Calculate the resting potential for sodium (Na+) if the ion concentration on the inside of the...
Calculate the resting potential for sodium (Na+) if the ion concentration on the inside of the cell is 1/10 of the concentration on the outside.Assume the temperature is 25 C, and therefore RT/zF = 59.8.
Homework Answers
Add Answer to:
Calculate the resting potential for
sodium (Na+) if the ion concentration on the inside of
the...
A polarized neuron in its resting state has A. high potassium & high sodium ion concentratio...
A polarized neuron in its resting state has A. high potassium & high sodium ion concentratio inside the cell membrane B. High potassium ion concentration on the outside of the cell membrane and high sodium ion concentration on the inside of the cell membrane C. High sodium and high potassium ion concentrations outside the cell membrane D. high sodium and high potassium ion concentrations outside the cell membrane
At resting membrane potential (-70mV), there are more sodium ions inside the cell than there are ...
At resting membrane potential (-70mV), there are more sodium ions inside the cell than there are outside the cell. True or False?
What is a resting potential? Is it positive or negative? The resting potential is mainly due...
What is a resting potential? Is it positive or negative? The resting potential is mainly due to the main _____-charged large molecules stuck inside the neuron. The Na+/K+ pump pushes Na+ _____ of the cell and K+ ____ of the cell (in or out for each ion) Where is K+ concentrated, inside or outside of the neuron? Where is Na+ concentrated, inside or outside of the neuron? The action potential starts with an rise in membrane voltage. This is due...
HW 11-1 Recall that the Na + concentration is significantly higher outside the cell than inside...
HW 11-1 Recall that the Na + concentration is significantly higher outside the cell than inside the cell. The symporter couples the "downhill" transport of two Na + ions into the cell to the "uphill" transport of glucose into the cell. If the Na + concentration outside the cell ( [ Na + ] out ) is 149 mM and that inside the cell ( [ Na + ] in ) is 19.0 mM, and the cell potential is −...
With respect to the membrane potential which of the following is NOT true? A. In resting...
With respect to the membrane potential which of the following is NOT true? A. In resting cells, the membrane potential is negative because sodium ions are less permeable than potassium ions. B. The resting potential of the nerve cell depends on voltage gated potassium channels C. While chloride is much more permeable than sodium, it adds relatively little to the negative membrane potential. D. The concentration of chloride inside/outside the cell is the reciprocal of the potassium concentration of the...
Question 49 1.67 pts Neurons have a negative resting potential. When they are conducting an action...
Question 49 1.67 pts Neurons have a negative resting potential. When they are conducting an action potential, the resting potential becomes more positive (depolarization) followed by a drop in the resting potential (repolarization). What is the order and direction of the ion movement responsible for these changes? Potassium (K+) rushes out, then sodium (Na+) rushes into the cell Chloride (Cl-) rushes out, then potassium (K) rushes into the cell Potassium (K+) rushes in, then sodium (Na+) rushes out of the...
A sodium ion electrode was calibrated by measuring the cell potentials of several standard Na+ solutions....
A sodium ion electrode was calibrated by measuring the cell potentials of several standard Na+ solutions. The other electrode was the SCE. The calibration data are shown in the following table. Log[Na+] Ecell (mV) -1 -165.6 0 -110.0 1 -51.8 2 6.5 3 64.5 a. Plot a calibration curve for these data. b. Determine the slope and intercept for the regression line of this plot. Is the response of this sodium electrode Nernstian? Explain. c. A 10.00mL aliquot of table...
1. If the membrane potential of sodium ions in a cell is equal to +60 mV,...
1. If the membrane potential of sodium ions in a cell is equal to +60 mV, what is its membrane potential for chloride ions if they are found in the exact same concentrations as sodium? Give your answer in mV. 2. Given a cell membrane with the following parameters- Ion Extracellular concentration (mmol/L) Intracellular concentration (mmol/L) Permeability K+ 10 150 1 Na+ 140 15 0.04 Cl- 100 7 0.45 calculate the membrane potential of the cell in mV. (Round your...
Calculate the sodium ion (Na^+) concentration when 30.0 mL of 0.25 sodium carbonate, Na_2 CO_3, solution...
Calculate the sodium ion (Na^+) concentration when 30.0 mL of 0.25 sodium carbonate, Na_2 CO_3, solution is added to 50.0 mL of 0.030 M sodium chloride, NaCl, solution. a. 0.103 M b. 0.206 M c. 0.1 13 M d. 0.225 M e. None of the above
< Question 10 of 18 > “To calculate AG for an ion, you simply add the...
< Question 10 of 18 > “To calculate AG for an ion, you simply add the equations for the chemical and electrostatic components together. AG = RT IN (6) +ZFV. Say you are trying to move Ca²+ into a frog muscle cell through its ionotropic Ach receptors after they are stimulated by the neurotransmitter. For a typical frog muscle cell, the concentration of Ca²+ is 0.100 mM inside the cell and 2.10 mM outside the cell. As mentioned earlier, a...
Question 49 1.67 pts Neurons have a negative resting potential. When they are conducting an action potential, the resting potential becomes more positive (depolarization) followed by a drop in the resting potential (repolarization). What is the order and direction of the ion movement responsible for these changes? Potassium (K+) rushes out, then sodium (Na+) rushes into the cell Chloride (Cl-) rushes out, then potassium (K) rushes into the cell Potassium (K+) rushes in, then sodium (Na+) rushes out of the...
Calculate the sodium ion (Na^+) concentration when 30.0 mL of 0.25 sodium carbonate, Na_2 CO_3, solution is added to 50.0 mL of 0.030 M sodium chloride, NaCl, solution. a. 0.103 M b. 0.206 M c. 0.1 13 M d. 0.225 M e. None of the above
< Question 10 of 18 > “To calculate AG for an ion, you simply add the equations for the chemical and electrostatic components together. AG = RT IN (6) +ZFV. Say you are trying to move Ca²+ into a frog muscle cell through its ionotropic Ach receptors after they are stimulated by the neurotransmitter. For a typical frog muscle cell, the concentration of Ca²+ is 0.100 mM inside the cell and 2.10 mM outside the cell. As mentioned earlier, a...
Most questions answered within 3 hours.
-
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 11 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 8 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 11 hours ago