Draw the complete pathway Conversion of Ribulose-1,5-Bisphosphate to glucose, also highlight the CO2 molecule that enters...
Draw the complete pathway
Conversion of Ribulose-1,5-Bisphosphate to glucose, also highlight the CO2 molecule that enters the pathway in every step
Homework Answers
The question is asking to draw Calvin cycle. It is a process of dark reaction which leads to the synthesis of glucose by atmospheric carbon dioxide.
It take place in stroma of chloroplast and the key enzyme is rubisco.
Please rate.
Add Answer to:
Draw the complete pathway
Conversion of Ribulose-1,5-Bisphosphate to glucose, also
highlight the CO2 molecule that enters...
Calvin-Benson Cycle AG0 (kJ/mol) +70.0 Reaction Ribulose-1,5-bisphosphate CO2 H2O 2(3-phosphoglycerate) +H Enzyme Ribulose-1,5-bisphosphate carboxylase oxygenase ЕС...
Calvin-Benson Cycle AG0 (kJ/mol) +70.0 Reaction Ribulose-1,5-bisphosphate CO2 H2O 2(3-phosphoglycerate) +H Enzyme Ribulose-1,5-bisphosphate carboxylase oxygenase ЕС Cofactors Regulation Notes 4,1.1.39 Mg2, cobalamin (B,2) coenzyme-A, NADH H Fe-S clusters, and possibly ATP Ribulose-1,5-bisphosphate (RUBP) behaves as an inhibitor by strongly binding to the activated form of the enzyme (ЕСM) Rubisco activase catalyzes the dissociation of RuBP from ECM Rubisco is very inefficient as a carboxylase It is probably the most abundant protein on earth; up to 50% of leaf protein is...
The fixation of CO2 into carbohydrates is catalyzed by Select one: a. ribulose 1,5-bisphosphate carboxylase b....
The fixation of CO2 into carbohydrates is catalyzed by Select one: a. ribulose 1,5-bisphosphate carboxylase b. thioredoxin c. rubisco activase d. 3-phosphoglycerate
Draw how the chemical structure changes during the fixation phase of the Calvin Cycle (Ribulose-1,5-bisphosphate +...
Draw how the chemical structure changes during the fixation phase of the Calvin Cycle (Ribulose-1,5-bisphosphate + CO2 --> 6-Carbon Intermediate --> 3-Phosphoglycerate). Include enzymes used and any byproducts formed. What enzyme mediates this change in Q3? What does it do? Are there any byproducts other than 3-Phosphoglycerate? Why or why not?
3,6,12 are options for all three In order to make a molecule of glucose, (Select) molecules...
3,6,12 are options for all three
In order to make a molecule of glucose, (Select) molecules of ribulose-1,5- bisphosphate must react with (Select] molecules of CO2 to produce [Select) molecules of 3-phosphoglycerate.
The following metabolic pathway allows for complete aerobic oxidation of glucose to CO2 and H2O, starting...
The following metabolic pathway allows for complete aerobic oxidation of glucose to CO2 and H2O, starting with the pentose phosphate pathway (PPP). Determine the number of ATP generated from one glucose molecule by filling in the blanks: your answers should include the number of ATP produced by substrate level phosphorylation, and the number of FADH2 and NADH (include NADPH) produced. For your calculation, assume that after electron transport driven ATP synthesis, 3ATP molecules are produced per NAD(P)H and 2 ATP...
Describe the pathway of free glucose in the bloodstream through its complete oxidation to CO2 and...
Describe the pathway of free glucose in the bloodstream through its complete oxidation to CO2 and H2O during cellular respiration. Include relevant signaling molecules, metabolic pathways, key intermediates and locations of all metabolic steps.
Create a metabolic pathway map that shows what happens to a glucose molecule that enters a muscle...
Create a metabolic pathway map that shows what happens to a glucose molecule that enters a muscle cell and becomes metabolized to lactate (in Oz-depleted muscle). Follow the lactate through the Cori cycle, and show how it ultimately gets converted to a glucose molecule that can once again enter the muscle cell. In addition, show how the glucose may be stored as glycogen, and mobilized from glycogen in both liver and muscle. Also show how pyruvate gets converted to acetyl-CoA...
5. Glycolysis a. The hydroxyl group on the sixth carbon on a glucose molecule is radiolabeled...
5. Glycolysis a. The hydroxyl group on the sixth carbon on a glucose molecule is radiolabeled using O. Please draw out the pathway showing where this radiolabel is in each step of the pathway, b. In glycolysis, ATP molecules are produced. Please write out the reactions that utilize ATP as well as the ones that create ATP, and explain how many molecules of ATP are made in glycolysis. c. A reaction is set up with 3-phosphoglycerate, where the phosphate atom...
Question: You buy a sample of glucose that has the radioactive carbon-14 (C) isotope at the...
Question: You buy a sample of glucose that has the radioactive carbon-14 (C) isotope at the second position (Carbon #2). All other carbon positions in the glucose molecules have the "C isotope. "C is only a label and does not alter the biochemical behavior of the molecules in which it is found. This glucose sample is mixed with all the enzymes derived from liver cells, which initially contain no other C-labeled chemicals. A) Draw the Haworth structure of glucose and...
a. Draw a Lewis structure for BH2F. Also, Indicate the overall dipole moment of the molecule...
a. Draw a Lewis structure for BH2F. Also, Indicate the overall dipole moment of the molecule (do not draw each individual arrow as your overall dipole moment). Finally, indicate the electron geometry of the molecule according to VSEPR. b. Draw a Lewis structure for (C3H6O). Also, indicate the overall dipole moment of the molecule (do not draw each individual arrow as your overall dipole moment). Finally, indicate the electron geometry of the molecule according to VSEPR. c. Determine the oxidation...
Calvin-Benson Cycle AG0 (kJ/mol) +70.0 Reaction Ribulose-1,5-bisphosphate CO2 H2O 2(3-phosphoglycerate) +H Enzyme Ribulose-1,5-bisphosphate carboxylase oxygenase ЕС Cofactors Regulation Notes 4,1.1.39 Mg2, cobalamin (B,2) coenzyme-A, NADH H Fe-S clusters, and possibly ATP Ribulose-1,5-bisphosphate (RUBP) behaves as an inhibitor by strongly binding to the activated form of the enzyme (ЕСM) Rubisco activase catalyzes the dissociation of RuBP from ECM Rubisco is very inefficient as a carboxylase It is probably the most abundant protein on earth; up to 50% of leaf protein is...
3,6,12 are options for all three
In order to make a molecule of glucose, (Select) molecules of ribulose-1,5- bisphosphate must react with (Select] molecules of CO2 to produce [Select) molecules of 3-phosphoglycerate.
Create a metabolic pathway map that shows what happens to a glucose molecule that enters a muscle cell and becomes metabolized to lactate (in Oz-depleted muscle). Follow the lactate through the Cori cycle, and show how it ultimately gets converted to a glucose molecule that can once again enter the muscle cell. In addition, show how the glucose may be stored as glycogen, and mobilized from glycogen in both liver and muscle. Also show how pyruvate gets converted to acetyl-CoA...
5. Glycolysis a. The hydroxyl group on the sixth carbon on a glucose molecule is radiolabeled using O. Please draw out the pathway showing where this radiolabel is in each step of the pathway, b. In glycolysis, ATP molecules are produced. Please write out the reactions that utilize ATP as well as the ones that create ATP, and explain how many molecules of ATP are made in glycolysis. c. A reaction is set up with 3-phosphoglycerate, where the phosphate atom...
Question: You buy a sample of glucose that has the radioactive carbon-14 (C) isotope at the second position (Carbon #2). All other carbon positions in the glucose molecules have the "C isotope. "C is only a label and does not alter the biochemical behavior of the molecules in which it is found. This glucose sample is mixed with all the enzymes derived from liver cells, which initially contain no other C-labeled chemicals. A) Draw the Haworth structure of glucose and...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 minute ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 32 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago