Homework Answers
Add Answer to:
please help!
UIZ 2 George White: Attempt 1 Question 2 POML5) What would be the AH...
1. Calculate AH for the reaction C2H4 (8) + H2() → C2H6), from the following data....
1. Calculate AH for the reaction C2H4 (8) + H2() → C2H6), from the following data. C2H4 (g) + 3 02 (®) → 2 CO2 (s) + 2 H20 (1) C2H6 (g) + 7/2 02(g) → 2 CO2(g) + 3 H20 (1) H2 + 1/2O2() → H20 (1) AH = -1411. kJ/mole AH = -1560. kJ/mole AH = -285.8 kJ/mole 2. Calculate AH for the reaction 4 NH3(g) +502 (g) → 4 NO(g) + 6 H20 (g), from the following...
(1) Consider SO2 (g) + 2H2S(g) = 3(g) + 2H2O(1) AH : (i) SO2 (g) =...
(1) Consider SO2 (g) + 2H2S(g) = 3(g) + 2H2O(1) AH : (i) SO2 (g) = -296.8 KJ/mol (ii) H2S (g) = -20.4 KJ/mol (iii) H20 (1) = -285.84 KJ/mol AH for the above reaction is: (a) 234.08 KJ (b)-234.08 KJ (c) 31.36 kJ (d) -31.36 KJ (e) None (2) The above reaction is (a) Endothermic (b) Exothermic (c) entropic (3) in k = Ae Ea/RT, Ea is (a) Activation Energy (b) 8.314 J/mol.K (c) Rate constant (4) In a...
5. Using standard heats of formation, calculate AH for 4 FeO (s) + O2(g) → 2...
5. Using standard heats of formation, calculate AH for 4 FeO (s) + O2(g) → 2 Fe2O3 (s) AH1 of FeO (s) = -272.0 kJ/mol AHºf of Fe2O3 (s) = -825.5 kJ/mol 3. Given 3 C (s) + 4 H2(g) → C3H8 (9) AH = -103.85 kJ/mol C(s) + O2(g) + CO2(g) AH = -393.5 kJ/mol H2 (g) + 12 O2(g) → H2O (1) AH = -285.8 kJ/mol find AH for C3H8 (g) + 5 O2(g) → 3 CO2 (g)...
Homework Thermochemistry Name: 1. Calculate the mass of O that is produced by photosynthesis when 2.49...
Homework Thermochemistry Name: 1. Calculate the mass of O that is produced by photosynthesis when 2.49 x 109 kJ of solar energy is consumed by the following reaction: 6 H20 (1) + 6 CO2 (g) - C&H 20(s) + 6 02 (g) ; AH-2803 kJ 2. Given the following thermochemical equation, what amount of energy is absorbed/given off when 255 g of CuO is reacted. 2 Cu20 (s) - 4 Cu (s) + O2(g) : AH = 333.8 kJ 3....
DaC. NUL20 1) Find AH, for the reaction 2H2(g) + 2C(s) + O2(g) → C2H5OH(I), using...
DaC. NUL20 1) Find AH, for the reaction 2H2(g) + 2C(s) + O2(g) → C2H5OH(I), using the following thermochemical data. For Hess's Law, rewrite equations to find out AH. C2H5OH (1) +2 02 (g) → 2 CO2 (g) + 3H20 (1) AH = -875.J C(s) + O2(g) → CO2 (g) AH = -394,51 kJ H2(g) + 12 02 (g) → H20 (1) AH = -285.8 kJ
2) From the enthalpies of reaction provided, calculate the AH for the reaction of carbon with hydrogen as shown bel...
2) From the enthalpies of reaction provided, calculate the AH for the reaction of carbon with hydrogen as shown below. Is the reaction exothermic or endothermic? How many grams of C3Hg are produced with an enthalpy change of 209.4 kJ? 3 C(s) + 4 H2(g) - C He(a) moto-non (5+3=2 C3H8(9) + 5 O2(g) 3 CO2(g) + 4 H2O(9) AH = -2043 kJ/mol AH = -393.5 kJ/mol C(s) + Ozon 2 H2(g) + O2th CO2(g) 2 H20(9) AH = -483.6...
Homework Thermochemistry Name: 1. Calculate the mass of O2 that is produced by photosynthesis when 2.49...
Homework Thermochemistry Name: 1. Calculate the mass of O2 that is produced by photosynthesis when 2.49 x 10° kJ of solar energy is consumed by the following reaction: 6 H20 (1) + 6 CO2 (g) C6H12O6 (s) + 6 O2 (g) ; AH = 2803 kJ 2. Given the following thermochemical equation, what amount of energy is absorbed/given off when 255 g of Cu20 is reacted. 2 Cu20 (s) 4 Cu (s) + O2(g) ; AH = 333.8 kJ 3....
L 255-7.cozts) to 2) Ethanol, C2H5OH, is promoted as a clean fuel and is used as...
L 255-7.cozts) to 2) Ethanol, C2H5OH, is promoted as a clean fuel and is used as an additive in many gasoline mixtures. Calculate the AH rxn for the combustion of ethanol. Tail Substance Hºf(kJ/mol) og C2H5OH( -277.0 5 GHSCUli) + O2(9) -> CO2(g) +H2O() CO2(8) -393.5 737 H20(9) -241.8 A)-1235.4 kJ B-751.8 kJ C) -358.3 kJ D) 358.3 kJ E) 1235.4 Kj
(2) ( 2 points ) Compute AH for the reaction, 2 CH4 + C2H4(9) + 2...
(2) ( 2 points ) Compute AH for the reaction, 2 CH4 + C2H4(9) + 2 H2(g) given the following data: H2(g) + } 02(g) + H20(1) AH° = -285.8 kJ CO2(g) + 2 H2O(l) + CH4(g) + 2 029) AH° = 890.3 kJ 2 C2H6(g) + 7 02(g) + 4CO2(g) + 6 H2O(1) AH° = -3120.8 kJ C2H4(9) + H2(g) → C2H6(9) AH° = -136.3 kJ
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below:...
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
1. Calculate AH for the reaction C2H4 (8) + H2() → C2H6), from the following data. C2H4 (g) + 3 02 (®) → 2 CO2 (s) + 2 H20 (1) C2H6 (g) + 7/2 02(g) → 2 CO2(g) + 3 H20 (1) H2 + 1/2O2() → H20 (1) AH = -1411. kJ/mole AH = -1560. kJ/mole AH = -285.8 kJ/mole 2. Calculate AH for the reaction 4 NH3(g) +502 (g) → 4 NO(g) + 6 H20 (g), from the following...
(1) Consider SO2 (g) + 2H2S(g) = 3(g) + 2H2O(1) AH : (i) SO2 (g) = -296.8 KJ/mol (ii) H2S (g) = -20.4 KJ/mol (iii) H20 (1) = -285.84 KJ/mol AH for the above reaction is: (a) 234.08 KJ (b)-234.08 KJ (c) 31.36 kJ (d) -31.36 KJ (e) None (2) The above reaction is (a) Endothermic (b) Exothermic (c) entropic (3) in k = Ae Ea/RT, Ea is (a) Activation Energy (b) 8.314 J/mol.K (c) Rate constant (4) In a...
5. Using standard heats of formation, calculate AH for 4 FeO (s) + O2(g) → 2 Fe2O3 (s) AH1 of FeO (s) = -272.0 kJ/mol AHºf of Fe2O3 (s) = -825.5 kJ/mol 3. Given 3 C (s) + 4 H2(g) → C3H8 (9) AH = -103.85 kJ/mol C(s) + O2(g) + CO2(g) AH = -393.5 kJ/mol H2 (g) + 12 O2(g) → H2O (1) AH = -285.8 kJ/mol find AH for C3H8 (g) + 5 O2(g) → 3 CO2 (g)...
Homework Thermochemistry Name: 1. Calculate the mass of O that is produced by photosynthesis when 2.49 x 109 kJ of solar energy is consumed by the following reaction: 6 H20 (1) + 6 CO2 (g) - C&H 20(s) + 6 02 (g) ; AH-2803 kJ 2. Given the following thermochemical equation, what amount of energy is absorbed/given off when 255 g of CuO is reacted. 2 Cu20 (s) - 4 Cu (s) + O2(g) : AH = 333.8 kJ 3....
DaC. NUL20 1) Find AH, for the reaction 2H2(g) + 2C(s) + O2(g) → C2H5OH(I), using the following thermochemical data. For Hess's Law, rewrite equations to find out AH. C2H5OH (1) +2 02 (g) → 2 CO2 (g) + 3H20 (1) AH = -875.J C(s) + O2(g) → CO2 (g) AH = -394,51 kJ H2(g) + 12 02 (g) → H20 (1) AH = -285.8 kJ
2) From the enthalpies of reaction provided, calculate the AH for the reaction of carbon with hydrogen as shown below. Is the reaction exothermic or endothermic? How many grams of C3Hg are produced with an enthalpy change of 209.4 kJ? 3 C(s) + 4 H2(g) - C He(a) moto-non (5+3=2 C3H8(9) + 5 O2(g) 3 CO2(g) + 4 H2O(9) AH = -2043 kJ/mol AH = -393.5 kJ/mol C(s) + Ozon 2 H2(g) + O2th CO2(g) 2 H20(9) AH = -483.6...
Homework Thermochemistry Name: 1. Calculate the mass of O2 that is produced by photosynthesis when 2.49 x 10° kJ of solar energy is consumed by the following reaction: 6 H20 (1) + 6 CO2 (g) C6H12O6 (s) + 6 O2 (g) ; AH = 2803 kJ 2. Given the following thermochemical equation, what amount of energy is absorbed/given off when 255 g of Cu20 is reacted. 2 Cu20 (s) 4 Cu (s) + O2(g) ; AH = 333.8 kJ 3....
L 255-7.cozts) to 2) Ethanol, C2H5OH, is promoted as a clean fuel and is used as an additive in many gasoline mixtures. Calculate the AH rxn for the combustion of ethanol. Tail Substance Hºf(kJ/mol) og C2H5OH( -277.0 5 GHSCUli) + O2(9) -> CO2(g) +H2O() CO2(8) -393.5 737 H20(9) -241.8 A)-1235.4 kJ B-751.8 kJ C) -358.3 kJ D) 358.3 kJ E) 1235.4 Kj
(2) ( 2 points ) Compute AH for the reaction, 2 CH4 + C2H4(9) + 2 H2(g) given the following data: H2(g) + } 02(g) + H20(1) AH° = -285.8 kJ CO2(g) + 2 H2O(l) + CH4(g) + 2 029) AH° = 890.3 kJ 2 C2H6(g) + 7 02(g) + 4CO2(g) + 6 H2O(1) AH° = -3120.8 kJ C2H4(9) + H2(g) → C2H6(9) AH° = -136.3 kJ
6. Hess's Law. Use the data in Table 1 to calculate AH for the reaction below: Table 1. Change in Enthalpy for Reactions Reactions Change in Enthalpy (AH) AH = -393.5 kJ/mol (1) C() (2) Hz((g) + + O2(g) O2(g) → CO2(8) → H2O(l) AH2 = -285.8 kJ/mol (3) 2CH.(g) + 702(g) → 4 CO2(g)+ 6H2O(1) AH = -283.0 kJ/mol Calculate the enthalpy change for the reaction: 2 C(s) + 3H2(g) → CzH6(g) AH = kJ/mol
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago