Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
The reaction is:
Cu + H2SO4 —> H2O + SO2 + CuSO4
Balance S:
Cu + 2 H2SO4 —> H2O + SO2 + CuSO4
Balance H:
Cu + 2 H2SO4 —> 2 H2O + SO2 + CuSO4
The equation is now balanced
Answer:
Cu + 2 H2SO4 —> 2 H2O + SO2 + CuSO4
Balance this equation and how you did it: Cu+H2(SO4)=H2O+SO2+Cu(SO4)
Determine the products of the following reactions. After, balance them: a) Fe2(SO4)3 + H2O + SO2 + KMnO4 = b) Fe2(SO4)3 + H2O + SO2 + KCr2O7 = c) Fe2(SO4)3 + H2O + SO2 + H2O2 = d) What would the above 3 reactions look like if you added KSCN? Write the balanced equations for them. *these were all apart of a chem lab in order to detect the presence of Fe+2 ions* *these are redox reactions*
Balance the following equation: Al(s) + KOH(aq) + H2SO4(aq) + H2O(l) ---> KAl(SO4)2 * 12 H2O(s) + H2(g)
Given: Cu(SO4).5(H2O) + 4 NH3 ----> Cu(NH3)4(SO4). H2O + 4 H2O The chemical formula for its complex ion is: The charge on its complex ion is: The chemical formula for its ligand is: Is the ligand an ion or a molecule? The charge on the ligand is: The chemical symbol for its transition metal is: The oxidation state on its transition metal is: Counter ions in a coordination compound serve to balance the charge on the complex ion. The chemical...
Cu + HNO3 ---> Cu(NO3)2 + H2O + NO Balance the Equation
1.. How would you formally name the compound [Cu(NH3)4]SO4*H2O prepared in this laboratory? A. tetraaminesulfatecopper monohydrate B. aminecopper(I) sulfate monohydrate C. tetraaminecopper(II) sulfate monohydrate D. tetraaminecopper(I) sulfate monohydrate
30. In the following equation which one of the compounds is acting as an acid H2(SO4) + H2O --> HSO4- + H3O+ a. H2O (Incorrect) b. H2SO4 c. H3O+ d. HSO4- e. none of the above
What is the percent by mass of NH3 (% of NH3 ) in the compound [Cu(NH3)4]SO4.H2O ?
Please help me balance the equation: ___ Fe(NH4)2(SO4)2 · 6 H2O + ___ H2C2O4 + ___ K2C2O4 + ___ H2O2 → ___ K3Fe1(C2O4)3 * 6 H2O + ___ (NH4)2SO4 + ___ H2SO4 + ___ H2O (Hint given: Remember H2O2, an oxidizing agent, was used in the synthesis, so you’ll need to do a redox balance. Start with just the iron ions, balance the reaction, and then add the full formulas.)
10. For the equation 2 H2SO4 + 2 Al → 2 H2 + Al2(SO4)3, suppose you wished to prepare 28.7 grams of H2. How many grams of H2SO4 and of Al would you require so that all of the H2SO4 and Al were combined?
Balance the following ionic equation for a redox reaction, using whole number coefficients. MnO4-(aq)+SO2−3(aq)+H3O+(aq)⟶Mn2+(aq)+SO2−4(aq)+H2O(l) In the balanced equation, what is the coefficient for H2O? (this is the exact equation in the textbook)