Calculate the amount of ZnO(s) produced during the reaction when 4410 kJ of heat were produced.
2 ZnS(s) + 3 O2(g) → 2 ZnO(s) + 2 SO2(g) ΔH = _ 879 kJ
Options: 10.0 mole ZnO
5.00 mole ZnO
20.0 mole ZnO
0.399 mole ZnO
879 kJ of heat was released when 2 moles of ZnO was formed.
Amount of heat released for 1 mole of ZnO = 879/2
= 439.5 kJ of heat
Moles of ZnO formed = Total heat released/Heat released when 1 mole of ZnO formed
Moles of ZnO = 4410/439.5
= 10 moles
Answer = 10 mole ZnO
Calculate the amount of ZnO(s) produced during the reaction when 4410 kJ of heat were produced....
1. Calculate the amount of ZnO(s) produced during the reaction when 4410 kJ of heat were produced 2 ZnS + 3 02(8) 2 ZnO + 2 SO2(8) AH = - 879 kJ 2. The following equation is given: H29) + 1/2 026) → H20, AH = - 144 kJ What is the AH for this equation? 2 H,00) + 2 H2(g) + O2(6)
For the reaction below ΔH = -296 kJ per mole of SO2 formed. S(s) + O2(g) → SO2(g) (a) Calculate the quantity of heat released when 1.05 g of sulfur is burned in oxygen. (b) Calculate the quantity of heat released when 0.584 mol of sulfur is burned in air. (c) What quantity of energy is required to break up exactly 9 mol of SO2(g) into its constituent elements?
Given: C(s) + O2(g) ---> CO2(g) ΔH = −393.5 kJ/mol S(s) + O2(g) ---> SO2(g) ΔH = −296.8 kJ/mol C(s) + 2S(s) ---> CS2(ℓ) ΔH = +87.9 kJ/mol A) Calculate the standard enthalpy change for the following reaction CS2(ℓ) + 3O2(g) ---> CO2(g) + 2SO2(g) ΔH° rxn = -1075 kJ/mol B) Using the equation and standard enthalpy change for the reaction (from part A), calculate the amount of heat produced or consumed when 3.2 mol of CS2 reacts with excess...
Calculate the heat change, in kJ, if 8.7395x1012 ng of carbon dioxide were produced in the following reaction: C(s) + O2(g) CO2(g) AH = -393.5 kJ/mol q=C MAT
for the reaction S(s)+O2(g)=SO2(g) delta H=-296 kJ per mole of SO2 formed calculate the quantity of heat released when 2.78g of sulfur is burned in oxygen=
2CH3OH(g)→2CH4(g)+O2(g),ΔH=+252.8 kJ 1. Calculate the amount of heat transferred when 25.0 gg of CH3OH(g)CH3OH(g) is decomposed by this reaction at constant pressure 2. For a given sample of CH3OHCH3OH, the enthalpy change during the reaction is 82.3 kJkJ . What mass of methane gas is produced? 3. How many kilojoules of heat are released when 38.6 gg of CH4(g)CH4(g) reacts completely with O2(g)O2(g) to form CH3OH(g)CH3OH(g) at constant pressure?
Nha rmation given here, data from here, data from Appendix (7.22) to calculate the standard and equation (7.22) (81. Use the Use the informati D, and equs enthalpy of forma 2 ZnS(s) + 302 ( of formation per mole of ZnS(s). + 3 O2(g) 2 ZnO(s) + 2 SO2(g) ArHº = -878.2 kJ mol-1
Consider the reaction B2H6(g)+O2(g)=B2O3(s)+3H2O(g) delta heat -2035 kJ/mol calculate the amount of heat released when 24.8g of diaborane is burned heat released=
Consider the following reaction: 2Mg(s)+O2(g)→2MgO(s)ΔH=−1204kJ a. How many grams of MgO are produced during an enthalpy change of -95.0 kJ ? b. How many kilojoules of heat are absorbed when 7.60 g of MgO(s) is decomposed into Mg(s) and O2(g) at constant pressure?
. For the reaction C(s)+O2(g) CO2(g), AH = -393.5 kJ/mol. What is the amount of heat (in kJ) produced during the combustion of 34.56 g of coal (pure carbon)? pec To abiod to yedmun Decide whether each of these reactinns is exothorm