3. For each of these molecules, indicate the missing tautomer.
4. Indicate the product (s) generated and demonstrate their generation by a mechanism. Included arrows demonstrating the movement of electrons, partial and formal charges and free electrons.
Homework Answers
Add Answer to:
3. For each of these molecules, indicate the missing
tautomer.
4. Indicate the product (s) generated...
Provide the products generated and demonstrate their generation via a mechanism. Include arrows showing movement of...
Provide the products generated and demonstrate their generation
via a mechanism. Include arrows showing movement of electrons,
formal and partial charges and free electrons
4. Provide the products generated and demonstrate their generation via a mechanism. Include arrows showing movement of electrons, formal and partial charges and free electrons. A) (26 marks) 2 CH3CH2OH, H+ (26 marks) HOCH CH2OH, H+ C) (27 marks) 1) H2NNH2, H20, NaOH, Heat 2) H20 (11 marks) PPh3 1) BH3, THF 2) H2O2, NaOH, H20
Give the numbers from the reagent table for the sequence of reactions that will convert ethanol...
Give the numbers from the reagent table for the
sequence of reactions that will convert ethanol to t-butyl
alcohol.
(2 18 15 18 .... 15 18 ...and
15 9 15 9 are all incorrect)
1. HNO3. H2S04 2. PCC 3. Na2Cr207. H2904 4. 8r2. FeBra 5. PBr3 6. H2C-О 7. 1. LiAIH4 2. H30+, H2O 8. HBr 9. H2O, H+ 10. CHgCH2CH2CI, AICI3 11. CH3CH2CH-PPh3 12. Zn-Hg. EtOH, HCI 13. Li THF 14. 1. CH3CH2CH2MgCI 2. H20, Ht 15 KMnO4...
question 3: draw the major organic product. indicate if the reaction is Wolff-Kishner or wittig. please...
question 3: draw the major organic product. indicate if the
reaction is Wolff-Kishner or wittig. please explain each one.
thank you!
NaBH4, H2O 1. Mg, THE 2. H2O* PPh3 1. (CH3CH2CH2CH2)2Culi 2. H30* 1. H2NNH2, H* 2. NaOH/H20, heat NaOH/H20 heat intramolecular aldol condensation
Give the missing reagent(s). Due 11/22/19 Give the missing reagent(s). CH3 Пон CH3 ОН CH3 он...
Give the missing reagent(s).
Due 11/22/19 Give the missing reagent(s). CH3 Пон CH3 ОН CH3 он он CH3 пон lot Matching: ACH, инно он CH3 пон "HOH Matching: H2SO4, H20 1) BH3.THF 2) H2O2, OH-1 C2 1) Br2, H2O 2) NaH KMnO4 Cold, Dilute,Basic HCl 1) Hg(OAc)2, H2O 2) NaBH4, OH! H2O, H2SO4 mCPBA 1) mCPBA 2) H:07 H2 1) OsO4 2) NaHSO3 (1) O₃ 2) (CH3)2S Na, Liquid NH; | 1) mCPBA 2) H2O, OH"! Lindlar's Catalyst
Predict the major product(s) of the following reactions. Show stereochemistry where appropriate. 3 CO3H i) OsO4...
Predict the major product(s) of the following reactions. Show stereochemistry where appropriate. 3 CO3H i) OsO4 H ii) NaHSO3, H2O CHC13, KOH any cha, kot i) BH3, THF CECH 11) H2O2, NaOH Li NH (liquid) cm X Ft, H/HO (vii) Two Markovnikov products Draw the structure of alkene for each of the following reactions. OH i) BH, THF 11) H202, NaOH 1) Hg(OAc)2, H20 ii) NaBH4 1) 03 ii) Zn/H Styrene undergoes propagation to give polystyrene. Showing electron-flow using half-headed...
Give the major organic product(s) of the reactions of l-methyl-2-deuteriocyclohexene (D = "H) with the reagents...
Give the major organic product(s) of the reactions of l-methyl-2-deuteriocyclohexene (D = "H) with the reagents given. Be sure to show all stereoisomers formed, and indicate which isomers are formed in equal and in unequal quantities. CHE 1-methyl-2-deuteriocyclohexene (a) (1) BH, THF: (2) H:03, NaOH, H:0 (b) HBr, AIBN (c) Br, H:0 Give the major organic product(s) of the reactions shown below. Be sure to show all stereoisomers formed, and indicate which isomers are formed in equal and in unequal...
1. (7 points) Draw the major, organic product generated for each of the reactions regiochemistry and...
1. (7 points) Draw the major, organic product generated for each of the reactions regiochemistry and stereochemistry. Be sure to indicate if more than one enantiomer is formed. below. Pay particular attention to the CI dilute H2SO4 KCN C2, H20 (dark) 1. BH3 THF 2. H2O2, KOH 1. NaH 2. allyl chloride (e) Draw the stereoisomer of 2,3-diphenylbut-2-ene that yields meso-2,3-dibromo-2,3-diphenylbutane on reaction with Br2 in the cold, darkness. 2.(2 points) Complete the following synthesis by filing in the missing...
For questions 1-4, provide the missing reactant(s), reagent(s), or major organic product(s) of each reaction. Only...
For questions 1-4, provide the missing reactant(s), reagent(s), or major organic product(s) of each reaction. Only one type of species is missing for each reaction. If you are providing reactant(8) or product(s), be sure to indicate stereochemistry if it is relevant. If you are providing reagents and more than one step is required, be sure to number each step. 1. EtMgBr 2.H20 NH [H] 5. Propose an efficient synthesis for one of the following transformations. Please circle the synthesis you...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt 1. Br 1 pt 2.3 equivalents of NaNH 3. mild acid 1 pt 4. BH 5. H202/ NaOH 1 pt 1 pt 1 pt Use the wedge/hash bond tools to indicate stereochemistry where it exists Include H atoms at chiral centers only If a group is achiral, do not use wedged or hashed bonds on it Draw organic species only. Do not include lone...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyri...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
Provide the products generated and demonstrate their generation
via a mechanism. Include arrows showing movement of electrons,
formal and partial charges and free electrons
4. Provide the products generated and demonstrate their generation via a mechanism. Include arrows showing movement of electrons, formal and partial charges and free electrons. A) (26 marks) 2 CH3CH2OH, H+ (26 marks) HOCH CH2OH, H+ C) (27 marks) 1) H2NNH2, H20, NaOH, Heat 2) H20 (11 marks) PPh3 1) BH3, THF 2) H2O2, NaOH, H20
Give the numbers from the reagent table for the
sequence of reactions that will convert ethanol to t-butyl
alcohol.
(2 18 15 18 .... 15 18 ...and
15 9 15 9 are all incorrect)
1. HNO3. H2S04 2. PCC 3. Na2Cr207. H2904 4. 8r2. FeBra 5. PBr3 6. H2C-О 7. 1. LiAIH4 2. H30+, H2O 8. HBr 9. H2O, H+ 10. CHgCH2CH2CI, AICI3 11. CH3CH2CH-PPh3 12. Zn-Hg. EtOH, HCI 13. Li THF 14. 1. CH3CH2CH2MgCI 2. H20, Ht 15 KMnO4...
question 3: draw the major organic product. indicate if the
reaction is Wolff-Kishner or wittig. please explain each one.
thank you!
NaBH4, H2O 1. Mg, THE 2. H2O* PPh3 1. (CH3CH2CH2CH2)2Culi 2. H30* 1. H2NNH2, H* 2. NaOH/H20, heat NaOH/H20 heat intramolecular aldol condensation
Give the missing reagent(s).
Due 11/22/19 Give the missing reagent(s). CH3 Пон CH3 ОН CH3 он он CH3 пон lot Matching: ACH, инно он CH3 пон "HOH Matching: H2SO4, H20 1) BH3.THF 2) H2O2, OH-1 C2 1) Br2, H2O 2) NaH KMnO4 Cold, Dilute,Basic HCl 1) Hg(OAc)2, H2O 2) NaBH4, OH! H2O, H2SO4 mCPBA 1) mCPBA 2) H:07 H2 1) OsO4 2) NaHSO3 (1) O₃ 2) (CH3)2S Na, Liquid NH; | 1) mCPBA 2) H2O, OH"! Lindlar's Catalyst
Predict the major product(s) of the following reactions. Show stereochemistry where appropriate. 3 CO3H i) OsO4 H ii) NaHSO3, H2O CHC13, KOH any cha, kot i) BH3, THF CECH 11) H2O2, NaOH Li NH (liquid) cm X Ft, H/HO (vii) Two Markovnikov products Draw the structure of alkene for each of the following reactions. OH i) BH, THF 11) H202, NaOH 1) Hg(OAc)2, H20 ii) NaBH4 1) 03 ii) Zn/H Styrene undergoes propagation to give polystyrene. Showing electron-flow using half-headed...
Give the major organic product(s) of the reactions of l-methyl-2-deuteriocyclohexene (D = "H) with the reagents given. Be sure to show all stereoisomers formed, and indicate which isomers are formed in equal and in unequal quantities. CHE 1-methyl-2-deuteriocyclohexene (a) (1) BH, THF: (2) H:03, NaOH, H:0 (b) HBr, AIBN (c) Br, H:0 Give the major organic product(s) of the reactions shown below. Be sure to show all stereoisomers formed, and indicate which isomers are formed in equal and in unequal...
1. (7 points) Draw the major, organic product generated for each of the reactions regiochemistry and stereochemistry. Be sure to indicate if more than one enantiomer is formed. below. Pay particular attention to the CI dilute H2SO4 KCN C2, H20 (dark) 1. BH3 THF 2. H2O2, KOH 1. NaH 2. allyl chloride (e) Draw the stereoisomer of 2,3-diphenylbut-2-ene that yields meso-2,3-dibromo-2,3-diphenylbutane on reaction with Br2 in the cold, darkness. 2.(2 points) Complete the following synthesis by filing in the missing...
For questions 1-4, provide the missing reactant(s), reagent(s), or major organic product(s) of each reaction. Only one type of species is missing for each reaction. If you are providing reactant(8) or product(s), be sure to indicate stereochemistry if it is relevant. If you are providing reagents and more than one step is required, be sure to number each step. 1. EtMgBr 2.H20 NH [H] 5. Propose an efficient synthesis for one of the following transformations. Please circle the synthesis you...
Draw the structure of the final product(s) of this series of reactions 1pt ernces 1 pt 1. Br 1 pt 2.3 equivalents of NaNH 3. mild acid 1 pt 4. BH 5. H202/ NaOH 1 pt 1 pt 1 pt Use the wedge/hash bond tools to indicate stereochemistry where it exists Include H atoms at chiral centers only If a group is achiral, do not use wedged or hashed bonds on it Draw organic species only. Do not include lone...
Hc VCH Draw the organic product formed when CH3CH2CH2OH is treated with each reagent. a H2S04 (180°C) d SOC12, pyridine Ig 1) NaH; 2) CH3CH2Br b NaH e PBr3 h 1) TSCI, pyridine; 2) NaSH c HBr f TsCl, pyridine 3. Draw the organic product formed when l-methylcyclohexanol is treaded with each reagent. In some cases, no reaction occurs. a KH c HBr Te NaHCO3 b Nacid HCI f 1) KH; 2) CH3CH2Br Draw two different routes to each of...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 25 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 56 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago