1) no reaction takes place between MgCl2 and SrCl2 . because both are chlorides
2) complete equation : (NH4)2SO4 + MgCl2 --------------------> MgSO4 + 2NH4Cl
net ionic equation :
2NH4+(aq) + SO42-(aq) + Mg2+(aq)+2Cl-(aq)---------> Mg2+(aq) + SO42-(aq) + 2NH4+(aq) + 2Cl-(aq)
no precipitate is formed in the reaction .because all are soluble compounds
The net ionic reaction of MgCl2 + SrCl2 can be determined by examining the ions present and identifying the spectator ions that do not participate in the reaction.
The balanced molecular equation for the reaction is:
MgCl2(aq) + SrCl2(aq) -> MgCl2(aq) + SrCl2(aq)
In this case, both Mg2+ and Cl- ions are common to both sides of the equation and do not participate in the reaction. They are called spectator ions. The net ionic equation is obtained by removing the spectator ions from the equation:
Net ionic equation: No reaction occurs.
Therefore, the net ionic reaction of MgCl2 + SrCl2 is no reaction.
Now let's consider the reaction between (NH4)2SO4 and MgCl2.
The balanced molecular equation for this reaction is:
(NH4)2SO4(aq) + MgCl2(aq) -> 2NH4Cl(aq) + MgSO4(aq)
To obtain the net ionic equation, we need to identify the ions that are present in the solution and participate in the reaction.
The dissociation of (NH4)2SO4 and MgCl2 in water yields the following ions:
(NH4)2SO4: 2NH4+ and SO4^2- MgCl2: Mg^2+ and 2Cl-
Based on the balanced equation, the net ionic equation can be written as:
2NH4+ + Mg^2+ + 2Cl- + SO4^2- -> 2NH4+ + 2Cl- + MgSO4(aq)
Simplifying this equation gives us the net ionic equation:
Mg^2+ + SO4^2- -> MgSO4(aq)
Therefore, the net ionic equation for the reaction between (NH4)2SO4 and MgCl2 is Mg^2+ + SO4^2- -> MgSO4(aq).
what is the net ionic reaction of MgCl2 + SrCl2 & what is the net ionic...
Na2SO4+(NH4)2CO3=Na2CO3+(NH4)2SO4 Balanced equation: Ionic equation: Net ionic equation:
For H2SO4(aq) + 2NH4OH(aq) --> (NH4)2SO4(aq)+2H2O what is the: Total Ionic equation: Specator Ions: Net Ionic equation:
write the ionic, net and molecular equation for KOH + MgCl2 write the ionic, net and molecular equation for Na2SO4 + CuCl2
A 20.0 mL of 0.100 M AgNO3 is titrated with 0.0500 M MgCl2. Write net ionic equation. What is the volume of MgCl2 to complete the reaction?
Determine the net ionic equation for the reaction that occurs between the two solutions given. (NH4)3PO4(aq) + MgCl2(aq) →? 0.66 points Reactants Products eBook Go Hint Print References 6 NH4+(aq) NH4Cl(s) 2 PO43(aq) 6 Cl(aq) Mg3(PO4)2(3) (NH4)3Cl(aq) (NH4)3(aq) Mg-(aq) 3 Mg2+(aq) PO43-(aq) CH(aq) MgPO4(s) Reset
Write Balanced Ionic Equations and Balanced Net Ionic Equations for the following combinations (including states ex.(s) or (aq)): BaCl2 and AgNO3, KBr and AgNO3, K2CrO4 and AgNO3, NaOH and AgNO3, Na2CO3 and BaCl2, (NH4)2SO4 and BaCl2, Pb(NO3)2 and Na2CO3, Zn(NO3)2 and Na2CO3, FeCl3 and Na2CO3, Cu(NO3)2 and Na2CO3, K2CrO4 and Pb(NO3)2, NaOH and Pb(NO3)2, NaOH and FeCl3, NaCH3COO and FeCl3, MgCl2 and NaOH, Cu(NO3)2 and NaOH.
d. CH 206 to (complete combustion) e. C6H12O6 to — (incomplete combustion) Net Ionic equations can be written for double displacement and single displacement reactions. All elements, precipitates, liquids, and lons not appearing on both sides of the equation are shown in a net ionic equation. 14. Write net ionic equations for the following unbalanced equations. a. Na3PO4 (aq) + SrCl2 (aq) → Sr3(PO4)2 (s) + NaCl (aq) b. Bi(NO3)2 (aq) + Na, SO4(aq) → Bi2(SO4)3 (s) + NaNO, (aq)...
Write the complete ionic equation and the net ionic equation for each of the reactions: Co(NO3)2(aq) + K2CO3(aq) --> CoCO3(s) + 2KNO3(aq) AgNO3(aq) + CsI(aq) ---> AgI(s) + CsNO3(aq) KHCO3(aq) + KOH(aq) --> K2CO3(aq) + H2O(l) H2SO4(aq) + 2NH3(aq) --> (NH4)2SO4(aq) 3Mg(s) + 2FeCl3(aq) --> 3MgCl2(aq) + 2Fe(s)
Show a net ionic equation for each proton transfer reaction: NH4+ + OH-
Write the net ionic equation for this precipitation reaction. Include physical states. (NH4)2CO3(aq)+Ca(ClO4)2(aq)⟶CaCO3(s)+2NH4ClO4(aq) net ionic equation: