Calculate the lattice energy of CaBr2
The standard heat of formation of
The first ionization energy of
The heat of sublimation of
The bond energy of
the heat of vaporization of
and the electron affinity of
Thank you!
Homework Answers
Request Answer!
We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Question 10 1 pts Given the following thermodynamic data, calculate the lattice energy of CaBrz(s). Term...
Question 10 1 pts Given the following thermodynamic data, calculate the lattice energy of CaBrz(s). Term Value (kJ/mol) AH°formation[CaBr2(s)] -675 AH sublimation Ca(g)] 178 AH Sublimation[Brz(s)] 31 AH°bond energy[Br2(g)] 194 IE(Ca) IE2(Ca) Ea(Br) 590. 1145 -325 Enter your answer in units of kJ.
Given the following thermodynamic data, calculate the lattice energy of CaBr2(s). Term Value (kJ/...
Given the following thermodynamic data, calculate the lattice energy of CaBr2(s).Term Value (kJ/mol)ΔH∘f[CaBr2(s)] -675ΔH∘f[Ca(g)] 178ΔH∘f[Br(g)] 112I1(Ca) 590.I2(Ca) 1145EA(Br) -325Express your answer to four significant figures, and include the appropriate units.
Given the following information, calculate the lattice energy of CaF2 The enthalpy of formation of CaF2...
Given the following information, calculate the lattice energy of CaF2 The enthalpy of formation of CaF2 -1228 kJ/mol Heat of sublimation of Ca 177.8 kJ/mol Bond dissociation energy of F2 159 kJ/mol First ionization energy of Ca 589.8 kJ/mol Second ionization energy of Ca 1145.4 kJ/mol . Electron affinity of F -328 kJ/mot [ Answer : -2644 KJİ I
Consider the following information.
Consider the following information. The enthalpy of formation of CaO is ΔHf°=-634.9 kJ/mol. The enthalpy of sublimation of Ca is ΔHsab = 177.8 kJ/mol. The first and second ionization energies of Ca are IE1 = 590 kJ/mol and IE2 = 1145 kJ/mol. The first electron affinity of O is ΔHAI=-142 kJ/mol. The bond energy of O2 is BE = 498 kJ/mol. The lattice energy of CaO is ΔHatice = -3414 kJ/mol. Determine the second electron affinity of O.
Consider the following information. The lattice energy of LiCl is ΔH lattice = −834 kJ/mol. The...
Consider the following information. The lattice energy of LiCl is ΔH lattice = −834 kJ/mol. The enthalpy of sublimation of Li is ΔH sub = 159.3 kJ/mol. The first ionization energy of Li is IE 1 = 520 kJ/mol. The electron affinity of Cl is ΔH EA = -349 kJ/mol. The bond energy of Cl2 is BE = 243 kJ/mol. Determine the enthalpy of formation, ΔHf, for LiCl(s).
Consider the following information. The lattice energy of NaCl is ΔH lattice=−788 kJ/mol The enthalpy of...
Consider the following information. The lattice energy of NaCl is ΔH lattice=−788 kJ/mol The enthalpy of sublimation of Na is ΔHsub=107.5 kJ/mol The first ionization energy of Na is IE1=496 kJ/mol. The electron affinity of Cl is ΔHEA=−349 kJ/mol. The bond energy of Cl2 is BE=243 kJ/mol. Determine the enthalpy of formation, ΔHf, for NaCl(s). ΔHf= kJ/mol
2. Use the following data to calculate the lattice energy (U) of NaCl(s) from sodium me...
2. Use the following data to calculate the lattice energy (U) of NaCl(s) from sodium me chlorine: Enthalpy of formation (4H) for NaCl(s) - -411 kJ/mol Enthalpy of sublimation (4Hub) of Na 107.3 kJ/mol The first ionization energy of Na (E,)-495.8 kJ/mol The bond dissociation energy (D) of Clh- 243 kJ/mol The electron affinity of Cl (Eea)- 348.6 kJ/mol.
Calculate the lattice energy for LiF(s) given the following: sublimation energy for Li(s) = +166 KJ/mol...
Calculate the lattice energy for LiF(s) given the following: sublimation energy for Li(s) = +166 KJ/mol delta Hf for F(g) = +77 KJ/mol first ionization energy of Li(g) = +520 KJ/mol electron affinity of F(g) = -328 KJ/mol enthalpy of formation of LiF(s) = -617 KJ/mol
Construct a Born-Haber cycle and calculate the lattice energy of CaC2 (s). Note that this solid...
Construct a Born-Haber cycle and calculate the lattice energy of CaC2 (s). Note that this solid contains the diatomic ion C22–.Useful Information:?H°f (CaC2(s)) ?Hsub (Ca (s)) ?Hsub (C (s)) Bond dissociation energy of C2 (g) = +614 kJ/molFirst ionization energy of Ca (g) = +590 kJ/mol Second ionization energy of Ca (g) = +1143 kJ/mol First electron affinity of C2 (g) = –315 kJ/mol Second electronaffinity of C2 (g) = +410 kJ/mol= –60 kJ/mol = +178 kJ/mol = +717 kJ/mol
5. Calculate the lattice energy for barium bromide given that AH, for this compound is -757.3...
5. Calculate the lattice energy for barium bromide given that AH, for this compound is -757.3 kJ mol, the entropy of sublimation of barium is 180. kJ molt, the electron affinity for bromine is -324.5 kJ mol", the first lonization energy of barium is 502.8 kJ mol", the second lonization energy of barium is 965.2 kJ moll, and the heat of vaporization of bromide is 30.9 kJ mol (6 pts)
Question 10 1 pts Given the following thermodynamic data, calculate the lattice energy of CaBrz(s). Term Value (kJ/mol) AH°formation[CaBr2(s)] -675 AH sublimation Ca(g)] 178 AH Sublimation[Brz(s)] 31 AH°bond energy[Br2(g)] 194 IE(Ca) IE2(Ca) Ea(Br) 590. 1145 -325 Enter your answer in units of kJ.
Given the following information, calculate the lattice energy of CaF2 The enthalpy of formation of CaF2 -1228 kJ/mol Heat of sublimation of Ca 177.8 kJ/mol Bond dissociation energy of F2 159 kJ/mol First ionization energy of Ca 589.8 kJ/mol Second ionization energy of Ca 1145.4 kJ/mol . Electron affinity of F -328 kJ/mot [ Answer : -2644 KJİ I
Consider the following information. The enthalpy of formation of CaO is ΔHf°=-634.9 kJ/mol. The enthalpy of sublimation of Ca is ΔHsab = 177.8 kJ/mol. The first and second ionization energies of Ca are IE1 = 590 kJ/mol and IE2 = 1145 kJ/mol. The first electron affinity of O is ΔHAI=-142 kJ/mol. The bond energy of O2 is BE = 498 kJ/mol. The lattice energy of CaO is ΔHatice = -3414 kJ/mol. Determine the second electron affinity of O.
2. Use the following data to calculate the lattice energy (U) of NaCl(s) from sodium me chlorine: Enthalpy of formation (4H) for NaCl(s) - -411 kJ/mol Enthalpy of sublimation (4Hub) of Na 107.3 kJ/mol The first ionization energy of Na (E,)-495.8 kJ/mol The bond dissociation energy (D) of Clh- 243 kJ/mol The electron affinity of Cl (Eea)- 348.6 kJ/mol.
5. Calculate the lattice energy for barium bromide given that AH, for this compound is -757.3 kJ mol, the entropy of sublimation of barium is 180. kJ molt, the electron affinity for bromine is -324.5 kJ mol", the first lonization energy of barium is 502.8 kJ mol", the second lonization energy of barium is 965.2 kJ moll, and the heat of vaporization of bromide is 30.9 kJ mol (6 pts)
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 54 minutes ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 1 hour ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 5 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 9 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 9 hours ago