1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate...

Question

Question

1.. How would you formally name the compound [Cu(NH₃)₄]SO_4*H₂O prepared in this laboratory?

A.		tetraaminesulfatecopper monohydrate
B.		aminecopper(I) sulfate monohydrate
C.		tetraaminecopper(II) sulfate monohydrate
D.		tetraaminecopper(I) sulfate monohydrate

Answer 1

Answer #1

() Finst name the caton beforte aniom hơn: Name the laands4m stin alphabe Healorden, then the mehal ahooi Hence name sf the z

Answer 2

Similar Homework Help Questions

What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O...

What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O ?
Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its...

Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its complex ion is: The charge on its complex ion is: The chemical formula for its ligand is: Is the ligand an ion or a molecule? The charge on the ligand is: The chemical symbol for its transition metal is: The oxidation state on its transition metal is: Counter ions in a coordination compound serve to balance the charge on the complex ion. The chemical...
1. Calculate the theoretical yields of the compounds to be prepared in this experiment. The metal...

1. Calculate the theoretical yields of the compounds to be prepared in this experiment. The metal ion in both cases is the limiting reagent. Hint: Find the number of moles of Cu(II) in the sample of CuSO4 5H20 that you used. That will equal the number of moles of [Cu(NH3)4] SO4 H20 that could theoretically be prepare. Proceed in a similar way for the synthesis involving Co(II). a. b. 2.How could you establish that the metal ion is the limiting...

1. Calculate the mass of copper(II) sulfate pentahydrate (CuSO4.5H2O) needed to prepare 1.50 grams ol tetramminecopper...

1. Calculate the mass of copper(II) sulfate pentahydrate (CuSO4.5H2O) needed to prepare 1.50 grams ol tetramminecopper (II) sulfate monohydrate (Cu(NH3)4] SO4 H2O according to the overall reaction on the first page of the lab. The overall net equation for the reaction is: Cu(H2O)2]SO4+H2O (aq) + 4 NH3 (aq) → [Cu(NH3)4]SO4+H2O + +4 H20 و اما الدم
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)

Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
Correctly name the following complexes: a). [Co(NH3)6]Br3 b). K3[FeF6] c). [Cu(OH2)4](SO4)

Correctly name the following complexes: a). [Co(NH3)6]Br3 b). K3[FeF6] c). [Cu(OH2)4](SO4)

5. Name the following compounds: a) [CuCl4)? b) [Cr(H2O)(NH3)]*2 c) [Cr(H2O) (NH3)]SO4 d) K3 [Fe(CN)6]

5. Name the following compounds: a) [CuCl4)? b) [Cr(H2O)(NH3)]*2 c) [Cr(H2O) (NH3)]SO4 d) K3 [Fe(CN)6]
Name the following compounds: 5. a) CuCla]2 b) Cr(H20)(NH3)]2 c) [Cr(H2O)4(NH)] SO4 d) K3[Fe(CN)6]

Name the following compounds: 5. a) CuCla]2 b) Cr(H20)(NH3)]2 c) [Cr(H2O)4(NH)] SO4 d) K3[Fe(CN)6]
Which of the following equations are balanced? (i) 2 Al + 3 H2SO4 --> Al2(SO4)3 +...

Which of the following equations are balanced? (i) 2 Al + 3 H2SO4 --> Al2(SO4)3 + 3 H2 (ii) Cl2 + NaI --> NaCl + I2 (iii) C2H6O + 7 O2 --> 2 CO2 + 3 H2O (iv) 3 Cu + 7 HNO3 --> 3 Cu(NO3)2 + 2 NO + 4 H2O (v) 2 NH3 + 3 CuO --> 3 Cu + 3 H2O + N2 Select one: a. i, iii and v b. i and v c. iii and...

A) Consistent with vanadium being a transition metal, the name for VSO4 should be: (Sulfate SO4...

A) Consistent with vanadium being a transition metal, the name for VSO4 should be: (Sulfate SO4 has a -2 charge as a polyatomic ion) A. vanadium sulfide B. vanadium (II) sulfate C. vanadium sulfur tetraoxide D. vanadium (I) sulfate E. vanadium (I) sulfite -------------------------------------------------------------------------------------------------------------