|
For each of the following reactions choose the expression that represents Kc for the reaction: 1) TlCl3(s) a) Kc = [TlCl3]/[TlCl][Cl2] b) Kc = [TlCl][Cl2]/[TlCl3] c) Kc = [Cl2] 2) CuCl42-(aq) a) Kc = [Cu2+][Cl-]4/[CuCl42-] b) Kc = [Cu2+][Cl-]/[CuCl42-] c) Kc = [CuCl42-]/[Cu2+][Cl-] 3) 3O2(g) a) Kc = [O2]3/[O3]2 b) Kc = [O3]3/[O2]2 c) Kc = [O3]2/[O2]3 4) 4H3O+(aq) +
2Cl-(aq) + MnO2(s)
a) Kc = [Mn2+][Cl2]/[H3O+]4[Cl-]2 b) Kc = [Mn2+][H2O]6[Cl2]/[H3O+]4[Cl-]2[MnO2] c) Kc = [Mn2+][H2O][Cl2]/[H3O+][Cl-]2[MnO2] |
TlCl(s) + Cl2(g)Homework Answers
![For a general reaction, a e + bB - cC + dD Kc = [c] e [o [A]a[B] for solids and liquids, concentration is 1. B 00 TIC13 (5)](http://img.homeworklib.com/questions/604f0490-cf71-11eb-a341-87f3de6385e1.png?x-oss-process=image/resize,w_560)
Add Answer to:
For each of the following reactions choose the expression that
represents Kc for the reaction:
1)...
1. Classify each of the following as a combination, decomposition, single replacement, double replacement, or combustion...
1. Classify each of the following as a combination,
decomposition, single replacement, double replacement, or
combustion reaction:
_______________
2 Fe2O3(s) + 3 C(s)
3 CO2(g) + 4 Fe(s)
_______________
2 KClO3(s)
2 KCl(s) + 3 O2(g)
_______________
2 C3H6(g) + 9 O2(g)
6 CO2(g) + 6H2O(g) + energy
_______________
N2(g) + 2 O2(g)
2 NO2(g)
_______________
BaCl2(aq) + K2SO4(aq)
BaSO4(s) + 2 KCl(aq)
2. Identify as an oxidation or reduction reaction:
Oxidation
Reduction
O2 + 4 e-
2...
Given the following electrolytic cell: The current is discharged into the electrolytic cell containing the solution CuS...
Given the following electrolytic cell:
The current is discharged into the electrolytic cell containing
the solution CuSO4(aq) 1.0M at 25 oC. During
the operation of the cell, copper Cu(s) is deposited on
one electrode and oxygen O2(g) gas is released, near the
second electrode.
O2(g) + 4H3O+(aq) +
4e-
6H2O(l) Eo= 1.23V
Cu2+(aq) + 2e- Cu(s)
Eo= 0.34V
A. The current in the cell is 1.5 amperes. The current is
streamed in 40 minutes.
i. Calculate the mass of copper...
1. Using the boxes below, balance the following chemical equations and fill in the blanks with...
1. Using the boxes below, balance the following chemical
equations and fill in the blanks with the coefficient and the
tables .
a) _____ Al(s) + _____ Cl2(g)
_____ AlCl3(s)
Reactants
Products
Al
Al
Cl
Cl
b) ___ Cr2O3(s) + _____ CCl4(l)
____ CrCl3(s) + _____ COCl2(g)
Reactants
Products
Cr
Cr
O
O
C
C
Cl
Cl
C ) _____ NO2(g) + _____ H2(g)
____ NH3(g) + _____ H2O(g)
Reactants
Products
2. Continue working on balancing chemical equations...
Given the following electrolytic cell: The current is discharged into the electrolytic cell containing the solution CuSO4(aq) 1.0M at 25 oC. During the operation of the cell, copper Cu(s) is deposite...
Given the following electrolytic cell:
The current is discharged into the electrolytic cell containing
the solution CuSO4(aq) 1.0M at 25 oC. During
the operation of the cell, copper Cu(s) is deposited on
one electrode and oxygen O2(g) gas is released, near the
second electrode.
O2(g) + 4H3O+(aq) +
4e-
6H2O(l) Eo= 1.23V
Cu2+(aq) + 2e- Cu(s)
Eo= 0.34V
A. Write the direction of the flow of electrons in the
cell.
B. Write the electrolysis equation that occurs in the cell....
Calculate the cell potential for the following reaction as written at 25.00 °C, given that [Mg2...
Calculate the cell potential for the following reaction as written at 25.00 °C, given that [Mg2 ] = 0.774 M and [Sn2 ] = 0.0190 M. Standard reduction potentials can be found here. Reduction Half-Reaction Standard Potential Ered° (V) F2(g) + 2e– → 2F–(aq) +2.87 O3(g) + 2H3O+(aq) + 2e– → O2(g) + 3H2O(l) +2.076 Co3+(aq) + e– → Co2+(aq) +1.92 H2O2(aq) + 2H3O+(aq) + 2e– → 2H2O(l) +1.776 N2O(g) + 2H3O+(aq) + 2e– → N2(g) + 3H2O(l) +1.766 Ce4+(aq) + e– → Ce3+(aq)...
Given: 1) NaOH Na+(aq) + OH- (aq) 2) NaOH + H+ Cl-(aq) H2O(l) + Na+(aq) +...
Given: 1) NaOH Na+(aq) + OH- (aq) 2) NaOH + H+ Cl-(aq) H2O(l) + Na+(aq) + Cl-(aq) 3) Na+(aq) + OH-(aq) + H+(aq) + Cl-(aq) H2O(l) + Na+(aq) + Cl-(aq) Show that equations 1 and 3 can be added algebraically to give equation 2. We were unable to transcribe this imageWe were unable to transcribe this imageWe were unable to transcribe this image
Reaction A $$O3(g)+Cl(g)ClO(g)+O2(g) $$A=2.93×10−11 cm3molecule • s and Ea=2.16 kJmol...
Reaction A
$$O3(g)+Cl(g)ClO(g)+O2(g)
$$A=2.93×10−11 cm3molecule • s and
Ea=2.16 kJmol
Reaction B
$$O3(g)+NO(g)NO2(g)+O2(g)
$$A=2.34×10−12 cm3molecule •
s Ea=11.6 kJmol
On the basis of the frequency factors and activation energy
values above, calculate the rate constant for Reaction A at 298
K.
On the basis of the frequency factors and activation energy
values above, calculate the rate constant for Reaction B at 298
K.
We were unable to transcribe this imageWe were unable to transcribe this image
Write a balanced chemical equation for the following redox reaction MnO2 (s) + Ag (s) Ag+...
Write a balanced chemical equation for the following redox
reaction MnO2 (s) + Ag (s)
Ag+ (aq) + Mn2+ (aq)
We were unable to transcribe this imageAg+ (aq) + Mn2+ (aq) Write a balanced chemical equation for the following redox reaction MnO2 (s) + Ag (s) chemPad Help X.Xº = Greek -/1 points My Notes Ask Your Write a balanced chemical equation for the following redox reaction I (aq) + NO3- (aq) ► 12 (s) + NO (9) chemPad Help...
Question 3 of 10 Submit Balance the following chemical equation (if necessary): Na3PO4(aq) + NiCiz (aq)...
Question 3 of 10 Submit Balance the following chemical equation (if necessary): Na3PO4(aq) + NiCiz (aq) → Ni3(PO4)2 (s) + NaCl(aq) Reset 30,2 Reset 60 @ 1 2 3 4 5 6 800 (s) 0 (g) (aq) Nis(POA)2 Nacı Na PO. Niclz • x H20 Question 4 of 10 Submit Balance the following chemical equation (if necessary): C3H6(g) + O2(g) + CO2(g) + H2O(g) Reset 30,2 Reset 60 @ 123460089 (aq) (s) CO2 (1) H20 (g) Oz CsHo • «...
(Before you do the experiment) review, in the following equations for familiar reactions, write an R over the red...
(Before you do the experiment) review, in the following equations for familiar reactions, write an R over the reducing agent and an over sent At the right, indicate the change in oxidation mumber per atom for each element whose oxidation number changes. If there is no change, write in "no change in oxidation number Element oxidized Oxidation number increase per atom Oxidation number decrease per atom Element reduced Reaction 2 Al(s) + 3 Cl2(g) → 2 A13+ + 6 CI-...
1. Classify each of the following as a combination,
decomposition, single replacement, double replacement, or
combustion reaction:
_______________
2 Fe2O3(s) + 3 C(s)
3 CO2(g) + 4 Fe(s)
_______________
2 KClO3(s)
2 KCl(s) + 3 O2(g)
_______________
2 C3H6(g) + 9 O2(g)
6 CO2(g) + 6H2O(g) + energy
_______________
N2(g) + 2 O2(g)
2 NO2(g)
_______________
BaCl2(aq) + K2SO4(aq)
BaSO4(s) + 2 KCl(aq)
2. Identify as an oxidation or reduction reaction:
Oxidation
Reduction
O2 + 4 e-
2...
