11. EGTA is a "chelator" that binds to and sequesters Ca2+ (that is, it prevents Ca2+...
11. EGTA is a "chelator" that binds to and sequesters Ca2+ (that is, it prevents Ca2+ from binding to anything else). EGTA is hydrophilic and cannot cross the plasma membrane. You obtain a brain slice, invoke a presynaptic neuron with a stimulating electrode, and measure postsynaptic EPSPs with a recording electrode. What would happen if you measured EPSPs if you treated your brain slice with EGTA?
(A) EGTA should have no effect, because EPSPs are a postsynaptic event.
(B) EGTA will block EPSPs, because vesicle release depends on Ca2+ influx in the presynaptic neuron.
(C) EGTA will block EPSPs, because depolarization of the postsynaptic membrane is caused by Ca2+ influx through neurotransmitter-gated Ca2+ channels.
(D) EGTA should have no effect, because Ca2+ is irrelevant to synaptic transmission.
(E) None of the above.
Homework Answers
EGTA should have no effect
This is because it is a slow chelator of Calcium ions
Add Answer to:
11. EGTA is a "chelator" that binds to and sequesters
Ca2+ (that is, it prevents Ca2+...
Complete each sentence to assess your knowledge of neurotransmitter storage and release at a typical neuronal...
Complete each sentence to assess your knowledge of
neurotransmitter storage and release at a typical neuronal
synapse.
Thank you!!!
Complete each sentence to assess your knowledge of neurotransmitter storage and release at a typical neuronal synapse, SNARE As action potentials propagate along a myelinated fiber, they jump from one node of Ranvier to the next and for this reason such propagation is called reuptake presynaptic Eventually, the action potential reaches the terminal of the neuron postsynaptic Depolarization in the terminat...
in no less than 3-5 full ser and falling) of a neuron Include the charges of...
in no less than 3-5 full ser and falling) of a neuron Include the charges of the area inside and outside the membrane how the tec desbe the action potential Clhoth rsinag sodium and potassium ion channels contribue action to the charges 15 pts moves downthe tporting event to describe how the action 16. Describe how the signal saltatory conductioins s ranmitted down the length of an axon through signal is transmitted down the length of an axon through tra...
KEY TERMS March the numbered form with the definition that is it be definition the responding...
KEY TERMS March the numbered form with the definition that is it be definition the responding sumber in front of the appropriate 40. excitatory postsynaptic potential 21. resting potential 22 on leakage channels 23. equilibrium potential -24 graded potential 25. gated ion channels 26. depolarization 27. hyperpolarization Sensory neurons 2. central nervous system 3. motor neurons 4. intercurons 5. peripheral nervous system 6. somatic motor neurons *7. autonomic motor neurons 8. sympathetic 9. parasympathetic 10. cell body all dendrites 12....
Are biogenic amine neurotransmitters such as dopamine considered to be proteins? No, it simply means that...
Are biogenic amine neurotransmitters such as dopamine considered to be proteins? No, it simply means that dopamine has at least one amine functional group in its molecular structure. No, dopamine cannot be a protein since proteins do not exhibit neurotransmitter activity. Yes, dopamine is a protein because of its expression of a nitrogen-containing amine group. Yes, amines are naturally occurring organic compounds composed of amino acids. Prozac belongs to a class of drugs known as selective serotonin reuptake inhibitors (SSRIs),...
Efer Figure2 to answer questions 18-21: 8. produce the myelin sheaths of neurons in the central F...
efer Figure2 to answer questions 18-21: 8. produce the myelin sheaths of neurons in the central Figure 2 nervous system. 19 form the Blood Brain Barrier 20._ are responsible for neurotransmitter release. 21 have ligand gated ion channels that are activated by neurotransmitters 22. Functionally, which cellular location is the neuron's "decision- making site" as to whether or not an action potential will be initiated? A axonal membrane B. axon hillock C. dendritic membrane D. presynaptic membrane 23. Calcium and...
Please fill in the blank. When an action potential moves to a nerve cell’s terminals, ------...
Please fill in the blank. When an action potential moves to a nerve cell’s terminals, ------ ions enter from the extracellular environment through gated channels to promote vesicle movement. ------ are chemicals responsible for the movement of a single across a synapse between two adjacent nerve cells. Regarding heterotrimeric G protein, the ------- subunit binds to and stimulates adenylyl cyclase (AC). In heterotrimeric G proteins, the ------- and ------- subunits(s) stimulate phospholipase C. The a-subunit of a heterotrimeric G protein...
1. The following statement is similar to those you might see on exams. Write a paragraph...
1. The following statement is similar to those you might see on exams. Write a paragraph of 3-5 sentences describing 1) whether the statement is correct or incorrect and 2) the reasoning for your answer. Your answer should demonstrate your understanding of the physiological concepts underlying the statement and be written professionally. At a chemical synapse, the release of neurotransmitter occurs in response to a graded depolarization of the synaptic terminal. 2. Write a paragraph of 3-5 sentences answering the...
The Brain on Mind Altering Drugs Psychoactive drugs alter brain function by acting at synapses in the brain, where they may mimic, enhance, or block the effects of natural signaling molecules (neurotr...
The Brain on Mind Altering Drugs Psychoactive drugs alter brain function by acting at synapses in the brain, where they may mimic, enhance, or block the effects of natural signaling molecules (neurotransmitters). The neurotransmitter dopamine plays a particularly important role in creating the dependency aspect of both drug and behavioral addictions. Natural behaviors which enhance survival and/or reproduction, such as eating or engaging in sex, result in a surge of dopamine. Normally, this response helps individuals learn to repeat beneficial...
Answer Thi Q. thank You The Nervous System edit) 1. The junction between one neuron and the next, or between a neuron and an effector is called: A) A synapse 8) A dendrite C) A neuotransmiter D )...
Answer Thi Q. thank You
The Nervous System edit) 1. The junction between one neuron and the next, or between a neuron and an effector is called: A) A synapse 8) A dendrite C) A neuotransmiter D ) A ventricle E) None of the above 2. A fast excitatory synapses follows this order A) (1) neurotransmiter released (2) diftused across the synaptic cleft to a receptor protein (3) binding of the transmitter opens pores in the ion channels and positive...
for each, what is the right answer? B) iris 19. The Nernst Equation predicts that the...
for each, what is the right answer?
B) iris 19. The Nernst Equation predicts that the equilibrium potential for an ion is proportional to where "in" means "inside the cell" and "out" means "outside the cell" (pick the answer that most closely matches the Nemst equation). A) log ([ion in x [ionout) B) bg ([on]out [onlin) C) log (ionin) D) bg (ion)in Vlog ([ion)out) E) log (ion)in) x log (ionout) 20. The eustachian tube connects the and the A) middle...
Complete each sentence to assess your knowledge of
neurotransmitter storage and release at a typical neuronal
synapse.
Thank you!!!
Complete each sentence to assess your knowledge of neurotransmitter storage and release at a typical neuronal synapse, SNARE As action potentials propagate along a myelinated fiber, they jump from one node of Ranvier to the next and for this reason such propagation is called reuptake presynaptic Eventually, the action potential reaches the terminal of the neuron postsynaptic Depolarization in the terminat...
in no less than 3-5 full ser and falling) of a neuron Include the charges of the area inside and outside the membrane how the tec desbe the action potential Clhoth rsinag sodium and potassium ion channels contribue action to the charges 15 pts moves downthe tporting event to describe how the action 16. Describe how the signal saltatory conductioins s ranmitted down the length of an axon through signal is transmitted down the length of an axon through tra...
KEY TERMS March the numbered form with the definition that is it be definition the responding sumber in front of the appropriate 40. excitatory postsynaptic potential 21. resting potential 22 on leakage channels 23. equilibrium potential -24 graded potential 25. gated ion channels 26. depolarization 27. hyperpolarization Sensory neurons 2. central nervous system 3. motor neurons 4. intercurons 5. peripheral nervous system 6. somatic motor neurons *7. autonomic motor neurons 8. sympathetic 9. parasympathetic 10. cell body all dendrites 12....
Are biogenic amine neurotransmitters such as dopamine considered to be proteins? No, it simply means that dopamine has at least one amine functional group in its molecular structure. No, dopamine cannot be a protein since proteins do not exhibit neurotransmitter activity. Yes, dopamine is a protein because of its expression of a nitrogen-containing amine group. Yes, amines are naturally occurring organic compounds composed of amino acids. Prozac belongs to a class of drugs known as selective serotonin reuptake inhibitors (SSRIs),...
efer Figure2 to answer questions 18-21: 8. produce the myelin sheaths of neurons in the central Figure 2 nervous system. 19 form the Blood Brain Barrier 20._ are responsible for neurotransmitter release. 21 have ligand gated ion channels that are activated by neurotransmitters 22. Functionally, which cellular location is the neuron's "decision- making site" as to whether or not an action potential will be initiated? A axonal membrane B. axon hillock C. dendritic membrane D. presynaptic membrane 23. Calcium and...
Answer Thi Q. thank You
The Nervous System edit) 1. The junction between one neuron and the next, or between a neuron and an effector is called: A) A synapse 8) A dendrite C) A neuotransmiter D ) A ventricle E) None of the above 2. A fast excitatory synapses follows this order A) (1) neurotransmiter released (2) diftused across the synaptic cleft to a receptor protein (3) binding of the transmitter opens pores in the ion channels and positive...
for each, what is the right answer?
B) iris 19. The Nernst Equation predicts that the equilibrium potential for an ion is proportional to where "in" means "inside the cell" and "out" means "outside the cell" (pick the answer that most closely matches the Nemst equation). A) log ([ion in x [ionout) B) bg ([on]out [onlin) C) log (ionin) D) bg (ion)in Vlog ([ion)out) E) log (ion)in) x log (ionout) 20. The eustachian tube connects the and the A) middle...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 38 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 2 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 4 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 6 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 6 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago