Homework Answers
Add Answer to:
Carbon crystallizes in many different allotropes, two of them being cubic and hexagonal diamond. Explain the...
1. Write two different theories for the enzyme reaction mechanism. Explain the difference(s) between them. 2....
1. Write two different theories for the enzyme reaction mechanism. Explain the difference(s) between them. 2. Explain the two different mechanisms of reversible enzyme inhibition.
Two different air track carts are sliding to the right at 1.0 m/s. The leading cart...
Two different air track carts are sliding to the right at 1.0 m/s. The leading cart has a mass of 500g and the trailing cart has a mass of 200g. They are being held together by a string, but being pushed apart by a spring between the two carts. The spring between them has a spring constant of 150 N/m and is compressed 4.0 cm. At t=0, the string is snipped. What are the final velocities of both carts? Don’t...
Two people have different levels of education. The person with one more year of education earns...
Two people have different levels of education. The person with one more year of education earns more money. A researcher wants to measure the return to education. To do so, he looks at the earnings of these two people and calls the difference between them the “return to one year of education”. Explain carefully what is wrong with this method (you may use words, graphs, or any other method to explain this, but be clear about what you mean). Does...
explain answers Question 5 0/1 pts In a skills competition involving many different events, two particular...
explain answers
Question 5 0/1 pts In a skills competition involving many different events, two particular contestants were tied on each and every event always getting the identical scores. The scores they achieved, however, differed from event to event. For the competition, the correlation between the scores of these two contestants IS: Correct Answer inappropriate because the variable "event is categorical. You Answered impossible to determine without knowing the actual scores Question 17 0 1 pts Recall that when we...
You are standing a distance d (2m) directly in front of one of two identical speakers, being driven by the same signal generator, that are a distance h (5m) apart. You walk in the positive direction s...
You are standing a distance d
(2m) directly in front of one of two identical speakers, being
driven by the same signal generator, that are a distance h (5m)
apart. You walk in the positive direction starting at y=0 m, along
a line parallel to the line joining the two speakers. The speed of
sound is 340 m/s and the frequency is 170 HZ. As you walk, how many
times and where will you hear a maximum sound?
PROBLEM You...
1.Many different study designs are used in epidemiological research. State which study design is being used in each of t...
1.Many different study designs are used in epidemiological research. State which study design is being used in each of the scenarios described below. Your choices are as follows: *EXPERIMENTAL STUDY *RETROSPECTIVE COHORT STUDY *PROSPECTIVE COHORT STUDY *CASE-CONTROL STUDY *CROSS-SECTIONAL STUDY *ECOLOGICAL STUDY (a) A hospital-based study of antidepressant medication use during pregnancy and the risk of cleft lip in the offspring. Investigators are currently enrolling two groups of women: those who just delivered an infant with a cleft lip and...
There are two factories in a small town. Both of them emit carbon dioxide into the...
There are two factories in a small town. Both of them emit carbon dioxide into the air. Factory 1 currently emits 120 tons per month, whereas factory 2 currently emits 160 tons per month. The technology of each factory is different, so their costs of reducing emissions are different as well. The tables below show the costs of reducing emissions in increments of 20 tons per month for each factory: Factory 1 Total cost of reducing emissions by 20 tons/month...
5. Beta-lactam antibiotics are the major antibiotics. Where they act? Name two different types of antibiotics...
5. Beta-lactam antibiotics are the major antibiotics. Where they act? Name two different types of antibiotics which fall in this category. Explain where they resemble and where they differ. 6. Penicillin and Tetracycline; which one is narrow spectrum and which one is broad spectrum and why-explain. 7. There are two types of antibiotics which act on membrane. Name one member of each type. Why one antibiotics of this group exclusive works on fungus/protists and not on bacteria. 8. Many antibiotics...
9. Draw two different chair conformations of cyclohexanol, showing all hydropen atoms. Identify each position as...
9. Draw two different chair conformations of cyclohexanol, showing all hydropen atoms. Identify each position as axial or equatorial 10. Draw the most stable chair conformation of the following molecules, and estimate the amount of strain in each: (a) trans-1-Chloro-3-methylcyclohexane (b) cis-1-Ethyl-2-methylcyclohexane (c) cis-1-Bromo-4-ethylcyclohexane (d) cis-1-tert-Butylcyclohexane 11. Which isomer is more stable, cis-decalin or trans-decalin? Explain. 12. Glucose exists in two forms having a 36:64 ratio at equilibrium. Draw a skeletal structure of each, describe the difference between them and...
The detection temperature under load for two different types of plastic pipe is being investigated. Two...
The detection temperature under load for two different types of plastic pipe is being investigated. Two random samples of 15 pipe specimens are tested, and the detection temperatures observed are as follows (in °F): Type 1: 206, 188, 205, 187, 194, 193, 207, 185, 189, 213, 192, 210, 194, 178, 205 Type 2: 177, 197, 206, 201, 180, 176, 185, 200, 197, 192, 198, 188, 189, 203, 192 Do the data support the claim that the deflection temperature under load...
1. Write two different theories for the enzyme reaction mechanism. Explain the difference(s) between them. 2. Explain the two different mechanisms of reversible enzyme inhibition.
explain answers
Question 5 0/1 pts In a skills competition involving many different events, two particular contestants were tied on each and every event always getting the identical scores. The scores they achieved, however, differed from event to event. For the competition, the correlation between the scores of these two contestants IS: Correct Answer inappropriate because the variable "event is categorical. You Answered impossible to determine without knowing the actual scores Question 17 0 1 pts Recall that when we...
You are standing a distance d
(2m) directly in front of one of two identical speakers, being
driven by the same signal generator, that are a distance h (5m)
apart. You walk in the positive direction starting at y=0 m, along
a line parallel to the line joining the two speakers. The speed of
sound is 340 m/s and the frequency is 170 HZ. As you walk, how many
times and where will you hear a maximum sound?
PROBLEM You...
5. Beta-lactam antibiotics are the major antibiotics. Where they act? Name two different types of antibiotics which fall in this category. Explain where they resemble and where they differ. 6. Penicillin and Tetracycline; which one is narrow spectrum and which one is broad spectrum and why-explain. 7. There are two types of antibiotics which act on membrane. Name one member of each type. Why one antibiotics of this group exclusive works on fungus/protists and not on bacteria. 8. Many antibiotics...
9. Draw two different chair conformations of cyclohexanol, showing all hydropen atoms. Identify each position as axial or equatorial 10. Draw the most stable chair conformation of the following molecules, and estimate the amount of strain in each: (a) trans-1-Chloro-3-methylcyclohexane (b) cis-1-Ethyl-2-methylcyclohexane (c) cis-1-Bromo-4-ethylcyclohexane (d) cis-1-tert-Butylcyclohexane 11. Which isomer is more stable, cis-decalin or trans-decalin? Explain. 12. Glucose exists in two forms having a 36:64 ratio at equilibrium. Draw a skeletal structure of each, describe the difference between them and...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago