For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Question

Question

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ

How much energy is needed to react excess B2O3 with 25.0 g of H2O

science chemistry

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

Answer:- Energy needed = 941.6 kJ

Solution:-

B₂O₃(s) + 3H₂O(g) ---> B₂H₆(g) + 3O₂(g) ΔH = 2035 kJ

This means 2035 kJ of energy is needed to react excess B₂O₃ with 25.0 g of H₂O

Lets convert 25.0 g of H₂O into moles

Number of moles = weight/molecular weight = 25/ 18.01 = 1.38812 moles

1 mole of B₂O₃ reacts with 3 mole of H₂O

so that

0.46271 mole of B₂O₃ reacts with 1.38812 mole of H₂O

Energy needed = 0.46271 * 2035

Energy needed = 941.6 kJ

Add a comment

Answer 2

Similar Homework Help Questions

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ
Applications 4.85 How many g of B_Ho will react with 3.00 mol of Oz? B2H6(1) +...

Applications 4.85 How many g of B_Ho will react with 3.00 mol of Oz? B2H6(1) + 302(8)—>B2O3(s) + 3H2O(l)
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=

QUESTION 13 How many grams 02 needed to react completely with 45.2 grams B2H6, according to...

QUESTION 13 How many grams 02 needed to react completely with 45.2 grams B2H6, according to the following balanced equation? B2H6 + 302 -> B2O3 + 3H20 1.93 g 4.959 0.05949 1579 3.08 9 0.4989 2.32 0.780 9
(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from th...

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from the elements as: 2B (s) + 3H2 (g) → B2H6 (g) Use the following data: 4B (s) + 3O2 (g) → 2B2O. (S) Δ? = -2546 kJ mol-1 B2H6 (g) + 3O2 (g) → B2O3 (s) + 3H2O (g) Δ? = -2035 kJ mol-1 2H2 (g) + O2 (g) → 2H2O (l) Δ? = -572 kJ mol-1 H2O (l) →...
CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ How much heat is released when a mixture of 8.26 g B2H7 and 8.80 g 02 is burned? heat released = kJ Submit Show Hints

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH a) This reaction is... Select one...

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH a) This reaction is... Select one or more: a. exothermic b. endothermic
Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of fo...

Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of formation: 12N2(g)+O2(g)→NO2(g), ΔH∘A=33.2 kJ 12N2(g)+12O2(g)→NO(g), ΔH∘B=90.2 kJ Express your answer with the appropriate units. Part B Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(g)→3O2(g)+B2H6(g), ΔH∘A=+2035 kJ 2B(s)+3H2(g)→B2H6(g), ΔH∘B=+36 kJ H2(g)+12O2(g)→H2O(l), ΔH∘C=−285 kJ H2O(l)→H2O(g), ΔH∘D=+44 kJ Express your answer with the appropriate units.
Consider the following balanced chemical equation: C2H5OH(l) + 3O2(g) → 2CO2(g) + 3H2O(l) a. How many...

Consider the following balanced chemical equation: C2H5OH(l) + 3O2(g) → 2CO2(g) + 3H2O(l) a. How many moles of CO2 form when 1.53 moles of C2H5OH react? moles CO2 b. How many moles of H2O form from the reaction of 1.53 moles of C2H5OH? moles H2O c. How many moles of CO2 form when 1.53 moles of H2O form? moles CO2 d. How many molecules of CO2 form when 1.53 moles of H2O form? × 10(Click to select)21222324 molecules CO2

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH c) If you add heat to...

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH c) If you add heat to the system, which of the following will occur? Check all that apply. Select one or more: a. the reaction will shift left b. the reaction will shift right c. [CH3CH2OHCH3CH2OH] will increase d. [H2OH2O] will decrease e. [O2O2] will decrease f. [CO2CO2] will increase

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Homework Answers

Add Answer to:
For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Post as a guest

Earn Coins

Calculate the enthalpy of the reaction 4B(s)+3O2(g)→2B2O3(s) given the following pertinent information: B2O3(s)+3H2O(...

Applications 4.85 How many g of B_Ho will react with 3.00 mol of Oz? B2H6(1) +...

Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 2...

QUESTION 13 How many grams 02 needed to react completely with 45.2 grams B2H6, according to...

(a) Diborane (B2H6) is a highly reactive borohydride that can be used as rocket fuel. Calculate Δ? for synthesis from th...

CHEMWORK Consider the reaction B2H6(g) +3 02(g) → B2O3(s) + 3 H2O(g) AH = -2035 kJ...

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH a) This reaction is... Select one...

Part A Calculate the enthalpy of the reaction 2NO(g)+O2(g)→2NO2(g) given the following reactions and enthalpies of fo...

Consider the following balanced chemical equation: C2H5OH(l) + 3O2(g) → 2CO2(g) + 3H2O(l) a. How many...

Given the following reaction: CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l)CH3CH2OH(l)+3O2(g)→2CO2(g)+3H2O(l) ∆H = –2200 kJ/mol CH3CH2OHCH3CH2OH c) If you add heat to...

For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Homework Answers

Add Answer to: For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...

Post as a guest

Earn Coins

Add Answer to:
For the reaction: B2O3 + 3H2O 3O2 +B2H6 H=2035KJ How much energy is needed to react...