Homework Answers
Answer 10)
A)Yes, there is found change in color of solution to yellow.
b) Explanation:
When we exhaled through a straw in a beaker, then carbon dioxide is released in the water. The CO2 reacts with water to produce carbonic acid. Carbonic acid disoociates to produce hydrogen ion.
CO2+ H2O -----> H2CO3- -----> HCO3- + H+
In this way, acidic pH occurs in the solution.
when bromophenol blue is added, then it color changes to yellow because of acidic behaviour of solution.
please rate?.
Add Answer to:
10.a. Carbon dioxide produced during cellular respiration can combine with water to form carbonic acid. Bromophenol...
Carbonic acid can form water and carbon dioxide upon heating. How much carbon dioxide is formed...
Carbonic acid can form water and carbon dioxide upon heating. How much carbon dioxide is formed from 12.4 g of carbonic acid? H2CO3 → H2O + CO2
1. What is the source of carbon for photosynthesis in plants? A. Carbonic acid B. Carbon...
1. What is the source of carbon for photosynthesis in plants? A. Carbonic acid B. Carbon monoxide C. Carbon Dioxide D. Calcium carbonate 2. H2CO3 forms when CO2 mixes with water. Why does it change the phenol red indicator to yellow? A. It is sodium carbonate, the color change shows a salt has formed. B. It is iron carbonate, it dissolves and releases iron which oxidizes (rusts). C. It is barium carbonate, which is naturally a dark yellow color. D....
Part A Carbonic acid can form water and carbon dioxide upon heating. How much carbon dioxide is formed from 3.10 g...
Part A Carbonic acid can form water and carbon dioxide upon heating. How much carbon dioxide is formed from 3.10 g of carbonic acid? H2CO3 + H2O + CO2 4.379 2.20 g 10.7 g 3.10 9 0.900 g Submit Request Answer Provide Feedback
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO2. Dissolved CO2...
Carbon dioxide dissolves in water to form carbonic acid, which
is primarily dissolved CO2. Dissolved CO2 satisfies the equilibrium
equation The acid dissociation constants listed in most standard
reference texts for carbonic acid actually apply to dissolved CO2.
For a CO2 partial pressure of 1.8×10–4 bar in the atmosphere, what
is the pH of water in equilibrium with the atmosphere? (For
carbonic acid Ka1 = 4.46× 10–7 and Ka2 = 4.69× 10–11).
Carbon dioxide dissolves in water to form carbonic...
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO2. Dissol...
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO2. Dissolved CO2 satisfies the equilibrium equation. CO2 (g) <--> CO2 (aq) K= 0.032 M atm-1 The acid dissociation constants listed in most standard reference texts for carbonic acid actually apply to dissolved CO2. For a CO2 partial pressure of 8.8×10-4 atm in the atmosphere, what is the pH of water in equilibrium with the atmosphere?
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO_2. Dissolved CO_2...
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO_2. Dissolved CO_2 satisfies the equilibrium equation CO_2(g) CO_2(aq) K=0.032 M atm^-1 The acid dissociation constants listed in most standard reference texts for carbonic acid actually apply to dissolved CO_2. For a CO_2 partial pressure of 7.1x10^-4 atm in the atmosphere, what is the pH of water in equilibrium with the atmosphere?
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO2. Dissolved CO2...
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO2. Dissolved CO2 satisfies the equilibrium equation CO2(gas)<------>CO2(aq) K=0.032 M*atm-1 The acid dissociation constants listed in most standard reference texts for carbonic acid actually apply to dissolved CO2. For a CO2 partial pressure of 3.1×10-4 atm in the atmosphere, what is the pH of water in equilibrium with the atmosphere?
11. In cellular respiration, glucose (C.H..0.) reacts with oxygen to produce energy, carbon dioxide, and water....
11. In cellular respiration, glucose (C.H..0.) reacts with oxygen to produce energy, carbon dioxide, and water. (Hint: There's an extra conversion factor!) a. If .08 mg of glucose react with .05 mg of oxygen, determine how much water can be produced based on the limiting reagent. (3 pts) b. Determine the amount of excess. (2 pts) c. If .002 grams of water is actually produced, determine the percent yield (2 pts).
11. In cellular respiration, glucose (CH,0.) reacts with oxygen to produce energy, carbon dioxide, and water. (Hint...
11. In cellular respiration, glucose (CH,0.) reacts with oxygen to produce energy, carbon dioxide, and water. (Hint: There's an extra conversion factor!) a. If .08 mg of glucose react with .05 mg of oxygen, determine how much water can be produced based on the limiting reagent. (3 pts) b. Determine the amount of excess. (2 pts) c. If .002 grams of water is actually produced, determine the percent yield (2 pts).
8) Covalent bolidnn Carbon dioxide reacts with water to form carbonic acid: CO2 + H2O →...
8) Covalent bolidnn Carbon dioxide reacts with water to form carbonic acid: CO2 + H2O → H2CO3 Provide items (a) through (g) below for the carbon-containing molecule before and after the reaction. (32 points total) After Before (a) Lewis structure (4 pts) (b) Number of bonding pairs around C (c) Number of lone pairs (d) Number of electron around C (2 24 3 domains around C (e) Hybridization of C (f) Electron domain geometry ts (g) Molecular geometry ineay ts...
1. What is the source of carbon for photosynthesis in plants? A. Carbonic acid B. Carbon monoxide C. Carbon Dioxide D. Calcium carbonate 2. H2CO3 forms when CO2 mixes with water. Why does it change the phenol red indicator to yellow? A. It is sodium carbonate, the color change shows a salt has formed. B. It is iron carbonate, it dissolves and releases iron which oxidizes (rusts). C. It is barium carbonate, which is naturally a dark yellow color. D....
Part A Carbonic acid can form water and carbon dioxide upon heating. How much carbon dioxide is formed from 3.10 g of carbonic acid? H2CO3 + H2O + CO2 4.379 2.20 g 10.7 g 3.10 9 0.900 g Submit Request Answer Provide Feedback
Carbon dioxide dissolves in water to form carbonic acid, which
is primarily dissolved CO2. Dissolved CO2 satisfies the equilibrium
equation The acid dissociation constants listed in most standard
reference texts for carbonic acid actually apply to dissolved CO2.
For a CO2 partial pressure of 1.8×10–4 bar in the atmosphere, what
is the pH of water in equilibrium with the atmosphere? (For
carbonic acid Ka1 = 4.46× 10–7 and Ka2 = 4.69× 10–11).
Carbon dioxide dissolves in water to form carbonic...
Carbon dioxide dissolves in water to form carbonic acid, which is primarily dissolved CO_2. Dissolved CO_2 satisfies the equilibrium equation CO_2(g) CO_2(aq) K=0.032 M atm^-1 The acid dissociation constants listed in most standard reference texts for carbonic acid actually apply to dissolved CO_2. For a CO_2 partial pressure of 7.1x10^-4 atm in the atmosphere, what is the pH of water in equilibrium with the atmosphere?
11. In cellular respiration, glucose (C.H..0.) reacts with oxygen to produce energy, carbon dioxide, and water. (Hint: There's an extra conversion factor!) a. If .08 mg of glucose react with .05 mg of oxygen, determine how much water can be produced based on the limiting reagent. (3 pts) b. Determine the amount of excess. (2 pts) c. If .002 grams of water is actually produced, determine the percent yield (2 pts).
11. In cellular respiration, glucose (CH,0.) reacts with oxygen to produce energy, carbon dioxide, and water. (Hint: There's an extra conversion factor!) a. If .08 mg of glucose react with .05 mg of oxygen, determine how much water can be produced based on the limiting reagent. (3 pts) b. Determine the amount of excess. (2 pts) c. If .002 grams of water is actually produced, determine the percent yield (2 pts).
8) Covalent bolidnn Carbon dioxide reacts with water to form carbonic acid: CO2 + H2O → H2CO3 Provide items (a) through (g) below for the carbon-containing molecule before and after the reaction. (32 points total) After Before (a) Lewis structure (4 pts) (b) Number of bonding pairs around C (c) Number of lone pairs (d) Number of electron around C (2 24 3 domains around C (e) Hybridization of C (f) Electron domain geometry ts (g) Molecular geometry ineay ts...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 40 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago