What are the differences between an antibiotic, a semisynthetic, and a synthetic as types of antimicrobials?
What are the differences between an antibiotic, a semisynthetic, and a synthetic as types of antimicrobials?
Homework Answers
The differences between an antibiotic, a semisynthetic and a synthetic as types of antimicrobials are as follows:
An antibiotic is defined as the chemical or physical agent which is produced naturally or artificially and is capable of killing or inhibiting the growth of microorganisms. (such as bacteria or fungus)
A semisynthetic is defined as the antibiotic which occurs naturally and its structure is altered in the lab.
A synthetic is defined as the antibiotic which is completely synthesized in the lab.
Add Answer to:
What are the differences between an antibiotic, a semisynthetic,
and a synthetic as types of antimicrobials?
What is the difference between a natural drug, a semisynthetic drug, and a synthetic drug?
What is the difference between a natural drug, a semisynthetic drug, and a synthetic drug? Match the words in the left column to the appropriate blanks in the sentences on the right.
What are the differences between value types and reference types in C#? support your answer with...
What are the differences between value types and reference types in C#? support your answer with examples.
What are the three different types of organizational purchases? Describe the differences between these types in...
What are the three different types of organizational purchases? Describe the differences between these types in terms of complexity, time frame, number of suppliers, and applications Show your analysis in a table. Discuss the different organizational purchase types as they relate to a business (not a consumer) purchasing a business product or service. Be specific.
What are the two types of user-defined functions? Discuss two differences between the two types of...
What are the two types of user-defined functions? Discuss two differences between the two types of user defined functions Describe two benefits of using a user defined functions in a program.program.
What are the main differences between qualitative and quantitative studies? What are the three types of...
What are the main differences between qualitative and quantitative studies? What are the three types of pre-experimental studies? What is the most significant threat to this type of experimentation?
a) What are the main differences between Finance and Accounts? b) Describe the 3 types of...
a) What are the main differences between Finance and Accounts? b) Describe the 3 types of Accounting with special emphasis on the roles performed in each.
Generalized and specialized transduction both involve bacteriophages. What are the differences between these two types of...
Generalized and specialized transduction both involve bacteriophages. What are the differences between these two types of transduction?
Why are there different types of skeletal muscle phenotypes, and what are the functional/physiological differences between...
Why are there different types of skeletal muscle phenotypes, and what are the functional/physiological differences between them?
1. Identify and describe three different types of hospital ownership? 2. What are the differences between...
1. Identify and describe three different types of hospital ownership? 2. What are the differences between inpatient and outpatient services? (2 points)
1. What differences can you observe between the normal and diseased blood types? 2. When observing...
1. What differences can you observe between the normal and diseased blood types? 2. When observing a blood smear, how can you differentiate between neutrophils and monocytes?
Most questions answered within 3 hours.
-
How would you train your employees to avoid risks of using
mobile devices?
asked 3 minutes ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 1 hour ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 2 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 6 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 6 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 6 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 6 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago