Homework Answers
ANS: Characteristics of epithelial types of tissues from kidney :-
The main functions of the epithelial tissues of covering of organs externally or internally. The Malpighian corpuscle (Renal corpuscle) comprises of glomerulus and Bowman's capsule. Out of this Bowman's capsule has two layers -outer parietal layer and inner visceral layer .
The parietal layer consists of squamous cell and parietal layer composed of special type of cells the podocytes .The podocytes are called because thy posses foot like processes ,the pedicels. The space between pedicels helpful for the filtration of glomerular filtrates .
The renal Tubules : The Proximal convoluted Tubules lined by cuboidal epithelial bearing a brush border of tall microvilli at free end which increases the surface area, its allow the reabsorption of salts by active transport.
Loop of Henle lined by cuboidal epithelium and Distal Convoluted tubules lined by cuboidal cells help in ionic movement ,Collecting duct lined by cuboidal or columnar epithelial tissues.
Characteristics of epithelial found in Dermis and Epidermis ;-
Layer of dermis present below the epidermis and Epidermis of epithelial made up stratified squamous epithelial ,the cells of the epithelial arranged in orderly on the basement membrane and basement membrane helps in signaling .Dermis below the epidermis contains hair follicles, sweat glands etc ..Here, epithelial function in secretion and protect in the skin from infection from the microorganisms.
Add Answer to:
EXPERIMENT 1: Explain the characteristics you observed when studying the epithelial types of the Epithelial Tissue...
1. Epithelial tissue and bone marrow are cell types that are more likely to be damaged...
1. Epithelial tissue and bone marrow are cell types that are more likely to be damaged by exposure to radiation than orcell types. 2 Increased hydrostatic pressure in the glomerular capillaries of the kidney results inglomerular filtration rate 3. Vision in the elderly may be impaired when the eyeball becomes less elastic, thus preventing accommodation and resulting in the condition called 4 With carcinoma of the breast tumor cells may demonstrate in molecular targeting and imaging for tumors. receptors on...
Dense Irregular Connective Tissue 1 Examine a slide of thick skin under low power. In Activity...
Dense Irregular Connective Tissue 1 Examine a slide of thick skin under low power. In Activity 5.1, you observed the epidermis. Locate this layer again and identify the type of epithelium. 2 Directly below the epidermis is the dermis of the skin. The deep region of the dermis is composed of dense irregular connective tissue. This type of connective tissue consists mostly of collagen fibers, although elastic and reticular fibers are also present. How does the arrangement of the fibers...
(303 Biology BLUE) 1. What type of tissue forms tendons * (1 Point) Connective tissue Epithelial...
(303 Biology BLUE) 1. What type of tissue forms tendons * (1 Point) Connective tissue Epithelial Tissue Nervous tissue 2. Which of the following types of epithelial tissue line the interior of blood vessels? (1 Point) Endothelial Simple Cuboid Simple squamous 3. Which of the following types of epithelial tissue provides the greatest amount of protection from rubbing, wear, and tear? * (1 Point) simple squamous O pseudostratified ciliated columnar O stratified columnar 41 French Search for or type a...
Please answer 1-5 Which of the following tissue types function in 1) prevention of tissue dehydration,...
Please answer 1-5
Which of the following tissue types function in 1) prevention of tissue dehydration, 2) secretion of materials (ie, into the gut), and 3) formation of sensory organs Select one: a. connective b. muscle c. epithelial d. nerve During meiosis, separate during anaphase I, and separate during anaphase II Select one: a chromatids; homologous chromosomes b. homologous chromosomes, chromatids oc homologous chromosomes; homologous chromosomes d. chromatids, chromatids Decreasing levels of cause the endometrium to be sloughed off during...
Period Name 1. What structures are included in the integumentary systern. 2. Skin may be one...
Period Name 1. What structures are included in the integumentary systern. 2. Skin may be one of the most underestimated organs in the body. List six functions your skin performs while it is "just lying there" 2. 3. 4. 5. 6. 3. The outer layer of skin is the layer. The inner layer is the layer. Which layer is the thickest? What is the subcutaneous layer? 4. Epidermis contains a few distinct cell types. Fill in the name of the...
Answer the following questions about histology(Connective tissue and plant cells) 1.Key characteristics of connective tissue(minimum 5)...
Answer the following questions about histology(Connective tissue and plant cells) 1.Key characteristics of connective tissue(minimum 5) 2. the words “dense”, “loose”, “regular”, “irregular” means. If lacunae is seen in the tissue, the tissue must be ... or....? 3. Animal tissue-connective tissues: For Loose connective tissueCT Areolar tissue: a.Point the irregular arrangement of fibers b. hows the arrangement of the fibers c. what type of fibers can you find d. how do you differentiate them 4. Dense irregular CT: a. where...
i just need 1-5 . thank you ! 1. Amoeba exhibit the characteristics of living things,...
i
just need 1-5 . thank you !
1. Amoeba exhibit the characteristics of living things, that is, movement, irritability, nutrition, metabolism, growth, and reproduction. How many of these characteristics have you been able to observe? 2. Have you seen any evidence that the amoeba responds to a stimulus? 3. Is paramecium bilaterally symmetrical? Explain. 4. Why do you suppose paramecium has contractile vacuoles?! 5. Did the cilia of paramecium beat in unison? Does this explain how the organism can...
1) The observed numbers for dominant and recessive types in an F2 generation are 154 and...
1) The observed numbers for dominant and recessive types in an F2 generation are 154 and 46. You would assume the expected numbers to be in a ---------- to 1 ratio. would the answer for question 1 be a 3 to 1 ratio i'm really confused. 2) Looking at the observed numbers in question 1 what would your expected number of dominant types be? I don't know please help. 3) Using the same observed numbers in question 1 what would...
1. Give an example of a primary producer that you observed in the pond water. What...
1. Give an example of a primary producer that you observed in the pond water. What does it do to be called a primary producer (hint – think sun)? 2. Read about pond microorganisms, and describe their importance in a pond (including bacteria), what would happen if all microorganisms would suddenly disappear from the pond. 3. Give and describe some examples of pond microbes with their images. (at least 5 microbes) Be sure that their images are magnified (microscope). 4....
Answer the following questions about muscle tissue: 1. When you see a highly structured muscle cell...
Answer the following questions about muscle tissue: 1. When you see a highly structured muscle cell with many nuclei pushed to one side, which muscle type is being observed? 2. What structure is unique and can be used to differentiate between smooth muscle slide and a cardiac muscle slide? 3. Why can it be hard to identify the smooth muscles in a slide? 4. Which muscle type is being observed when small capillaries are found throughout the tissue?
1. Epithelial tissue and bone marrow are cell types that are more likely to be damaged by exposure to radiation than orcell types. 2 Increased hydrostatic pressure in the glomerular capillaries of the kidney results inglomerular filtration rate 3. Vision in the elderly may be impaired when the eyeball becomes less elastic, thus preventing accommodation and resulting in the condition called 4 With carcinoma of the breast tumor cells may demonstrate in molecular targeting and imaging for tumors. receptors on...
Dense Irregular Connective Tissue 1 Examine a slide of thick skin under low power. In Activity 5.1, you observed the epidermis. Locate this layer again and identify the type of epithelium. 2 Directly below the epidermis is the dermis of the skin. The deep region of the dermis is composed of dense irregular connective tissue. This type of connective tissue consists mostly of collagen fibers, although elastic and reticular fibers are also present. How does the arrangement of the fibers...
(303 Biology BLUE) 1. What type of tissue forms tendons * (1 Point) Connective tissue Epithelial Tissue Nervous tissue 2. Which of the following types of epithelial tissue line the interior of blood vessels? (1 Point) Endothelial Simple Cuboid Simple squamous 3. Which of the following types of epithelial tissue provides the greatest amount of protection from rubbing, wear, and tear? * (1 Point) simple squamous O pseudostratified ciliated columnar O stratified columnar 41 French Search for or type a...
Please answer 1-5
Which of the following tissue types function in 1) prevention of tissue dehydration, 2) secretion of materials (ie, into the gut), and 3) formation of sensory organs Select one: a. connective b. muscle c. epithelial d. nerve During meiosis, separate during anaphase I, and separate during anaphase II Select one: a chromatids; homologous chromosomes b. homologous chromosomes, chromatids oc homologous chromosomes; homologous chromosomes d. chromatids, chromatids Decreasing levels of cause the endometrium to be sloughed off during...
Period Name 1. What structures are included in the integumentary systern. 2. Skin may be one of the most underestimated organs in the body. List six functions your skin performs while it is "just lying there" 2. 3. 4. 5. 6. 3. The outer layer of skin is the layer. The inner layer is the layer. Which layer is the thickest? What is the subcutaneous layer? 4. Epidermis contains a few distinct cell types. Fill in the name of the...
i
just need 1-5 . thank you !
1. Amoeba exhibit the characteristics of living things, that is, movement, irritability, nutrition, metabolism, growth, and reproduction. How many of these characteristics have you been able to observe? 2. Have you seen any evidence that the amoeba responds to a stimulus? 3. Is paramecium bilaterally symmetrical? Explain. 4. Why do you suppose paramecium has contractile vacuoles?! 5. Did the cilia of paramecium beat in unison? Does this explain how the organism can...
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 8 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago