Homework Answers
Energy stored as electrons which is present throughout the cycles in the form of NADH2 and FADH2 which is passed on to ETC creating electrochemical gradient for driving ATP.
Oxygen is oxidized, protons are just involved in creating gradient and carbohydrates are energy source and not storage form.
Add Answer to:
QUESTION 25 Throughout glycolysis, the citric acid cycle, and most of oxidative phosphorylation, energy is stored...
Oxidative phosphorylation refers to O the electron transport chain coupled to glycolysis O the citric acid...
Oxidative phosphorylation refers to O the electron transport chain coupled to glycolysis O the citric acid cycle coupled to ATP synthesis O beta-oxidation coupled to ATP synthesis O the electron transport chain coupled to ATP synthesis QUESTION 8 Which ATP synthase subunit binds protons from the intermembrane space? OCO O Beta Alpha O Gamma QUESTION 9 Which ATP synthase subunit catalyzes the phosphorylation of ADP? O Alpha Beta O Gamma O C10
Be able to label any and all steps in: glycolysis, the citric acid cycle and oxidative...
Be able to label any and all steps in: glycolysis, the citric acid cycle and oxidative phosphorylation. Including (but not limited to): names of compounds, enzymes (for extra credit where stated), ATP produced, NADH and FADH2 produced, and the role or importance of main molecules. **Note: this is really three questions in one. Therefore, know how to label the sequences in 1. Glycolysis 2. The citric acid cycle and 3. Oxidative phosphorylation .
Which of the following reduces NAD+ to NADH? *photosystem I *glycolysis *fermentation *oxidative phosphorylation *citric acid...
Which of the following reduces NAD+ to NADH? *photosystem I *glycolysis *fermentation *oxidative phosphorylation *citric acid cycle *Calvin cycle
Where do the following occur in a cell? a) Glycolysis b) Citric Acid Cycle c) Oxidative...
Where do the following occur in a cell? a) Glycolysis b) Citric Acid Cycle c) Oxidative Phosphorylation d) Carbon Fixation
During which step(s) of cellular respiration does the cell generate ATP? Glycolysis Citric Acid Cycle Oxidative...
During which step(s) of cellular respiration does the cell generate ATP? Glycolysis Citric Acid Cycle Oxidative Phosphorylation A and B only are true B and C only are true A and C only are true A. B. and C are all true What is substrate-level phosphorylation? The phosphorylation of reactants by phosphatases an enzyme directly adds one phosphate at a time to a molecule Multiple phosphorylation's happening at the same time Phosphorylation that happens outside the mitochondria
Question 12 0.25 pts Glucose oxidation is completed (i.e. finished) in Gluconeogenesis Oxidative phosphorylation O Pyruvate...
Question 12 0.25 pts Glucose oxidation is completed (i.e. finished) in Gluconeogenesis Oxidative phosphorylation O Pyruvate oxldation Glycolysis o The Citric Acid Cycle
Two related species metabolize glucose using the exact same pathways (glycolysis, citric acid cycle, oxidative phosphorylation)....
Two related species metabolize glucose using the exact same pathways (glycolysis, citric acid cycle, oxidative phosphorylation). Experiments show, however, that species A generates only 83% of the ATP compared to species B when provided with the same amount of glucose. What could be a potential reason for this outcome? The ATP synthase of species A contains 8c subunits, while species B contains 10 c subunits. The ATP synthase of species A contains 12 c subunits, while species B contains 10...
7. What is the difference between substrate level phosphorylation and oxidative phosphorylation? And, where specifically do...
7. What is the difference between substrate level phosphorylation and oxidative phosphorylation? And, where specifically do they occur in glycolysis, the citric acid cycle, and oxidative phosphorylation (which steps/complexes)? 10 points
1Q 5.1 Energy Transformations in Cells The energy released by oxidizing glucose is saved in the...
1Q 5.1 Energy Transformations in Cells The energy released by oxidizing glucose is saved in the high-energy bonds of: O A ADP and other activated carrier molecules O B ATP and other activated carrier molecules O C GDP and other activated carrier molecules. O D water and carbon dioxide. Unanswered 2 attempts left Assigned as Homework 0 2Q 5.1 Energy Transformations in Cells Sugars (glucose) ingested from food are broken down by O A glycolysis, the citric acid cycle, and...
QUESTION 65 Free energy (delta G) is higher during the citric acid cycle than during glycolysis....
QUESTION 65 Free energy (delta G) is higher during the citric acid cycle than during glycolysis. Despite this, only two molecules of ATP will be generated in the krebs cycle. Most of the remaining free energy that is released during the krebs cycle will be O a. Used to synthesize GTP O b. Converted into kinetic energy O c.Lost as heat d. Used to reduce pyruvate Oe. Used to reduce electron carriers such as NADH and FADH2
Oxidative phosphorylation refers to O the electron transport chain coupled to glycolysis O the citric acid cycle coupled to ATP synthesis O beta-oxidation coupled to ATP synthesis O the electron transport chain coupled to ATP synthesis QUESTION 8 Which ATP synthase subunit binds protons from the intermembrane space? OCO O Beta Alpha O Gamma QUESTION 9 Which ATP synthase subunit catalyzes the phosphorylation of ADP? O Alpha Beta O Gamma O C10
During which step(s) of cellular respiration does the cell generate ATP? Glycolysis Citric Acid Cycle Oxidative Phosphorylation A and B only are true B and C only are true A and C only are true A. B. and C are all true What is substrate-level phosphorylation? The phosphorylation of reactants by phosphatases an enzyme directly adds one phosphate at a time to a molecule Multiple phosphorylation's happening at the same time Phosphorylation that happens outside the mitochondria
Question 12 0.25 pts Glucose oxidation is completed (i.e. finished) in Gluconeogenesis Oxidative phosphorylation O Pyruvate oxldation Glycolysis o The Citric Acid Cycle
Two related species metabolize glucose using the exact same pathways (glycolysis, citric acid cycle, oxidative phosphorylation). Experiments show, however, that species A generates only 83% of the ATP compared to species B when provided with the same amount of glucose. What could be a potential reason for this outcome? The ATP synthase of species A contains 8c subunits, while species B contains 10 c subunits. The ATP synthase of species A contains 12 c subunits, while species B contains 10...
7. What is the difference between substrate level phosphorylation and oxidative phosphorylation? And, where specifically do they occur in glycolysis, the citric acid cycle, and oxidative phosphorylation (which steps/complexes)? 10 points
1Q 5.1 Energy Transformations in Cells The energy released by oxidizing glucose is saved in the high-energy bonds of: O A ADP and other activated carrier molecules O B ATP and other activated carrier molecules O C GDP and other activated carrier molecules. O D water and carbon dioxide. Unanswered 2 attempts left Assigned as Homework 0 2Q 5.1 Energy Transformations in Cells Sugars (glucose) ingested from food are broken down by O A glycolysis, the citric acid cycle, and...
QUESTION 65 Free energy (delta G) is higher during the citric acid cycle than during glycolysis. Despite this, only two molecules of ATP will be generated in the krebs cycle. Most of the remaining free energy that is released during the krebs cycle will be O a. Used to synthesize GTP O b. Converted into kinetic energy O c.Lost as heat d. Used to reduce pyruvate Oe. Used to reduce electron carriers such as NADH and FADH2
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 28 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago