A- The given acid HNO3 is a strong acid. We know the strong acids dissociates 100% to H+ ion. Thus the pH of strong acid is calculated as
pH = -log [H+]
Now due to 100% dissociation i.e all the HNO3 will completely converted into H+, [H+] = [HNO3] = 0.028 M
Thus pH = -log [H+] = -log [0.028] = 1.55
B-
For Benzoic acid (C6H5COOH), it is a weak acid. Thus it cant dissociates 100% to H+ ion. Hence some of the acid dissociate ti H+ and some remain as C6H5COOH.
Now the given Ka represents the dissociation constant for C6H5COOH
i.e C6H5COOH → H+ + C6H5COO- This is the dissociation reaction of Benzoic acid
Here C6H5COOH = the weak acid and C6H5COO- = conjugate base
Here Ka = [H+][C6H5COO-]/[C6H5COOH]
Now pH of weak acid is calculated by Henderson Hasselblach Equation-
pH = pKa + log [Conjugate base] / [weak acid] where pKa = -log Ka
Now given [C6H5COOH] = 0.028 M and Ka = 6.5x10-5
Lets consider x M of acid is dissociate to C6H5COO- . Then to find the concentration of acicd and conjugate base, we have to form the ICE table
[C6H5COOH] | [H+] | [C6H5COO-] | |
Initial | 0.028 M | 0 | 0 |
Change | -x | +x | +x |
Equilibrium | 0.028 M -x | +x | +x |
Now putting the values for
Ka = [H+][C6H5COO-]/[C6H5COOH]
6.5x10-5 = x * x / 0.028 M -x
6.5x10-5 * (0.028 M -x) = x2
0.00000182 - 0.000065x = x2
Or x2 + 0.000065x - 0.00000182 = 0
Now solving this,
x = 0.0013
Thus at equilibrium, [C6H5COOH] = 0.028 M -x = 0.028 M - 0.0013 = 0.0267 M
And [C6H5COO-] = x = 0.0013 M
Again pKa = -log Ka = -log (6.5x10-5) = 5 - log 6.5 = 4.18
Now putting the values in the equation-
pH = pKa + log [Conjugate base] / [weak acid]
pH = 4.18 + log [0.0013] / [0.0267]
= 4.18 + log [0.048]
= 2.86
A) calculate the ph of a 0.028 M HNO3 solution B) Calculate the pH of a...
Calculate the pH at the equivalence point in titrating 0.028 M solutions of each of the following with 0.031 M NaOH. (a) nitric acid (HNO3) pH = ______ (b) benzoic acid (HC7H5O2), Ka = 6.3e-05 pH = _______ (c) hypobromous acid (HBrO), Ka = 2.5e-09 pH = _______
calculate the pH of a 0.30 M solution of benzoic acid (HC7H5O2, Ka = 6.5x10-5)
1. Calculate the pH a. a 0.040 M solution of HCIO, b. a 0.028 M solution of NaOH c. a 0.0011 M solution of Ca(OH)2 2. Fill in the blanks for the corresponding conjugate acids and bases. Acid Conjugate Base Conjugate Acid HCIO HS PH. нсо, 3. Name the seven strong acids
What is the pH of a 0.0327 M aqueous solution of benzoic acid? Ka (C6H5COOH) = 6.5x10-5
What is the pH of a 0.0717 M aqueous solution of benzoic acid? Ka (C6H5COOH) = 6.5x10-5
Calculate the pH at the equivalence point in titrating 0.047 M solutions of each of the following with 0.055 M NaOH. (a) nitric acid (HNO3) pH = (b) acetic acid (HC2H3O2), Ka = 1.8e-05 pH = (c) benzoic acid (HC7H5O2), Ka = 6.3e-05 pH = Calculate the pH at the equivalence point in titrating 0.047 M solutions of each of the following with 0.055 M NaOH. (a) nitric acid (HNO3) pH = (b) acetic acid (HC2H302), Ka = 1.84-05...
A. Calculate the pH of a 0.0001 M HNO3 solution B. Calculate the pH of 0.08 M Sr(OH)2 solution C. Calculate the pH of a 0.02 M hydrazoic acid solution (HN3 ----> (H+) + (N3-)), pKa = 4.72 D. Aluminum carbonate (AI2(CO3)3) reacts with phosphoric acid(H3PO4) to produce aluminum phosphate (AIPO4), carbon dioxide, and water 1. Write a balanced equation for the reaction 2. Calculate the mass of phosphoric acid (g) required to react with 100 g of an aluminum...
Calculate the pH at the equivalence point in titrating 0.047 M solutions of each of the following with 0.055 M NaOH. (a) nitric acid (HNO3) pH = (b) acetic acid (HC2H3O2), Ka = 1.8e-05 pH = (c) benzoic acid (HC7H5O2), Ka = 6.3e-05 pH = Calculate the pH at the equivalence point in titrating 0.047 M solutions of each of the following with 0.055 M NaOH (a) nitric acid (HNO3) pH= (b) аcetic acid (HC2H302), ка = 1.8e-05 pH =...
Part Calculate the pH of a solution prepared by mixing 15.0 mL of 0.10 M NaOH and 30.0 mL of 0.10 M benzoic acid solution. (Benzoic acid is monoprotic; its dissociation constant is 6.5x10.) IVO AQ R O a ? Submit Request Answer
calculate the pH of the solution at the equivalence point when 25.0 mL of .10 M benzoic acid is titrated with 0.10 M potassium hydroxide. The Ka for benzoic acid is 6.3 x 10^-5