What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O...
Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its complex ion is: The charge on its complex ion is: The chemical formula for its ligand is: Is the ligand an ion or a molecule? The charge on the ligand is: The chemical symbol for its transition metal is: The oxidation state on its transition metal is: Counter ions in a coordination compound serve to balance the charge on the complex ion. The chemical...
1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate B. aminecopper(I) sulfate monohydrate C. tetraaminecopper(II) sulfate monohydrate D. tetraaminecopper(I) sulfate monohydrate
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
Correctly name the following complexes: a). [Co(NH3)6]Br3 b). K3[FeF6] c). [Cu(OH2)4](SO4)
NH3(g) and CuO(s) react to form Cu(s), H2O(l) and N2(g). What is the theoretical yield of Cu(s) in moles if the percent yield of Cu(s) is 86.0% and 7.00 grams of Cu(s) forms?
1. Calculate the mass of copper(II) sulfate pentahydrate (CuSO4.5H2O) needed to prepare 1.50 grams ol tetramminecopper (II) sulfate monohydrate (Cu(NH3)4] SO4 H2O according to the overall reaction on the first page of the lab. The overall net equation for the reaction is: Cu(H2O)2]SO4+H2O (aq) + 4 NH3 (aq) → [Cu(NH3)4]SO4+H2O + +4 H20 و اما الدم
2. Calculate the volume of 15.0M ammonia (NH3) needed to prepare 1.50 grams of tetramminecopper (II) sulfate monohydrate [Cu(NH3)4]sO4 H2O according to the overall reaction on the first page of the lab. calaboorhance at 740 nm calculate the enerav of one photon overall net equation for the reaction is: Cu(H2O)4] SO4 H2O (aq) + 4 NH3 (aq)-[Cu(NH3)4]SO4 H2O + +4 H2O ()
The deep blue compound Cu(NH3)4SO4 is made by the reaction of copper(II) sulfate and ammonia. CuSO4(aq) + 4NH3(aq) → Cu(NH3)4SO4(aq) If you use 47.0 g of CuSO4 and excess NH3, what is the theoretical yield of Cu(NH3)4SO4? If you isolate 38.2 g of Cu(NH3)4SO4, what is the percent yield of Cu(NH3)4SO4? ______ g Cu(NH3)4SO4 _______ %
5. Name the following compounds: a) [CuCl4)? b) [Cr(H2O)(NH3)]*2 c) [Cr(H2O) (NH3)]SO4 d) K3 [Fe(CN)6]
How do I find the percent yield of Cu(NH3)4SO4xH2O if the theoretical yield of Cu(NH3)4SO4xH2O is 10.3g? the limiting reagent is 10g CuSO4x5H20