Homework Answers
Solution:- As the 3'- hydroxyl group Attacks the alpha-phosphorus group on an incoming nucleotide. so, 1st option is correct.
Add Answer to:
In transcription, the 3'-hydroxyl group of the growing RNA strand: attacks the alpha-phosphorous group of the...
What is the importance of the 2′ hydroxyl group in the ribose sugar of an RNA...
What is the importance of the 2′ hydroxyl group in the ribose sugar of an RNA molecule? Check all that apply. View Available Hint(s) Hint 1. Properties of an hydroxyl groupopened hint A hydroxyl group has the formula OH. Water, alcohols, carboxylic acids, and other hydroxy-containing compounds can be deprotonated owing to the high electronegativity of oxygen, resulting in a stable conjugate base. Hydroxy-containing compounds are also able to form hydrogen bonds, which lead to higher boiling and melting points...
1) RNAi or dsRNA-mediated RNA interference is an example of a broader phenomenon that occurs widely...
1) RNAi or dsRNA-mediated RNA interference is an example of a broader phenomenon that occurs widely in eukaryotes called __________. a) RNA activation b) RNA ascension c) RNA translation d) RNA silencing e) RNA charging 2) Which of the following is an RNA nucleotide? A phosphate group, thymine and ribose A phosphate group, guanine and deoxyribose Cytosine and ribose. Uracil and deoxyribose None of the above 3) You are looking at an electron micrograph of several transcriptional units for rRNA....
In rho-dependent transcription termination: the formation of a hairpin in the transcribed mRNA causes RNA polymerase...
In rho-dependent transcription termination: the formation of a hairpin in the transcribed mRNA causes RNA polymerase to pause, facilitating termination. rho binds the mRNA, and when it makes contact with RNA polymerase, it assists with the removal of the mRNA from the DNA template. the rho factor binds to the -10 consensus sequence located in the promoter region to terminate transcription. a site within the poly(A) tail is cleaved which signals termination. the 3' untranslated region (3" UTR) is synthesized....
Unwinds DNA strand to make replication fork. Adds free nucleotides to the growing daughter DNA strands...
Unwinds DNA strand to make replication fork. Adds free nucleotides to the growing daughter DNA strands Adds short pieces of RNA to help DNA polymerase start Removes RNA and replaces with DNA Fuses or "glues" fragments of DNA together Proofreads or edits the DNA, checking for mistakes Given the following, DNA Sequence, what is the new daughter strand? (Did you label the 5' and 3' ends?) What is the name of the "fragments" of DNA on the lagging strand after...
Which of the following statements is FALSE? Nucleotides are only ever linked to one another 5’...
Which of the following statements is FALSE? Nucleotides are only ever linked to one another 5’ to 3’ DNA can contain Uracil as a result of a chemical reaction MutS/MutL only works to repair the lagging strand of synthesis Alternative splicing happens in every eukaryotic gene All of these statements are false The protein that phosphorylates the CTD to initiate transcription is called EF-Tu eIF4 TFIID TFIIH RNA polymerase Which of these enzymatic activities in DNA replication require the input...
Which of the following is a chemical or structural characteristic of RNA? The RNA sugar is...
Which of the following is a chemical or structural characteristic of RNA? The RNA sugar is ribose, which has an OH group on the 2' carbon. O RNA is usually a single-stranded molecule. The bases in RNA include uracil instead of thymine. RNA molecules are generally shorter in length compared DNA macromolecules. All of the above are either a chemical or structural characteristic of RNA. Which of these sequences could form a hairpin? 5' GGGGTTTTCCCC 3' 5' AAAAAAAAAAAA 3' 5'...
where does transcription begin 3. List the major types of RNA and include what they code...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
Below is a diagram of a transcription unit and the mRNA made from the transcription unit:...
Below is a diagram of a transcription unit and the mRNA made from the transcription unit: A H TTGACA DNA TATAAT -35 B -10 С D - Start codon Stop codon mRNA 5' 3' E F G Is this a prokaryotic or eukaryotic transcription unit? prokaryotic What is the name of the cofactor required for RNA polymerase to bind to the promoter? Which letters on the above diagram correspond to the following structures? Promoter Pribnow box Non-template strand Transcriptional start...
13. Why are ribonucleoside triphosphates the monomers required for RNA synthesis rather than ribonucleoside monophosphates? A....
13. Why are ribonucleoside triphosphates the monomers required for RNA synthesis rather than ribonucleoside monophosphates? A. Only ribonucleoside triphosphates contain the sugar ribose. B. Ribonucleoside triphosphates have low potential energy, making the polymerization reaction endergonic. C. Ribonucleoside triphosphates have high potential energy, making the polymerization reaction exergonic. D. Ribonucleoside monophosphates cannot form complementary base pairs with the DNA template. E. Ribonucleoside triphosphates are not used, rather all use deoxyriboside triphosphates. 14. How is a mutation in a bacterial cell that...
29. The initiator RNA attaches at the ribosome's site. A. A B. translocon C. E DP...
29. The initiator RNA attaches at the ribosome's site. A. A B. translocon C. E DP E. O 30. Which one of the following, if missing, would usually prevent translation from starting? A. one of several exons in a mRNA B. poly-A tail C. AUG codon D. spliceosome E. RNA polymerase 31. Which of the following statements about DNA synthesis is true? A. Nucleotides are added in a random fashion to single-stranded DNA. B. DNA polymerase adds dNTP monomers in...
In rho-dependent transcription termination: the formation of a hairpin in the transcribed mRNA causes RNA polymerase to pause, facilitating termination. rho binds the mRNA, and when it makes contact with RNA polymerase, it assists with the removal of the mRNA from the DNA template. the rho factor binds to the -10 consensus sequence located in the promoter region to terminate transcription. a site within the poly(A) tail is cleaved which signals termination. the 3' untranslated region (3" UTR) is synthesized....
Unwinds DNA strand to make replication fork. Adds free nucleotides to the growing daughter DNA strands Adds short pieces of RNA to help DNA polymerase start Removes RNA and replaces with DNA Fuses or "glues" fragments of DNA together Proofreads or edits the DNA, checking for mistakes Given the following, DNA Sequence, what is the new daughter strand? (Did you label the 5' and 3' ends?) What is the name of the "fragments" of DNA on the lagging strand after...
Which of the following is a chemical or structural characteristic of RNA? The RNA sugar is ribose, which has an OH group on the 2' carbon. O RNA is usually a single-stranded molecule. The bases in RNA include uracil instead of thymine. RNA molecules are generally shorter in length compared DNA macromolecules. All of the above are either a chemical or structural characteristic of RNA. Which of these sequences could form a hairpin? 5' GGGGTTTTCCCC 3' 5' AAAAAAAAAAAA 3' 5'...
where does transcription begin
3. List the major types of RNA and include what they code for, their function in the cell and which type is translated. 4. If a bacterial protein has 2,500 amino acids long, how many nucleotide pairs long is the ger sequence that codes for it? 5. Where does transcription begin? 6. What is the template and nontemplate strands of DNA? 7. Why is only one strand transcribed, and is the same strand of DNA always...
Below is a diagram of a transcription unit and the mRNA made from the transcription unit: A H TTGACA DNA TATAAT -35 B -10 С D - Start codon Stop codon mRNA 5' 3' E F G Is this a prokaryotic or eukaryotic transcription unit? prokaryotic What is the name of the cofactor required for RNA polymerase to bind to the promoter? Which letters on the above diagram correspond to the following structures? Promoter Pribnow box Non-template strand Transcriptional start...
13. Why are ribonucleoside triphosphates the monomers required for RNA synthesis rather than ribonucleoside monophosphates? A. Only ribonucleoside triphosphates contain the sugar ribose. B. Ribonucleoside triphosphates have low potential energy, making the polymerization reaction endergonic. C. Ribonucleoside triphosphates have high potential energy, making the polymerization reaction exergonic. D. Ribonucleoside monophosphates cannot form complementary base pairs with the DNA template. E. Ribonucleoside triphosphates are not used, rather all use deoxyriboside triphosphates. 14. How is a mutation in a bacterial cell that...
29. The initiator RNA attaches at the ribosome's site. A. A B. translocon C. E DP E. O 30. Which one of the following, if missing, would usually prevent translation from starting? A. one of several exons in a mRNA B. poly-A tail C. AUG codon D. spliceosome E. RNA polymerase 31. Which of the following statements about DNA synthesis is true? A. Nucleotides are added in a random fashion to single-stranded DNA. B. DNA polymerase adds dNTP monomers in...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 9 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 59 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago