Homework Answers
Add Answer to:
Covalent Compounds QUESTIONN ANSER One of the uses of hydrazine, N,H, is as a rocket fuel....
15. (10 pts.) Hydrazine (N,Ha) is commonly used as rocket fuel. It reacts with oxygen according...
15. (10 pts.) Hydrazine (N,Ha) is commonly used as rocket fuel. It reacts with oxygen according to the balanced chemical equation: N2H4(g) + 302(g) + 2N02(g) + 2H20(1) 70.5 g of Hydrazine (N,Ha) is reacted with 195.3 g of Oz to test the thermodynamics of the reaction. MAKE SURE TO SHOW ALL OF YOUR WORK Compound Molecular Weight (g/mol) N2H4 32.06 0 32.00 NOZ 46.01 a. Identify the limiting reactant: b. How many grams of NO, should be produced in...
Please answer the questions too. Thanks. 4. What is used for naming covalent compounds that is...
Please answer the questions too. Thanks.
4. What is used for naming covalent compounds that is not used for lonic compound naes Procedures: 1. Complete Table A "Electron Dot Structures" using the given examples 2. Complete Table B "Physical Properties of lonic Compounds using text book as the reference. 3. Complete Table C "Formulas of lonic Compounds." Determine the oxidation mumber or valence of each ion, then determine the chemical formula so that the compounds have a balance, zero net...
Did I do this correctly? 21. Name and draw the product of the following reaction: H...
Did I do this correctly?
21. Name and draw the product of the following reaction: H NO2 O Tupac Name: 1- (2.4 -Dinitroprenyl)- isopropyli denenud razia ch3 NO2 + HEN H3C "CH3 .C NO2 "N-N CH3 "NO2 Acetone 2,4-Dinitrophenyl- hydrazine Acetone 2,4- Ginitropnery) hydrazine 22. Draw the product of the following reaction: Connor name CH3 CHE CH3C=CHCCHE H2NNH2 CH3-ċ=CH-CH₂-CH3 KOH at CH3 23. Draw the product of the following reaction: 1. CH_MBt, ether 2.H30* 24. What is the order of...
Name the following carbonyl I compounds Please help with H., I., J. CH2CH3 CH CH,C= N...
Name the following carbonyl I compounds Please help with H., I.,
J.
CH2CH3 CH CH,C= N 2 CH3 CH2CH2CH3
Fuel: 0.84C12H26+0.11C7H8+0.05C2H5OH Pressure ratio: rp = 16.7 Equivalence ratio: φ = 0.38 The fuel is a three-fuel blend of: Name Chemical Formula h¯◦f n-dodecane C12H26. −35...
Fuel: 0.84C12H26+0.11C7H8+0.05C2H5OH Pressure ratio: rp = 16.7 Equivalence ratio: φ = 0.38 The fuel is a three-fuel blend of: Name Chemical Formula h¯◦f n-dodecane C12H26. −352,100 kJ/kmol toluene C7H8 12,178 kJ/kmol ethanol C2H5OH −277,507 kJ/kmol For the inlet air conditions, use a temperature of 280 K and a pressure of 100 kPa. a) Calculate the net engine power for an air mass flow rate of 50 kg/s. • Except during combustion, assume that the working fluid is air, but account...
Directions: Write the formula or name of the following compounds in the space provided. (Please note...
Directions: Write the formula or name of the following compounds in the space provided. (Please note that some of these compounds do not exist as a stable substance in nature, however the following should serve as a practice exercise in nomenclature.) If provided the name, then you must write the formula. If provided the formula, then you must write the correct name. Indicate IUPAC names only. NOTE: IF EVEN ONE PROBLEM IS LEFT UNANSWERED, YOU WILL RECEIVE ZERO (0) POINTS...
Which of the following compounds are the correct intermediates? Mel excess Ago, H,0 EN N No...
Which of the following compounds are the correct intermediates? Mel excess Ago, H,0 EN N No VI a) I, II, VI b) II, III, VI c) I, III, V e) I, III, VI, V d) II, VI 3. Which one of the following products is the most suitable for the reaction below? H2N- NH Product NaOEt OH NH C
5) (8 pts) Arrange the following compounds from most acidic through neutral to most basic. Briefly...
5) (8 pts) Arrange the following compounds from most acidic through neutral to most basic. Briefly explain your reasoning. 7) (15 pts) a) Write out the 3-step arrow pushing mechanism showing how 1-pentene is hydrated to make 2-pentanol. b) Draw the other 2 alkenes (don't forgel cis/trans isomers!) that could also be hydrated to make 2-pentanol. Briefly explain why 1-pentene is the best choice. II, II,O a) heat Acidic Neutral Basic 6) (18 pts) Consider the Fischer projections of the...
Compoumas at mignt result from the combination of these metals and nonmetals. Name these compounds. Name...
Compoumas at mignt result from the combination of these metals and nonmetals. Name these compounds. Name one ionic compound that contains only nonmetallic elements. Name one ionic compound that contains a polyatomic cation and a polyatomic anion (see Table 2.3). 9.9 9.10 An ionic bond is formed between a cation A and an anion B". How would the 9.15 energy of the ionic bond [see Equation (9.2)] be affected by the following changes? (a) doubling the radius of A*, (b)...
Which one of the following is the conjugate base of NH_3? H^+ NH_4^+ NH_2^- N^3. Which...
Which one of the following is the conjugate base of NH_3? H^+ NH_4^+ NH_2^- N^3. Which of the following best describes the relationship between the following two structures? different compounds with different constitutions identical compounds constitutional isomers resonance structures What is the formal charge on the carbon atom? -1 -2 +1 0 What is the formal charge on the oxygen atom in the structure below? +1 -1 0 +2
15. (10 pts.) Hydrazine (N,Ha) is commonly used as rocket fuel. It reacts with oxygen according to the balanced chemical equation: N2H4(g) + 302(g) + 2N02(g) + 2H20(1) 70.5 g of Hydrazine (N,Ha) is reacted with 195.3 g of Oz to test the thermodynamics of the reaction. MAKE SURE TO SHOW ALL OF YOUR WORK Compound Molecular Weight (g/mol) N2H4 32.06 0 32.00 NOZ 46.01 a. Identify the limiting reactant: b. How many grams of NO, should be produced in...
Please answer the questions too. Thanks.
4. What is used for naming covalent compounds that is not used for lonic compound naes Procedures: 1. Complete Table A "Electron Dot Structures" using the given examples 2. Complete Table B "Physical Properties of lonic Compounds using text book as the reference. 3. Complete Table C "Formulas of lonic Compounds." Determine the oxidation mumber or valence of each ion, then determine the chemical formula so that the compounds have a balance, zero net...
Did I do this correctly?
21. Name and draw the product of the following reaction: H NO2 O Tupac Name: 1- (2.4 -Dinitroprenyl)- isopropyli denenud razia ch3 NO2 + HEN H3C "CH3 .C NO2 "N-N CH3 "NO2 Acetone 2,4-Dinitrophenyl- hydrazine Acetone 2,4- Ginitropnery) hydrazine 22. Draw the product of the following reaction: Connor name CH3 CHE CH3C=CHCCHE H2NNH2 CH3-ċ=CH-CH₂-CH3 KOH at CH3 23. Draw the product of the following reaction: 1. CH_MBt, ether 2.H30* 24. What is the order of...
Name the following carbonyl I compounds Please help with H., I.,
J.
CH2CH3 CH CH,C= N 2 CH3 CH2CH2CH3
Which of the following compounds are the correct intermediates? Mel excess Ago, H,0 EN N No VI a) I, II, VI b) II, III, VI c) I, III, V e) I, III, VI, V d) II, VI 3. Which one of the following products is the most suitable for the reaction below? H2N- NH Product NaOEt OH NH C
5) (8 pts) Arrange the following compounds from most acidic through neutral to most basic. Briefly explain your reasoning. 7) (15 pts) a) Write out the 3-step arrow pushing mechanism showing how 1-pentene is hydrated to make 2-pentanol. b) Draw the other 2 alkenes (don't forgel cis/trans isomers!) that could also be hydrated to make 2-pentanol. Briefly explain why 1-pentene is the best choice. II, II,O a) heat Acidic Neutral Basic 6) (18 pts) Consider the Fischer projections of the...
Compoumas at mignt result from the combination of these metals and nonmetals. Name these compounds. Name one ionic compound that contains only nonmetallic elements. Name one ionic compound that contains a polyatomic cation and a polyatomic anion (see Table 2.3). 9.9 9.10 An ionic bond is formed between a cation A and an anion B". How would the 9.15 energy of the ionic bond [see Equation (9.2)] be affected by the following changes? (a) doubling the radius of A*, (b)...
Which one of the following is the conjugate base of NH_3? H^+ NH_4^+ NH_2^- N^3. Which of the following best describes the relationship between the following two structures? different compounds with different constitutions identical compounds constitutional isomers resonance structures What is the formal charge on the carbon atom? -1 -2 +1 0 What is the formal charge on the oxygen atom in the structure below? +1 -1 0 +2
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago