What is the purpose of adipoyl chloride, 5% aqeous solution of 1,6 hexane diamine, cyclohexane and...
What is the purpose of adipoyl chloride, 5% aqeous solution of 1,6 hexane diamine, cyclohexane and NaOH in synthesis of Nylon-6,6?
Homework Answers
Sodium hydroxide (NaOH) was added to the hexamethylenediamine solution in order to react with the hydrochloric acid (HCl) produced when the 1,6-hexanediamine reacts with the adipoyl chloride. The NaOH maintains the pH of the solution by reacting with the HCl to form NaCl and water. While cylcohexane is used as solvent for the reaction.
Add Answer to:
What is the purpose of adipoyl chloride, 5% aqeous solution of
1,6 hexane diamine, cyclohexane and...
Why was 1mL of 3 M NaOH added to the aqueous solution of hexane-1,6-diamine in the...
Why was 1mL of 3 M NaOH added to the aqueous solution of hexane-1,6-diamine in the synthesis of nylon (6,10)? Draw the structure you would expect for a nylon termed "Nylon (4,6)". A sample of the polymer polyethylene (PE) had an average molecular weight of 700,000, approximately how many ethylene (ethene) monomers were used to make it?
Can you answer these questions based on the Synthesis of Nylon-6,6 using adipoyl chloride and 1,6-hexanediamine...
Can you answer these questions based on the Synthesis of Nylon-6,6 using adipoyl chloride and 1,6-hexanediamine Discuss the polycondensation reaction. Why would water interfere with it? In case experiment failed-explanation is expected. Why it failed? What could be improved. Explain molecular structure vs signal relationship . In your discussion consider the following concepts: polycondensation, functional groups, fibril formation and stabilization (interchain molecular itneractions) , reaction yield and the role of NaOH solution used in the reaction
please explain the polycondensation reaction of 1,6 diaminohexane and adipoyl chloride creating nylon 6,6 why would...
please explain the polycondensation reaction of 1,6 diaminohexane and adipoyl chloride creating nylon 6,6 why would water interfere ?
Backkground on condensation polymers and what happens (in details) when 1,6-diaminohexane and adipoyl chloride mix.
Backkground on condensation polymers and what happens (in details) when 1,6-diaminohexane and adipoyl chloride mix.
Discuss the polycondensation reaction. Why would water interfere with it? In case experiment failed-explanation is expected....
Discuss the polycondensation reaction. Why would water interfere with it? In case experiment failed-explanation is expected. Why it failed? What could be improved. Explain molecular structure vs signal relationship . In your discussion consider the following concepts: polycondensation, functional groups, fibril formation and stabilization (interchain molecular itneractions) , reaction yield and the role of NaOH solution used in the reaction Can you answer these questions based on the Synthesis of Nylon-6,6 using adipoyl chloride and 1,6-hexanediamine
1. (a) What functional groups are present in (i) PET, (ii) Nylon and (iii) adipoyl chloride...
1. (a) What functional groups are present in (i) PET, (ii) Nylon and (iii) adipoyl chloride ? 1- (b) These three functional groups in question 1(a) are part of a larger family of functional groups. What is that larger family ? (c) The larger family of functional groups in question 1(b) typically undergo reactions of a common general mechanistic pathway. The hydrolysis of PETE and the formation of Nylon in this experiment are both examples of this. What is the...
what is the theoretical yield for this experiment? ORGANIC POLYMERS: THE SYNTHESIS OF NYLON Nylon's outstanding...
what is the theoretical yield for this experiment?
ORGANIC POLYMERS: THE SYNTHESIS OF NYLON Nylon's outstanding characteristic in the textile industry is its versatility. It can be made strong enough to stand up under the punishment tire cords must endure, fine enough for sheer, high fashion hosiery, and light enough for parachute cloth and backpacker's tents. Nylon is used both alone and in blends with other fibers, where its chief contributions are strength and abrasion resistance. Nylon washes easily, dries...
for this experiment, what is the balanced chemical equation and mechanism? Experimental Procedure a) Reagent Prep...
for this experiment, what is the balanced chemical equation and
mechanism?
Experimental Procedure a) Reagent Preparation (mix in hood): 1. In a 125mL Erlenmeyer dissolve 1 mL of the sebacyl chloride in 50 mL of hexane. Label the Solution as SC 2. In a 50mL Erlenmeyer dissolve 2.5 mL of 1,6-hexanediamine in 25 mL of 3% sodium hydroxid Label the solution as diamine. (The 3% NaOH solution will be provided) b) Nylon Synthesis 1. Using a 10mL graduate cylinder take...
8) Hexane (P 152 torr ) and cyclohexane (P 97.6 torr) form an ideal solution. At...
8) Hexane (P 152 torr ) and cyclohexane (P 97.6 torr) form an ideal solution. At some solution concentration the vapor above the solution is comprised of hexane:cyclohexane molecules in a 1:3 ratio. What is the composition of the solution in mole percentages?
What is the IUPAC name of the following compound? CH3-(CH2)5-CH3 Heptane O Hexane 1,6-dimethylpentane Octane 1-Heptene
What is the IUPAC name of the following compound? CH3-(CH2)5-CH3 Heptane O Hexane 1,6-dimethylpentane Octane 1-Heptene
Why was 1mL of 3 M NaOH added to the aqueous solution of hexane-1,6-diamine in the synthesis of nylon (6,10)? Draw the structure you would expect for a nylon termed "Nylon (4,6)". A sample of the polymer polyethylene (PE) had an average molecular weight of 700,000, approximately how many ethylene (ethene) monomers were used to make it?
what is the theoretical yield for this experiment?
ORGANIC POLYMERS: THE SYNTHESIS OF NYLON Nylon's outstanding characteristic in the textile industry is its versatility. It can be made strong enough to stand up under the punishment tire cords must endure, fine enough for sheer, high fashion hosiery, and light enough for parachute cloth and backpacker's tents. Nylon is used both alone and in blends with other fibers, where its chief contributions are strength and abrasion resistance. Nylon washes easily, dries...
for this experiment, what is the balanced chemical equation and
mechanism?
Experimental Procedure a) Reagent Preparation (mix in hood): 1. In a 125mL Erlenmeyer dissolve 1 mL of the sebacyl chloride in 50 mL of hexane. Label the Solution as SC 2. In a 50mL Erlenmeyer dissolve 2.5 mL of 1,6-hexanediamine in 25 mL of 3% sodium hydroxid Label the solution as diamine. (The 3% NaOH solution will be provided) b) Nylon Synthesis 1. Using a 10mL graduate cylinder take...
8) Hexane (P 152 torr ) and cyclohexane (P 97.6 torr) form an ideal solution. At some solution concentration the vapor above the solution is comprised of hexane:cyclohexane molecules in a 1:3 ratio. What is the composition of the solution in mole percentages?
What is the IUPAC name of the following compound? CH3-(CH2)5-CH3 Heptane O Hexane 1,6-dimethylpentane Octane 1-Heptene
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 15 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago