Question 35 1 pts What are the products of the reaction of the following reaction? CH-CH3-N-CH-CH3...
Question 32 1 pts What are the products of the following hydrolysis? CH3-CH -CH-E-N+-CH3 + H2O + HCI снуснған 8-н, сна CHỊCH-CH-Z-OH + CHÚNH,+ C CH=CH=CH22O + CHẠNH, CH3-CH4-CHz-C-OH+CH3NH2
Question 2 What are the products of the reaction shown? CH,CH,CON(CH), + Hot - heat + ? O A CH3CH3 + CO2 + (CH3)2NH2+ O B. CH3CH2OH + [HCONH(CH3)21+ c. [CH3CH2CONH(CH3)21+ + H20 OD. CH3CH2COOH + (CH3)2NH2+ O E products are not shown Question 3 Which of each of the following pairs of compounds has the higher boiling point? ICH,CH,CHNH or II CH,CH,CH,OH III CH CH NHCH,CH, or TV CH CH N(CH), O ALINE OBLIV ec, ODI, IV Question 4...
84. What two products are formed in the hydrolysis reaction shown below? heat CH-C-NHCHCH, + NaOH 0 CH, —C—OH A) + NHẠCH CHI B) CH3 -C-NH2 + Na+ "CH,CH; L. C) CH-C-NH, + CH,CH 0 D) CH,-0-0- Nat + NH CHỊCH __ + CH3-C-NH E) HOCH.CH
What statement is TRUE about the mechanism for the reaction shown here? CH(CH) COACH CHỊ(CH3CO,CH NaOH excess heat CH,(CH2)2CO CHỊ Water attacks the carbonyl carbon to form a tetrahedral intermediate The first step of the reaction involves protonation of the ester carbonyl oxygen. One of the products formed is CH3(CH2)2CO Na. Water deprotonates the alpha carbon.
Chem Concepts F19 <Ch 07 HW Problem 7.18 (CHỊ),NH+ H2O=(CH3)2NH3 + OH Use the Brønsted-Lowry definitions to identify the first compound in each equation as an acid or a base. (Hint: What is produced by the reaction?) acid base Submit Request Answer Part B C6H, NH, + HOẠCH, NH + OH- acid O base Submit Request Answer Part C CH, CHANH, + H2O +CGHỊ CHANH + OH acid
What is the mechanism for the following reaction? N' V CN CH3 Ph IZ Provide a mechanism for hydrolysis of the antibiotic penicillin under basic conditions. H₃C Ph CH₃ NaOH "ICO Na H2O Ph. Co Na . S. CH3 IN_CH3 N- moo Na
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
Question 3a) CH3 Br н,С. CH3 H Ph3P CH3 H n-Buli What is the name of the reaction above? 1 point Your answer Which of the following compounds is an intermediate in the reaction above? 1 point CH Ph Ph CH, OⓇ CH3 HCH₂ HC y PhPa HEC Ph-P-0 Ph CH₂ Ph-P-0 Phạ% CHỊ Ph Phen Phon A B с D Ο Α OB
What statement is TRUE about the mechanism for the reaction shown here? CHỊ(CH4)2COẠCH, CH,(CHỊ) CO,CH 2, CO,CH NAOH excess heat CHỊ(CH) CÓ CH, Water attacks the carbonyl carbon to form a tetrahedral intermediate. The first step of the reaction involves protonation of the ester carbonyl oxygen. One of the products formed is CH3(CH2)2CO2Na. Water deprotonates the alpha carbon.
1. Rewrite the completed reaction with the products formed. 2. Name the organic products formed. a) H-C + CH₃-CH ₂ OH H heat *** + CH3 CH 0 1-0-CH3 + NaOH heat CH₃ -C-O-CH₃ MUL + Hao o Il 6) CH₂ - CH2 - C-OH + NaOH -