PLEASE DO NOT WRITE BY HAND!! Please answer these three questions. 1. Why would the rate...
PLEASE DO NOT WRITE BY HAND!!
Please answer these three questions.
1. Why would the rate of reaction be slower if the following ester was used in place of adipoyl chloride?
2. The product of the following reaction is commonly known is Kevlar. Draw the polymer product of the following reaction.
3. Acid chlorides react with a wide variety of nucleophiles. What is the product of the following reaction where a diol is used as a nucleophile?
Homework Answers
1. Since the order of reactivity of acid derivatives is as follows: Acid chloride < Anhydride < Ester < Amide
Hence adipoyl Chloride is more reactive.
2& 3 are examples condensation polymerization.
Add Answer to:
PLEASE DO NOT WRITE BY HAND!!
Please answer these three questions.
1. Why would the rate...
This is for the Grignard Reaction laboratory. Please help me answer this question, much appreciated. 1....
This is for the Grignard Reaction laboratory. Please help me answer this question, much appreciated. 1. If a student performing Laboratory with Grignard reaction accidently used acetone as the reaction solvent instead of diethyl ether, what would the major organic product(s) be? Draw the structure of the product(s) (no mechanism necessary). b. What was the purpose of adding magnesium sulfate in this experiment? c. Grignard reagents react with both aldehyde and ketone functional groups. How do you predict the reaction...
Please answer the following two questions 1 and 2. Please answer the following questions 1 and...
Please answer the following two questions 1 and 2.
Please answer the following questions 1 and 2 1. Write the structural chemical equation for the reaction of the given acids with thionyl chloride. a.) Cinnamic Acid + thionyl chloride b.) 4-methoxybenzoic acid + thionyl chloride Write the structural chemical equation for the reaction of your acid chloride from question 2 and aniline for the formation of anilide derivative, and draw out the detailed mechanism with electron pushing arrows. 2.
20.14 ULUS because they result in the transfer of an wety np. from one heterontom to...
20.14
ULUS because they result in the transfer of an wety np. from one heterontom to another is prepared by the acetylation of morphine, an analyesic compound Isolated from the opium poppy. Both OH groups of morphine are readily acetylated with ceris whydride to form the diester present in heroin. HO OT o HF HOW Problem 20.14 morphine heroin minyarides react like acid chlorides with the nucleophiles described in Chapter 17. draw the products formed when each of the following...
Draw the organic products of the following below reactions Please answer the following questions - 11...
Draw the organic products of the following below
reactions
Please answer the following questions - 11 &12
Slide 10
14. Draw the organic product of the following reactions. NaOH OH SOCl2 OH 800°C OH 11. Why do aldehydes and ketones undergo nucleophilic addition undergo nucleophilic substitution? and carboxylic acid derivatives lain the reactivity trend shown in Slide 10 (acid chlorides>anhydridessestersoamides). Relative Reactivity of Carboxylic Acid Derivatives Substitution in Synthesis Nucleophiles react more readily with unhindered carbonyl groups More electrophilic carbonyl...
please answer all!! 9. Draw the three organic products formed from the following reaction with excess...
please answer all!!
9. Draw the three organic products formed from the following reaction with excess acid and water. (6) HO NH 10. Draw two monomers that could produce the following polymer. (4) 11. Draw an ester and a Grignard reagent that would make the following compound. (4). OH yo
PLEASE HELP ME IT IS DUE TONIGHT ! write the whole reaction out neatly ou [1]...
PLEASE HELP ME IT IS DUE TONIGHT ! write the whole reaction
out neatly
ou [1] Oxidation of 1 alcohols with PCC (Section 12.12B) РСС но. 1 alcohol н R Reduction of esters (Section 17.7A) [2] о O [1] DIBAL-H OR [2] Н,о ester Reduction of acid chlorides (Section 17.7A) [3] O 1 LIAIHOC(CHab CI н [2] H2O acid chloride [4] Hydroboration-oxidation of an alkyne (Section 11.10) (1 R BH R H [2] H202, OH alkyne
complete #1 and #2 and please explain! Nucleophilic Substitutions: Competing Nucleophiles Dry Lab Name When an...
complete #1 and #2 and please explain!
Nucleophilic Substitutions: Competing Nucleophiles Dry Lab Name When an alcohol (substrate) is placed in an excess equimolar amounts of chloride ions and bromide ions in acid media the corresponding alkyl halides are obtained. The ratio of the alkyl halides depends on several factors: the nature of the substrate, the reaction conditions, the solvent and the mechanism of the reaction. (Refer to your lab textbook, see syllabus schedule) When fert-butanol (density 20 °C-0.7858 g/mL)...
use the notes provided to help answer the question above. will rate well The second step...
use the notes provided to help answer the question
above. will rate well
The second step of the synthesis transformation of the chlorosulfonyl functional group into a sulfonamide) is an example of a a. Nucleophilic displacement (substitution) b Elimination C. Electrophilic aromatic substitution d. Acid hydrolysis Esterification e. THE SULFONIC ACID GROUP AND ITS DERIVATIVES Sulfonic acids are organic analogs of sulfuric acid, a very strong acid. They are highly corrosive, react vigorously with water, and can cause skin bums....
Answer the following questions: Why is L-B acid catalysis required to convert a carboxylic acid and...
Answer the following questions: Why is L-B acid catalysis required to convert a carboxylic acid and an alcohol to an ester? Why is acyl bromide less reactive than acyl chloride? What reagent will you use to convert benzoic acid to benzoyl chloride: SOCl_2; PCl_3; or PCl_5 or any one of them? Why is Fischer Esterification reaction is not universal (i.e. not applicable to many acids and or alcohols)? Please draw the FIRST mechanistic step in ALL L-B acid catalyzed acyl...
please answer all parts Does 1-chlorobutane, an alkyl chloride, undergo a substitution reaction with the nucleophiles...
please answer all parts
Does 1-chlorobutane, an alkyl chloride, undergo a substitution reaction with the nucleophiles NaCl, NaBr, or Nal? Solubility data for each of these nucleophiles and the substrate is given in Table 1 below. Table 1: Solubility of Compounds in Various Solvents Compound Solvents in Which Soluble 1-chlorobutane Diethyl ether, hexanes, acetone, tetrahydrofuran NaCl Water, glycerol, ethylene glycol, formic acid NaBr Water, methanol Nal Water, ethanol, acetone 4. Write balanced chemical equations showing 1-chlorobutane undergoing a nucleophilic substitution...
Please answer the following two questions 1 and 2.
Please answer the following questions 1 and 2 1. Write the structural chemical equation for the reaction of the given acids with thionyl chloride. a.) Cinnamic Acid + thionyl chloride b.) 4-methoxybenzoic acid + thionyl chloride Write the structural chemical equation for the reaction of your acid chloride from question 2 and aniline for the formation of anilide derivative, and draw out the detailed mechanism with electron pushing arrows. 2.
20.14
ULUS because they result in the transfer of an wety np. from one heterontom to another is prepared by the acetylation of morphine, an analyesic compound Isolated from the opium poppy. Both OH groups of morphine are readily acetylated with ceris whydride to form the diester present in heroin. HO OT o HF HOW Problem 20.14 morphine heroin minyarides react like acid chlorides with the nucleophiles described in Chapter 17. draw the products formed when each of the following...
Draw the organic products of the following below
reactions
Please answer the following questions - 11 &12
Slide 10
14. Draw the organic product of the following reactions. NaOH OH SOCl2 OH 800°C OH 11. Why do aldehydes and ketones undergo nucleophilic addition undergo nucleophilic substitution? and carboxylic acid derivatives lain the reactivity trend shown in Slide 10 (acid chlorides>anhydridessestersoamides). Relative Reactivity of Carboxylic Acid Derivatives Substitution in Synthesis Nucleophiles react more readily with unhindered carbonyl groups More electrophilic carbonyl...
please answer all!!
9. Draw the three organic products formed from the following reaction with excess acid and water. (6) HO NH 10. Draw two monomers that could produce the following polymer. (4) 11. Draw an ester and a Grignard reagent that would make the following compound. (4). OH yo
PLEASE HELP ME IT IS DUE TONIGHT ! write the whole reaction
out neatly
ou [1] Oxidation of 1 alcohols with PCC (Section 12.12B) РСС но. 1 alcohol н R Reduction of esters (Section 17.7A) [2] о O [1] DIBAL-H OR [2] Н,о ester Reduction of acid chlorides (Section 17.7A) [3] O 1 LIAIHOC(CHab CI н [2] H2O acid chloride [4] Hydroboration-oxidation of an alkyne (Section 11.10) (1 R BH R H [2] H202, OH alkyne
complete #1 and #2 and please explain!
Nucleophilic Substitutions: Competing Nucleophiles Dry Lab Name When an alcohol (substrate) is placed in an excess equimolar amounts of chloride ions and bromide ions in acid media the corresponding alkyl halides are obtained. The ratio of the alkyl halides depends on several factors: the nature of the substrate, the reaction conditions, the solvent and the mechanism of the reaction. (Refer to your lab textbook, see syllabus schedule) When fert-butanol (density 20 °C-0.7858 g/mL)...
use the notes provided to help answer the question
above. will rate well
The second step of the synthesis transformation of the chlorosulfonyl functional group into a sulfonamide) is an example of a a. Nucleophilic displacement (substitution) b Elimination C. Electrophilic aromatic substitution d. Acid hydrolysis Esterification e. THE SULFONIC ACID GROUP AND ITS DERIVATIVES Sulfonic acids are organic analogs of sulfuric acid, a very strong acid. They are highly corrosive, react vigorously with water, and can cause skin bums....
Answer the following questions: Why is L-B acid catalysis required to convert a carboxylic acid and an alcohol to an ester? Why is acyl bromide less reactive than acyl chloride? What reagent will you use to convert benzoic acid to benzoyl chloride: SOCl_2; PCl_3; or PCl_5 or any one of them? Why is Fischer Esterification reaction is not universal (i.e. not applicable to many acids and or alcohols)? Please draw the FIRST mechanistic step in ALL L-B acid catalyzed acyl...
please answer all parts
Does 1-chlorobutane, an alkyl chloride, undergo a substitution reaction with the nucleophiles NaCl, NaBr, or Nal? Solubility data for each of these nucleophiles and the substrate is given in Table 1 below. Table 1: Solubility of Compounds in Various Solvents Compound Solvents in Which Soluble 1-chlorobutane Diethyl ether, hexanes, acetone, tetrahydrofuran NaCl Water, glycerol, ethylene glycol, formic acid NaBr Water, methanol Nal Water, ethanol, acetone 4. Write balanced chemical equations showing 1-chlorobutane undergoing a nucleophilic substitution...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 34 minutes ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 56 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 2 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 4 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 4 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 5 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 7 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 7 hours ago