What are the IUPAC name for the compounds shown below?
What are the IUPAC name for the compounds shown below? F. Cl CI CH2CH3
What is the systematic name (IUPAC name) of CH3CH2CH2CH(CH2CH3)CH2CH3?
Name the following compounds: CH2CH3 CH2CH3meta -1,3-dimethybenzene CI CI 1,2,4-trichlorobenzene CI Br OH CI
Provide an IUPAC name for each of the compounds shown. (Specify (E)/(Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc.) CH3 CH3CH2CH H H₃C o I H CH3 CH3 CH3 eu CH3CHCO H CH3 Provide an IUPAC name for each of the compounds shown. (Specify (E)/(Z) stereochemistry, if relevant, for straight chain alkenes only. Pay attention to commas, dashes, etc.) ci? CH3 CH2CH3 mocloco CH3CH2CH2 C= H3CH2CH2C C
Write the IUPAC name for each of the compounds drawn below on the line provided. Be sure to include stereochemical information if applicable (R, S, Cis, Trans, E, Z) Instructions: write the IUPAC name for each of the compounds drawn below on the line provided. Be sure to include stereochemical information if applicable (R, S, cis, trans, E, Z) CI Cl Br Instructions: write the IUPAC name for each of the compounds drawn below on the line provided. Be sure...
) What is the IUPAC name for the molecule below? Br CH2CH3 H3C
Please provide an IUPAC name for each of the following structures CH3 HзС, CH2CH3CHCH3 F CH2CH3 CH3CH2 CH3 Br CI BrCH2CH2CH-CCH3 CH2CH3 CH3CH2CH2CH2CCH2CH2CH3 CH2 CHз CH3CH2CH2 CH2CH3CH2CH3 н н НзС CH3
1. Name using IUPAC nomenclature following compounds. NO2 CH3 c) CI b) a) ÓCH3 Br CH3 Cl соон Cl CHO
What is the correct IUPAC name for the compound shown below? H3C CH3 C=C H CH2CH3 O cis-2-ethyl-2-butene (Z)-2-ethyl-2-butene O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O (Z)-3-methyl-2-pentene
What is the correct IUPAC name for the compound shown below? CH3 HC С=С H CH2CH3 O (E)-3-methyl-2-pentene O trans-3-methyl-3-pentene O cis-2-ethyl-2-butene O (Z)-2-ethyl-2-butene O (Z)-3-methyl-2-pentene
Problem 8: Give IUPAC names for the compounds shown below. CI O CI Br کہللا کلید مو CI 025 Q26 Q27 Problem 9: Provide reasonable starting materials for the following three compounds. Q28 Michael Acceptor Q29 Michael Donor 0= H Q30 Diene + Q31 Dienophile H Q32 SM1 + Q33 SM2