Given the following electrolytic cell:
The current is discharged into the electrolytic cell containing
the solution CuSO4(aq) 1.0M at 25 oC. During
the operation of the cell, copper Cu(s) is deposited on
one electrode and oxygen O2(g) gas is released, near the
second electrode.
O2(g) + 4H3O+(aq) +
4e-
6H2O(l) Eo= 1.23V
Cu2+(aq) + 2e- Cu(s)
Eo= 0.34V
A. The current in the cell is 1.5 amperes. The current is
streamed in 40 minutes.
i. Calculate the mass of copper...
1. Using the boxes below, balance the following chemical
equations and fill in the blanks with the coefficient and the
tables .
a) _____ Al(s) + _____ Cl2(g)
_____ AlCl3(s)
Reactants
Products
Al
Al
Cl
Cl
b) ___ Cr2O3(s) + _____ CCl4(l)
____ CrCl3(s) + _____ COCl2(g)
Reactants
Products
Cr
Cr
O
O
C
C
Cl
Cl
C ) _____ NO2(g) + _____ H2(g)
____ NH3(g) + _____ H2O(g)
Reactants
Products
2. Continue working on balancing chemical equations...
Given the following electrolytic cell:
The current is discharged into the electrolytic cell containing
the solution CuSO4(aq) 1.0M at 25 oC. During
the operation of the cell, copper Cu(s) is deposited on
one electrode and oxygen O2(g) gas is released, near the
second electrode.
O2(g) + 4H3O+(aq) +
4e-
6H2O(l) Eo= 1.23V
Cu2+(aq) + 2e- Cu(s)
Eo= 0.34V
A. Write the direction of the flow of electrons in the
cell.
B. Write the electrolysis equation that occurs in the cell....
Reaction A
$$O3(g)+Cl(g)ClO(g)+O2(g)
$$A=2.93×10−11 cm3molecule • s and
Ea=2.16 kJmol
Reaction B
$$O3(g)+NO(g)NO2(g)+O2(g)
$$A=2.34×10−12 cm3molecule •
s Ea=11.6 kJmol
On the basis of the frequency factors and activation energy
values above, calculate the rate constant for Reaction A at 298
K.
On the basis of the frequency factors and activation energy
values above, calculate the rate constant for Reaction B at 298
K.
We were unable to transcribe this imageWe were unable to transcribe this image
Write a balanced chemical equation for the following redox
reaction MnO2 (s) + Ag (s)
Ag+ (aq) + Mn2+ (aq)
We were unable to transcribe this imageAg+ (aq) + Mn2+ (aq) Write a balanced chemical equation for the following redox reaction MnO2 (s) + Ag (s) chemPad Help X.Xº = Greek -/1 points My Notes Ask Your Write a balanced chemical equation for the following redox reaction I (aq) + NO3- (aq) ► 12 (s) + NO (9) chemPad Help...
Question 3 of 10 Submit Balance the following chemical equation (if necessary): Na3PO4(aq) + NiCiz (aq) → Ni3(PO4)2 (s) + NaCl(aq) Reset 30,2 Reset 60 @ 1 2 3 4 5 6 800 (s) 0 (g) (aq) Nis(POA)2 Nacı Na PO. Niclz • x H20 Question 4 of 10 Submit Balance the following chemical equation (if necessary): C3H6(g) + O2(g) + CO2(g) + H2O(g) Reset 30,2 Reset 60 @ 123460089 (aq) (s) CO2 (1) H20 (g) Oz CsHo • «...
(Before you do the experiment) review, in the following equations for familiar reactions, write an R over the reducing agent and an over sent At the right, indicate the change in oxidation mumber per atom for each element whose oxidation number changes. If there is no change, write in "no change in oxidation number Element oxidized Oxidation number increase per atom Oxidation number decrease per atom Element reduced Reaction 2 Al(s) + 3 Cl2(g) → 2 A13+ + 6 CI-...
Most questions answered within 3 hours.
-
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 1 hour ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 1 hour ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 1 hour ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 1 hour ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 1 hour ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 1 hour ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 1 hour ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 1 hour ago -
Explain an understanding of services and protocols.
Explain the job of DNS.
Explain the three email...
asked 1 hour ago -
(As soon as possible) Balance each of the following equations
according to the half-reaction method:
H2O2(aq)...
asked 2 hours ago -
A thin rod with a mass of 3.5kg and a length L=1.5 m is oriented
horizontally....
asked 2 hours ago -
Inheritance pattern in BRCA 1
Describe the inheritance pattern of BRCA 1 Is it recessive or...
asked 2 hours ago