Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Question

Question

Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as transaminases. How many ATPs would be generated from the complete oxidation of aspartate? (Ignore the energy involve in nitrogen oxidation).

science biology

Add a comment Improve this question Transcribed image text

Answer 1

Answer #1

Answer

Aspartate can be converted to oxaloacetate and the reaction is catalysed by the enzyme commonly called transaminase

Oxaloacetate is then converted to phospho-enolpyruvate in the presence of enzyme phospho-enolpyruvate carboxykinase which utilise one molecule of GTP and release one molecule of GDP and carbon dioxide

Phospho-enolpyruvate is then converted to pyruvate which undergoes citric acid cycle or tricarboxylic acid cycle for complete oxidation and the reaction is catalysed by pyruvate kinase in the presence of magnesium, potassium and generate one molecule of ATP

In citric acid cycle

3 NADH2 gives 9 ATP

1 FADH2 gives 2 ATP

1 ATP (via direct GTP)

1 ATP from glycolysis

Total 13 ATP molecule are formed in complete oxidation of aspartate

However 1 ATP molecule is utilise in conversion of oxaloacetate to phosphoenolpyruvate in the form of GTP therefore net ATP molecules generated in complete oxidation of aspartate are 12

If you have any doubt regarding this question you can ask me in the comment section thank you

Add a comment

Answer 2

Similar Homework Help Questions

Aspartate can be degragated to NH4, CO2, and H2O to produce ATP energy by its carbons...

Aspartate can be degragated to NH4, CO2, and H2O to produce ATP energy by its carbons entering the TCA cycle. How many molecules of ATP can be generated from each molecule of this amino acid? using NADH=2.5 ATPS and FADH2=1.5 ATPs
3. "Enzymes affect reaction rates, not equilibria." This is a fundamental concept of enzyme action. Explain, in your...

3. "Enzymes affect reaction rates, not equilibria." This is a fundamental concept of enzyme action. Explain, in your own words, why enzymes cannot alter the equilibrium of a reaction. Then explain how enzymes can actually speed up a reaction. 4. How is the activation energy AG different from the biochemical standard free energy change AG"? 5. Explain why AG's p can be different from AG p.s. Describe the implication of this difference in terms of the direction of the reaction...
Threonine is converted to succinyl CoA through a process that produces 1 molecule of ammonia and...

Threonine is converted to succinyl CoA through a process that produces 1 molecule of ammonia and 1 NADH while requiring 1 ATP. Consider that the resulting succinyl CoA can use a portion of the citric acid cycle to be converted to oxaloacetate. 1. (2 points) How many molecules of threonine would be required to produce one molecule of glucose? 2. (6 points) What is the net consumption or production of NADH, FADH2, and ATP for the synthesis of one molecule...

Iron can serve as a................. to enzymes involved in numerous oxidation reduction reactions that commonly occur...

Iron can serve as a................. to enzymes involved in numerous oxidation reduction reactions that commonly occur in all cells of the body. a.substrate b.cofactor c.catalyst d.analog In iron deficiency anemia, a lighter skinned individual can develop a distinct pale appearance called ............ , which is a result of lack of iron in the red bloods cells. a.anemia b.microcytic c.apathy d.pallor In order to best absorb iron from plant sources, also known as ............ iron, a person must also consume enough...
What is the critical difference between passive and active transport? A. passive requires energy but active...

What is the critical difference between passive and active transport? A. passive requires energy but active does not B. passive requires no energy, but active does C. passive and active each require energy, but passive requires less What is an enzyme? A. a protein that facilitates a reaction B. a protein that supplies water for hydrolysis reactions C. a protein that absorbs water during dehydration reactions The First Law of Thermodynamics states: A. energy can be changed from one form...
Part A - Overview of enzyme structure and enzymatic reactions Enzymes are large globular proteins. Much...

Part A - Overview of enzyme structure and enzymatic reactions Enzymes are large globular proteins. Much of their three dimensional shape is the result of interactions between the R (variable) groups of their amino acids. The active site is the portion of the enzyme that will interact with the substrate the molecule that the enzyme acts upon. The nature and arrangement of amino acids in the active site make each enzyme specific to a substrate and to the reaction it...

1)Which statement about enzymes is TRUE? a)Enzymes are the reactants in a chemical reaction b)Enzymes catalyze...

1)Which statement about enzymes is TRUE? a)Enzymes are the reactants in a chemical reaction b)Enzymes catalyze specific reactions c)Enzymes' functions require inhibitors d)Enzymes are the products in a chemical reaction 2)Active transport ________. a)is a type of facilitated diffusion b)moves solutes with their concentration gradient c)can involve the transport of ions d)does not use ATP as an energy source 3)What is the chromosome composition of a normal human female? a)44 autosomes, 1 X chromosome, and 1 Y chromosome b)46 autosomes,...
Short answer questions, answer on blank paper. These questions cannot be answered without work, you must...

Short answer questions, answer on blank paper. These questions cannot be answered without work, you must show all work for full credit. 1. (8 points) Given the following metabolic pathway of aspartate to pyruvate, all of which occurs in the cytosol thus requiring transport of electrons into the mitochondria, calculate the number of ATP that can produced from the complete cxcidation of aspartate in the muscle aspartate oxaloacetate m NAD NADH NADH NAD alate Pyruvate NAD NADH 2. (7 points)...
Iron can be removed from water by oxidation. The following oxidants are commonly used for iron...

Iron can be removed from water by oxidation. The following oxidants are commonly used for iron removal. a. Please calculate: for each mg of Fe removed, what is the mass of oxidant needs? b. And what is the mass of sludge generated for each mg of Fe removed? C. If sludge disposal is a concern, which oxidant would you choose? d. If chemical consumption needs to be minimized, which oxidant would you choose? Oxidant Oxygen Chlorine Chlorine dioxide Potassium permanganate...

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such...

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+⟶CH3CH2CH2CO2CH2CH3(l)+H2O(l) Part A Given 7.75 g of butanoic acid and excess ethanol, how many grams of ethyl butyrate...

Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Homework Answers

Add Answer to:
Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Post as a guest

Earn Coins

Aspartate can be degragated to NH4, CO2, and H2O to produce ATP energy by its carbons...

3. "Enzymes affect reaction rates, not equilibria." This is a fundamental concept of enzyme action. Explain, in your...

Threonine is converted to succinyl CoA through a process that produces 1 molecule of ammonia and...

Iron can serve as a................. to enzymes involved in numerous oxidation reduction reactions that commonly occur...

What is the critical difference between passive and active transport? A. passive requires energy but active...

Part A - Overview of enzyme structure and enzymatic reactions Enzymes are large globular proteins. Much...

1)Which statement about enzymes is TRUE? a)Enzymes are the reactants in a chemical reaction b)Enzymes catalyze...

Short answer questions, answer on blank paper. These questions cannot be answered without work, you must...

Iron can be removed from water by oxidation. The following oxidants are commonly used for iron...

Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such...

Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Homework Answers

Add Answer to: Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...

Post as a guest

Earn Coins

Add Answer to:
Aspartate can be converted to oxaloacetate in a reaction catalyzed by enzymes commonly referred to as...