Approximately 3.9 x 106 kg of water falls 65 m over a waterfall each second. (a)...
Approximately 3.9 x 106 kg of water falls 65 m over a waterfall each second. (a) What is the decrease in the gravitational potential energy of the water-Earth system each second? (b) If all this energy could be converted to electrical energy (it cannot be), at what rate would electrical energy be supplied? (The mass of 1 m3 of water is 1000 kg.) (c) If the electrical energy were sold at 3.1 cent/kW·h, what would be the yearly income in dollars?
Homework Answers
hope this helps.
Please comment for any doubt or further clarification.
Please rate positively..
Add Answer to:
Approximately 3.9 x 106 kg of water falls 65 m over a waterfall
each second. (a)...
Approximately 1.0 x 106 kg of water falls 45 m over a waterfall each second. (a) What is the decrease in the gravitation...
Approximately 1.0 x 106 kg of water falls 45 m over a waterfall each second. (a) What is the decrease in the gravitational potential energy of the water-Earth system each second? (b) If all this energy could be converted to electrical energy (it cannot be), at what rate would electrical energy be supplied? (The mass of 1 m3 of water is 1000 kg.) (c) If the electrical energy were sold at 3.3 cent/kW·h, what would be the yearly income in...
Approximately 2.1 x 105 kg of water falls 14 m over a waterfall each second. (a)...
Approximately 2.1 x 105 kg of water falls 14 m over a waterfall each second. (a) What is the decrease in the gravitational potential energy of the water-Earth system each second? (b) If all this energy could be converted to electrical energy (it cannot be), at what rate would electrical energy be supplied? (The mass of 1 m3 of water is 1000 kg.) (c) If the electrical energy were sold at 1.7 cent/kW·h, what would be the yearly income in...
A hydroelectric generator converts kinetic energy of water into electrical energy. Each second 2915 m3 of...
A hydroelectric generator converts kinetic energy of water into electrical energy. Each second 2915 m3 of water passes over a waterfall 300 m high and the generator is only 84% efficient: (The mass of 1 m3 of water is 1000 kg.) a) What is the total energy available? b) What is the power generated? W
Water flows over Victoria Falls, which is 128 m high, at an average rate of 1.39...
Water flows over Victoria Falls, which is 128 m high, at an average rate of 1.39 × 106 kg/s. The acceleration of gravity is 9.81 m/s 2 . If half the potential energy of this water were converted into electric energy, how much power would be produced by these falls? Answer in units of MW.
A dam collects water at a height of 300m. The water can be let down through a pipe. As it falls t...
A dam collects water at a height of 300m. The water can be let down through a pipe. As it falls to the ground it loses potential energy but it gains kinetic energy. 100 tonnes (note 1 tonne 1000 kg) of water are let out from the dam and reach the ground, 300m below; all the gained kinetic energy is then harnessed by a perfectly efficient turbine and converted into energy to power houses in the valley. The Bureau of...
25. In a hydroelectric dam, water falls 25 m and then spins a turbine to generate...
25. In a hydroelectric dam, water falls 25 m and then spins a turbine to generate electricity. a) What is U, of 1.0 kg of water? b) Suppose the dam is 80% efficient at converting the water's potential energy to electrical energy. How many kilograms of water must pass through the turbines each second to generate 50 MW of electricity? This is a typical value for a small hydroelectric dam.
A 0.375 kg stone is held 1.42 m above the top edge of a water well...
A 0.375 kg stone is held 1.42 m above the top edge of a water well and then dropped into it. The well has a depth of 4.78 m. Take y = 0 at the top edge of the well. a) What is the gravitational potential energy of the stone-Earth system before the stone is released? b) What is the gravitational potential energy of the stone-Earth system when the stone reaches the bottom of the well. c) What is the...
9) An insulated container contains V liters of hot water at temperature T. If M kg...
9) An insulated container contains V liters of hot water at temperature T. If M kg of ice at 0 °C is added to the water, what is the temperature of the system when it reaches equilibrium? Reminder, for water: 1L = 1 kg Cwater = 4190 Cice = 2100 ROK Lboll = 2.26 x 106 steam kg = 2000 .,Lmelt = 3.33 x 105 kg kg kg 10) In an engine, after the fuel is ignited, there is a...
A. 2 pts. Consider a small hydroelectric power station that generates 1000 kW of electrical power....
A. 2 pts. Consider a small hydroelectric power station that generates 1000 kW of electrical power. Water passes through the turbine as it falls from the reservoir level down a vertical drop of 25.0 m to the river below the dam. Assuming 80.0% conversion efficiency, what volume of water must pass through the turbine each second? (give answer in m') p= density of water 1000 kg/m3 g=9.81 ms-2 B. 2 pts. Determine the total energy content of all the natural...
1. Which of the following is not considered a nutrient a Vitamin B. Water c.Carbohydrate (d)...
1. Which of the following is not considered a nutrient a Vitamin B. Water c.Carbohydrate (d) Alcohol e Mineral 2. For which of the following causes of death does a person's diet play a part? a. Lung disease (6) Cancer Chronic lower respiratory diseases d. Infections of the blood e AIDS 3. Researchers repeatedly report that people who consume a variety of foods such as fruits, vegetables, legumes, nuts, and whole grains have reduced risks of which of the following...
A hydroelectric generator converts kinetic energy of water into electrical energy. Each second 2915 m3 of water passes over a waterfall 300 m high and the generator is only 84% efficient: (The mass of 1 m3 of water is 1000 kg.) a) What is the total energy available? b) What is the power generated? W
A dam collects water at a height of 300m. The water can be let down through a pipe. As it falls to the ground it loses potential energy but it gains kinetic energy. 100 tonnes (note 1 tonne 1000 kg) of water are let out from the dam and reach the ground, 300m below; all the gained kinetic energy is then harnessed by a perfectly efficient turbine and converted into energy to power houses in the valley. The Bureau of...
25. In a hydroelectric dam, water falls 25 m and then spins a turbine to generate electricity. a) What is U, of 1.0 kg of water? b) Suppose the dam is 80% efficient at converting the water's potential energy to electrical energy. How many kilograms of water must pass through the turbines each second to generate 50 MW of electricity? This is a typical value for a small hydroelectric dam.
9) An insulated container contains V liters of hot water at temperature T. If M kg of ice at 0 °C is added to the water, what is the temperature of the system when it reaches equilibrium? Reminder, for water: 1L = 1 kg Cwater = 4190 Cice = 2100 ROK Lboll = 2.26 x 106 steam kg = 2000 .,Lmelt = 3.33 x 105 kg kg kg 10) In an engine, after the fuel is ignited, there is a...
A. 2 pts. Consider a small hydroelectric power station that generates 1000 kW of electrical power. Water passes through the turbine as it falls from the reservoir level down a vertical drop of 25.0 m to the river below the dam. Assuming 80.0% conversion efficiency, what volume of water must pass through the turbine each second? (give answer in m') p= density of water 1000 kg/m3 g=9.81 ms-2 B. 2 pts. Determine the total energy content of all the natural...
1. Which of the following is not considered a nutrient a Vitamin B. Water c.Carbohydrate (d) Alcohol e Mineral 2. For which of the following causes of death does a person's diet play a part? a. Lung disease (6) Cancer Chronic lower respiratory diseases d. Infections of the blood e AIDS 3. Researchers repeatedly report that people who consume a variety of foods such as fruits, vegetables, legumes, nuts, and whole grains have reduced risks of which of the following...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 34 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago