Would each of the following scenarios cause you to calculate a heat fusion higher or lower...
Would each of the following scenarios cause you to calculate a heat fusion higher or lower than the accepted answer? Explain your answer.
a) the ice you add to the calorimeter has a significant amount of water on it
b) the ice is initially colder than 0 degree celsius
c) a significant amount of water is taken when the excess ice is removed from the calorimeter
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Add Answer to:
Would each of the following scenarios cause you to calculate a
heat fusion higher or lower...
1. An unknown sample is being evaluated in lab. What is the specific heat of the...
1. An unknown sample is being evaluated in lab. What is the specific heat of the compound if it requires 105.06 J to raise the temperature of 51.68 grams of the unknown from 15.25 °C to 22.9 °C. 2. A 25.00 gram sample of an unknown metal initially at 99.0 degrees Celsius is added to 50.00 grams of water initially at 5.94 degrees Celsius. The final temperature of the system is 20.15 degrees Celsius. Calculate the specific heat of the...
1. An unknown sample is being evaluated in lab. What is the specific heat of the...
1. An unknown sample is being evaluated in lab. What is the specific heat of the compound if it requires 105.06 J to raise the temperature of 51.68 grams of the unknown from 15.25 °C to 22.9 °C. 2. A 25.00 gram sample of an unknown metal initially at 99.0 degrees Celsius is added to 50.00 grams of water initially at 5.94 degrees Celsius. The final temperature of the system is 20.15 degrees Celsius. Calculate the specific heat of the...
I need help please Enthalpy of Fusion of Ice This worksheet will help you organize your thoughts for the discussi...
I need help please
Enthalpy of Fusion of Ice
This worksheet will help you organize your thoughts for the discussion. Write down some notes based on the questions and prompts below. 1. Describe the parts of a coffee cup calorimeter. In your description, specify the use of each part. 2. Outline how you would use a calorimeter to determine the enthalpy of fusion of ice. 3. Suppose the enthalpy of fusion of ice determined from your experiment is lower than...
We did the lab of latent heat of fusion of ice, and I am confused that what the 'water equivalent...
We did the lab of latent heat of fusion of ice, and I am
confused that what the 'water equivalent' represents.
I thought it is the amount (kg) of water, but it is
mccc according to this lab manual, which unit
is (J/oC).
Please answer what the water equivalent represents and the unit
of it.
- In this experiment, an ice cube of mass mt, assumed to be at 0°C, is placed in a calorimeter containing a mass of water...
Calculate the final equilibrium temperature when 10.0 grams of steam initially at 100 degree C is...
Calculate the final equilibrium temperature when 10.0 grams of steam initially at 100 degree C is mixed with 450 grams of liquid water and 110 grams of ice at 0 degree C in a calorimeter. That is, the liquid water AND the ice are initially at 0 degree C. Ignore any heat energy exchanges with the calorimeter and the surroundings. If you conclude that the final temperature of the system is 0 degree C, then what mass of ice remains,...
Explain what effect the following scenarios would have on the calculated specific heat (i.e. would it...
Explain what effect the following scenarios would have on the calculated specific heat (i.e. would it be calculated artificially high, low, or have no effect). Your explanation should address what variable(s) would be affected by the scenario and how that affects the calculation of specific heat.(1.5pt each) A student accidently dropped the piece of metal on the countertop during the process of transferring it from the boiling water bath to the calorimeter, but was quickly picked up and put into...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6.01 kJ/mol. The molar heat of fusion (AH) of ice is the amount of heat required to melt 1 mole of ice experiment is to determine the molar heat of fusion of ice and compare the experimental Definition Heat of fusion of ice is the amount of heat required to melt ice. The more the ice to melt,...
Using the values for the heat of fusion, specific heat of water, and/or heat of vaporization,...
Using the values for the heat of fusion, specific heat of water, and/or heat of vaporization, calculate the amount of heat energy in each of the following: Part A; joules needed to melt 20.0 g of ice at 0 ∘C and to warm the liquid to 55.0 ∘C Express your answer to three significant figures and include the appropriate units. Part B: kilocalories released when 40.0 g of steam condenses at 100 ∘C and the liquid cools to 0 ∘C...
Using the heat of fusion for water 334 J/g the heat of vaporization for water 2260...
Using the heat of fusion for water 334 J/g the heat of
vaporization for water 2260 J / g and fhe specific heat of water
4.184 J/g C calculate the total amount of heat for each of the
following
Using the heat of fusion for water, 334 J/g. the heat of vaporication for water 2260 J/6, and the specific heat of water, 4 184J/g °C, calculate the total amount of heat for each of the following Part A joules released...
1) What Physical properties, other than specific heat, could you use to help identify unknown metals
1) What Physical properties, other than specific heat, could you use to help identify unknown metals? 2) Why is water an excellent material to use in a calorimeter?Density, color, resistivity (or conductitivy), melting point, crystallization. 2) water is excellent because it has a high thermal inertia (specific heat), it is non corrosive, it is cheap. It however is restricted to temperatures below 100C.Why is water an excellent material to use in a calorimeter Why is water an excellent material to...
I need help please
Enthalpy of Fusion of Ice
This worksheet will help you organize your thoughts for the discussion. Write down some notes based on the questions and prompts below. 1. Describe the parts of a coffee cup calorimeter. In your description, specify the use of each part. 2. Outline how you would use a calorimeter to determine the enthalpy of fusion of ice. 3. Suppose the enthalpy of fusion of ice determined from your experiment is lower than...
We did the lab of latent heat of fusion of ice, and I am
confused that what the 'water equivalent' represents.
I thought it is the amount (kg) of water, but it is
mccc according to this lab manual, which unit
is (J/oC).
Please answer what the water equivalent represents and the unit
of it.
- In this experiment, an ice cube of mass mt, assumed to be at 0°C, is placed in a calorimeter containing a mass of water...
Calculate the final equilibrium temperature when 10.0 grams of steam initially at 100 degree C is mixed with 450 grams of liquid water and 110 grams of ice at 0 degree C in a calorimeter. That is, the liquid water AND the ice are initially at 0 degree C. Ignore any heat energy exchanges with the calorimeter and the surroundings. If you conclude that the final temperature of the system is 0 degree C, then what mass of ice remains,...
Determination Of The Molar Heat of Fusion Of Ice Purpose The purpose of this result with its reported value that is s 6.01 kJ/mol. The molar heat of fusion (AH) of ice is the amount of heat required to melt 1 mole of ice experiment is to determine the molar heat of fusion of ice and compare the experimental Definition Heat of fusion of ice is the amount of heat required to melt ice. The more the ice to melt,...
Using the heat of fusion for water 334 J/g the heat of
vaporization for water 2260 J / g and fhe specific heat of water
4.184 J/g C calculate the total amount of heat for each of the
following
Using the heat of fusion for water, 334 J/g. the heat of vaporication for water 2260 J/6, and the specific heat of water, 4 184J/g °C, calculate the total amount of heat for each of the following Part A joules released...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 28 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago