Homework Answers
Add Answer to:
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) +...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
6. Consider the following galvanic cell and standard reduction potentials: Ag Pb E° = 0.80 V salt bridge Ag+ (aq) + e →...
6. Consider the following galvanic cell and standard reduction potentials: Ag Pb E° = 0.80 V salt bridge Ag+ (aq) + e → Ag(s) Pb2+(aq) + 2e → Pb(s) E° = -0.13 V 1 M Ag+ 1 M Pb2+ Which one of the following statements is TRUE? a) The cell on the left containing Ag+(aq) is the anode. b) The initial reading on the voltmeter would be 0.67 V. c) Oxidation occurs in the cell on the right containing Pb²+(aq)....
Use the following half-reactions to write 3 spontaneous reactions, calculate E°cell for each reaction, what is...
Use the following half-reactions to write 3 spontaneous
reactions, calculate E°cell for each reaction, what is
the n number (number of electrons transferred).
Au+ (aq) + e− → Au
(s) E° = 1.69
V
N2O (g) + 2H+ (aq) + 2 e− →
N2 (g) + H2O (l) E° =
1.77 V
Cr3+ (aq) + 3 e− → Cr
(s) E° = -0.74 V
Question 7 0.36 pts Use the following half-reactions to write 3 spontaneous reactions, calculate Eºcell for...
Separate galvanic cells are made from the following half-cells: cell 1: H+(aq)/H2(g) and Pb2+(aq)/Pb(s) cell 2:...
Separate galvanic cells are made from the following half-cells: cell 1: H+(aq)/H2(g) and Pb2+(aq)/Pb(s) cell 2: Fe2+(aq)/Fe(s) and Zn2+(aq)/Zn(s) Which of the following is correct for the working cells? Standard reduction potentials, 298 K, Aqueous Solution (pH = 0): Cl2(g) + 2e --> 2C1-(aq); E° = +1.36 V Fe3+(aq) + e --> Fe2+(aq); E° = +0.77 V Cu2+(aq) + 2e --> Cu(s); E° = +0.34 V 2H+(aq) + 2e --> H2(g); E° = 0.00 V Pb2+(aq) + 2e --> Pb(s);...
A galvanic cell based on the following reactions Cu 2+ (aq) + 2e- + Cu(s) E°=0.339...
A galvanic cell based on the following reactions Cu 2+ (aq) + 2e- + Cu(s) E°=0.339 V (AD + 14H(aq) + 6e-4 2Cr 3+(aq) + 7 H2O(1) Eo=1.330 V a) Write the overall cell reaction and determine its voltage. b) If the E value of the galvanic cell is 1.2 le of the galvanic cell is 1.254 V, calculate the pH of the cell when [Cu2+]=0.00010 M, Cr-0,2-1=0.00460 M, Cr3+1=1.0x102 M. The Nerst equation is E=E - (0.0592/n)logQ
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction +...
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction + O2(9)+4 H (aq)+4e' 2H20) = 1.23 V red Ered Fe+. (аq) Fe3(aq)+e = +0.771 V Answer the following questions about thiss cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
help with this one Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V...
help with this one
Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V 2 Hg2+(aq) + 2e - H922+(aq) = 0.92 V 2 Ho2+ The initial concentrations are: [Cr3+] =0.31 M [Hg2+] =2.57 M [Hg22+] =0.49 M (1) What is the potential of this non-standard cell at 298 K? Give your answer to 3 sig. figs. E(V) = Submit Answer Tries 0/2 (ii) How will each of the following changes to...
15. Consider the following reduction / reactions: MnO4 (aq) + 2 H20 (1) + 3 e...
15. Consider the following reduction / reactions: MnO4 (aq) + 2 H20 (1) + 3 e → MnO2 (s) Ni(OH)2 (s) + 2 e- → Ni (s) + 2 OH- (aq) E° = 0.59 V E° = -0.72 V What would be the cell potential given 0.50 mol/L of Mn04 and 0.15 mol/L OH- in the galvanic cell? ( a. 1.26 V b. 1.8 V C. -1.26 V d. 2.64 V. e. -2.64 V
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
6. Consider the following galvanic cell and standard reduction potentials: Ag Pb E° = 0.80 V salt bridge Ag+ (aq) + e → Ag(s) Pb2+(aq) + 2e → Pb(s) E° = -0.13 V 1 M Ag+ 1 M Pb2+ Which one of the following statements is TRUE? a) The cell on the left containing Ag+(aq) is the anode. b) The initial reading on the voltmeter would be 0.67 V. c) Oxidation occurs in the cell on the right containing Pb²+(aq)....
Use the following half-reactions to write 3 spontaneous
reactions, calculate E°cell for each reaction, what is
the n number (number of electrons transferred).
Au+ (aq) + e− → Au
(s) E° = 1.69
V
N2O (g) + 2H+ (aq) + 2 e− →
N2 (g) + H2O (l) E° =
1.77 V
Cr3+ (aq) + 3 e− → Cr
(s) E° = -0.74 V
Question 7 0.36 pts Use the following half-reactions to write 3 spontaneous reactions, calculate Eºcell for...
Separate galvanic cells are made from the following half-cells: cell 1: H+(aq)/H2(g) and Pb2+(aq)/Pb(s) cell 2: Fe2+(aq)/Fe(s) and Zn2+(aq)/Zn(s) Which of the following is correct for the working cells? Standard reduction potentials, 298 K, Aqueous Solution (pH = 0): Cl2(g) + 2e --> 2C1-(aq); E° = +1.36 V Fe3+(aq) + e --> Fe2+(aq); E° = +0.77 V Cu2+(aq) + 2e --> Cu(s); E° = +0.34 V 2H+(aq) + 2e --> H2(g); E° = 0.00 V Pb2+(aq) + 2e --> Pb(s);...
A galvanic cell based on the following reactions Cu 2+ (aq) + 2e- + Cu(s) E°=0.339 V (AD + 14H(aq) + 6e-4 2Cr 3+(aq) + 7 H2O(1) Eo=1.330 V a) Write the overall cell reaction and determine its voltage. b) If the E value of the galvanic cell is 1.2 le of the galvanic cell is 1.254 V, calculate the pH of the cell when [Cu2+]=0.00010 M, Cr-0,2-1=0.00460 M, Cr3+1=1.0x102 M. The Nerst equation is E=E - (0.0592/n)logQ
A chemist designs a galvanic cell that uses these two half-reactions: standard reduction potential half-reaction + O2(9)+4 H (aq)+4e' 2H20) = 1.23 V red Ered Fe+. (аq) Fe3(aq)+e = +0.771 V Answer the following questions about thiss cell Write a balanced equation for the half-reaction that happens at the cathode Write a balanced equation for the half-reaction that happens at the anode Write a balanced equation for the overall reaction that powers the cell. Be sure the reaction is spontaneous...
help with this one
Construct a galvanic cell using the following half-reactions: Cr3+ (aq) + 3e - Cr(s) º = -0.56 V 2 Hg2+(aq) + 2e - H922+(aq) = 0.92 V 2 Ho2+ The initial concentrations are: [Cr3+] =0.31 M [Hg2+] =2.57 M [Hg22+] =0.49 M (1) What is the potential of this non-standard cell at 298 K? Give your answer to 3 sig. figs. E(V) = Submit Answer Tries 0/2 (ii) How will each of the following changes to...
15. Consider the following reduction / reactions: MnO4 (aq) + 2 H20 (1) + 3 e → MnO2 (s) Ni(OH)2 (s) + 2 e- → Ni (s) + 2 OH- (aq) E° = 0.59 V E° = -0.72 V What would be the cell potential given 0.50 mol/L of Mn04 and 0.15 mol/L OH- in the galvanic cell? ( a. 1.26 V b. 1.8 V C. -1.26 V d. 2.64 V. e. -2.64 V
Most questions answered within 3 hours.
-
What are some ways that technology can help companies and leaders
to manage compensation, benefits plans,...
asked 1 minute ago -
A cart loaded with bricks has a total mass of 22.1 kg and is
pulled at...
asked 2 minutes ago -
Twin studies suggest
that if a person has a ______ twin their relative risk of being...
asked 10 minutes ago -
At the end of their final exam, 550 students answered an
additional question in which they...
asked 9 minutes ago -
Consider an argon-ion laser running at 514.5nm with a minimum
beam waist (radius) of wo =...
asked 21 minutes ago -
Discuss in your own words the application of risk management
techniques needed to make a facility...
asked 28 minutes ago -
Culver Co. purchased land as a factory site for $600,000. The
process of tearing down two...
asked 39 minutes ago -
ANSWER THE FOLLOWING AS TRUE OR FALSE
a) _____ there are no saturated fats in...
asked 59 minutes ago -
Peak Petro, LLC is a small,oil-field company. They maintain a
fleet of various trucks to service...
asked 40 minutes ago -
Crazy Cliff’s Car Coral (CCCC) is considering buying a company
van for $50,000. CCCC expects the...
asked 45 minutes ago -
IN C++
Create a student hash table that contains information, studentID
(int), name (string), marks_oop345 (float)....
asked 45 minutes ago -
Provide a general summary of Consumer Electronics Stores
Industry in the US like Radio shack. Why...
asked 48 minutes ago