Homework Answers
Add Answer to:
2) Draw the product(s) of the following reaction and identify the major product. If no reaction...
identify the major product of this reaction HO Identify the major product of this reaction. -CH...
identify the major product of this reaction
HO Identify the major product of this reaction. -CH H2SO4 A (A) CH (B) -CH, (C) .CH (D) -CH) REMOVED 7 Identify a reagent or set of reagents to accomplish the following transformation. OH (A) Oso -BUOOH (B) 1) Hg(OAC)2 H20 2) NaBH4 (D) HOOH (C) THF.BH) 2) H30, OH H20 9 Identify an important intermediate in following reaction. ထူး 1) LATHA + HOCH CH CH,CII OCH, 2010 CHI CHỊ (A) (B) :OH...
Provide the MAJOR product(s) for the following reactions. SN2 and E2 reaction will only give one...
Provide the MAJOR product(s) for the following reactions. SN2
and E2 reaction will only give one major product (the substitution
of elimination product)
major product (the substitution or elimin SOCI, Pyridine HCI (excess) Heat Oh ot H2SO4, H20 Nas DMF, 25 °C NaOH H20, 55 °C Br
Complete the following reaction with the major product Reactions: complete the following reaction with the major...
Complete the following reaction with the major
product
Reactions: complete the following reaction with the major product HBr он 1- OH POCl3 pyridine 2- H2SO4 OH 3- Hl 4- H20 H3PO4 5- Cl2 H20 7- 1) BH2-THF 2) H202, KOH 8- 2) 9- 1) BH3-THF 10- DLL 10- Date: G# : 12, and 13- Br H20 но 2) NaH 14, and 15- ) NaOH i NaOH 2 dil H.0 3) PBr 3)HBr F6 FZ F8
Draw the major product(s) obtained for all the following reactions. Give the major organic product(s) of...
Draw the major product(s) obtained for all the following
reactions.
Give the major organic product(s) of the following reaction. Give the major organic product(s) of the following reaction. 1) DIBAH (-78°C) (0.5 moles) 2) H30+ H2SO4, H20 Ph-c=c-Ph - HgS04 Give the major organic product(s) of the following reaction. Give the major organic product(s) of the following reaction. CrO,CH Croz . Qaoa ? M ? H2SO4 Give the major organic product(s) of the following reaction. Give the major organic product(s)...
Identify the major product of this reaction но Identify the major product of this reaction. CH,...
Identify the major product of this
reaction
но Identify the major product of this reaction. CH, H2SO4 (A) CH (B) .CH CH (D) CH REMOVED Identify a reagent or set of reagents to accomplish the following transformation. OH (A) OsO4 I-BUOOH (C) 1) THF-BH) 2) H30, OH H20 (B) 1) Hg(OAc), H,0 2) NaBHE (D) HOOH A 9 Identify an important intermediate in following reaction. -93 1) LATHA 2) 11,0 OCH, ဂုံ + HOCH CH, CHCI CHỊCH (A) (B) :OH...
For each of the following reactions fill in the box to give the missing product(s). If...
For each of the following reactions fill in the box to give the
missing product(s). If no reaction occurs, write N.R. If the
reaction produces a mixture of products, such as stereoisomers or
constitutional isomers, give the structure of each product. If a
major product arises, label it as so. Be sure to show
stereochemistry when needed.
1. NaOH ОН 2. 1-iodopropane THF OH 1. NaH THE 2. 1-bromobutane THF 1. methanol Hg(OAc)2 H2SO4 2. NaBH4 THE H2SO4 YOH 140...
Draw the major organic product(s) for the following reactions. If there is no reaction, state so....
Draw the major organic product(s) for the following reactions.
If there is no reaction, state so.
- das ports row the major organic products for 1. (15 points) Draw the major organic product(s) for the following reactions. If there is no reaction, state so. NH2NH2 water. он CH3CHCH3 + H2C— C— CH3 La 1. LiAIHA c. Học -c- 2. H20 H2O/NaOH d. CH3CH2C— 0-CH2CH3 two products -C- OCH H20 two products
7. Draw the structure of the missing major organic product(s) for each of the following reactions....
7. Draw the structure of the missing major organic product(s) for each of the following reactions. There is no “No Reaction in any of the answers. Show correct stereochemistry when needed! NO ON Na S204 (excess) NaOH, H20, heat Sebacoyl chloride PhCH OH OH (excess) 0 H2SO4, heat Aryl Bromide 1) Mg, THF 2) CH2=0 3) H20, H307 PhCH,CH,OH1 H2SO4 (catalytie) T heat H2Cro (excess)
1. What is the major product for the following reaction? 2. What is the major product...
1. What is the major product for the following
reaction?
2. What is the major product for the following
reaction?
3.
4. Which reagent or test could be used to distinguish between
3-methyl-2-octene and 3-methyloctane?
Ethanol
Br2/CCl4
Sodium hydroxide aqueous solution
Two of these choices.
All of these choices.
5. Which of the following reagents give the highest yield for
conversion of 2-bromopentane to 1-pentene?
KOH/H2O
KOH/CH3OH
(CH3)3COK/(CH3)3COH
CH3ONa/CH3OH
CH3CH2ONa/CH3CH2OH
6.
What is the major product for the following reaction?...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
identify the major product of this reaction
HO Identify the major product of this reaction. -CH H2SO4 A (A) CH (B) -CH, (C) .CH (D) -CH) REMOVED 7 Identify a reagent or set of reagents to accomplish the following transformation. OH (A) Oso -BUOOH (B) 1) Hg(OAC)2 H20 2) NaBH4 (D) HOOH (C) THF.BH) 2) H30, OH H20 9 Identify an important intermediate in following reaction. ထူး 1) LATHA + HOCH CH CH,CII OCH, 2010 CHI CHỊ (A) (B) :OH...
Provide the MAJOR product(s) for the following reactions. SN2
and E2 reaction will only give one major product (the substitution
of elimination product)
major product (the substitution or elimin SOCI, Pyridine HCI (excess) Heat Oh ot H2SO4, H20 Nas DMF, 25 °C NaOH H20, 55 °C Br
Complete the following reaction with the major
product
Reactions: complete the following reaction with the major product HBr он 1- OH POCl3 pyridine 2- H2SO4 OH 3- Hl 4- H20 H3PO4 5- Cl2 H20 7- 1) BH2-THF 2) H202, KOH 8- 2) 9- 1) BH3-THF 10- DLL 10- Date: G# : 12, and 13- Br H20 но 2) NaH 14, and 15- ) NaOH i NaOH 2 dil H.0 3) PBr 3)HBr F6 FZ F8
Draw the major product(s) obtained for all the following
reactions.
Give the major organic product(s) of the following reaction. Give the major organic product(s) of the following reaction. 1) DIBAH (-78°C) (0.5 moles) 2) H30+ H2SO4, H20 Ph-c=c-Ph - HgS04 Give the major organic product(s) of the following reaction. Give the major organic product(s) of the following reaction. CrO,CH Croz . Qaoa ? M ? H2SO4 Give the major organic product(s) of the following reaction. Give the major organic product(s)...
Identify the major product of this
reaction
но Identify the major product of this reaction. CH, H2SO4 (A) CH (B) .CH CH (D) CH REMOVED Identify a reagent or set of reagents to accomplish the following transformation. OH (A) OsO4 I-BUOOH (C) 1) THF-BH) 2) H30, OH H20 (B) 1) Hg(OAc), H,0 2) NaBHE (D) HOOH A 9 Identify an important intermediate in following reaction. -93 1) LATHA 2) 11,0 OCH, ဂုံ + HOCH CH, CHCI CHỊCH (A) (B) :OH...
For each of the following reactions fill in the box to give the
missing product(s). If no reaction occurs, write N.R. If the
reaction produces a mixture of products, such as stereoisomers or
constitutional isomers, give the structure of each product. If a
major product arises, label it as so. Be sure to show
stereochemistry when needed.
1. NaOH ОН 2. 1-iodopropane THF OH 1. NaH THE 2. 1-bromobutane THF 1. methanol Hg(OAc)2 H2SO4 2. NaBH4 THE H2SO4 YOH 140...
Draw the major organic product(s) for the following reactions.
If there is no reaction, state so.
- das ports row the major organic products for 1. (15 points) Draw the major organic product(s) for the following reactions. If there is no reaction, state so. NH2NH2 water. он CH3CHCH3 + H2C— C— CH3 La 1. LiAIHA c. Học -c- 2. H20 H2O/NaOH d. CH3CH2C— 0-CH2CH3 two products -C- OCH H20 two products
7. Draw the structure of the missing major organic product(s) for each of the following reactions. There is no “No Reaction in any of the answers. Show correct stereochemistry when needed! NO ON Na S204 (excess) NaOH, H20, heat Sebacoyl chloride PhCH OH OH (excess) 0 H2SO4, heat Aryl Bromide 1) Mg, THF 2) CH2=0 3) H20, H307 PhCH,CH,OH1 H2SO4 (catalytie) T heat H2Cro (excess)
1. What is the major product for the following
reaction?
2. What is the major product for the following
reaction?
3.
4. Which reagent or test could be used to distinguish between
3-methyl-2-octene and 3-methyloctane?
Ethanol
Br2/CCl4
Sodium hydroxide aqueous solution
Two of these choices.
All of these choices.
5. Which of the following reagents give the highest yield for
conversion of 2-bromopentane to 1-pentene?
KOH/H2O
KOH/CH3OH
(CH3)3COK/(CH3)3COH
CH3ONa/CH3OH
CH3CH2ONa/CH3CH2OH
6.
What is the major product for the following reaction?...
Part II - Reactions (16 marks] Draw the expected major product(s) for each of the following reactions. Question Answer 8. 1. NaH OH ? 2. OTs 9. NBS ? major product 10. Nal Br ? Acetone Br 11. 1. NaNH2 H3C-CECH ? 2. OTS 12. OH Br NaOH ? cyclic compound 13. OH HBT ? 14. ? OH cat. H2SO4 H20 Room temp. 15. Br MeOH
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 14 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 7 hours ago