Homework Answers
Answers:-
5 (a) Reactant = Sodium Acetate + Hydrogen Chloride
Product = Acetic Acid + Sodium Chloride
5 (b) Reactant = Pottasium Adepate + Hydrogen Chloride
Product = Adipic Acid + Pottasium Chloride
6 (a) Reactant = Acetic Acid + Methanol
Product = Methyl Acetate + Water
6 (b) Reactant =Benzoic Acid + iso-propanol
Product = Isopropyl Benzoate + Water
6 (c) Reactant = propanol + 2-methylpropanoic acid
Product = Propyl isobutyrate + Water
7 (a) Reactant = Methyl Acetate + Water
Product = Acetic Acid + Methanol
7 (b) Reactant = Ethyl Benzoate + Water
Product = Benzoic Acid + Ethanol
7 (c) Reactant = isopropyl Acetate + Water
Product = isopropanol + Formic Acid
8 (a) Reactant = Methyl Acetate + Water
Product = Sodium Acetate + Methanol
8 (b) Reactant = Ethyl Benzoate + Water
Product = Sodium Benzoate + Ethanol
8(c) Reactant = isopropyl Acetate + Water
Product = isopropanol + Sodium Formate
Add Answer to:
5. Complete the following reacidification reactions. Name the reactant and the product a) cynamo Na + Het 6) K*0-8...
QUESTIONS 6-109. Predict the product formed in each of the following reactions and give each reactant...
QUESTIONS 6-109. Predict the product formed in each of the following reactions and give each reactant and product a suitable name: (a) CH3CH,MgBr + CH,0 1. ether 2. H 1. ether b) p-CH,CHMgBr CHCHCO 6-110. Using the Grignard reaction, carry out the following transformations. Any necessary organic or inorganic reagents may be used. Name all reactants and products. OH CH,CH,OH (c) CHy 6-112. In the experiment, ligroin may be used as a solvent for the separation of the product from...
1, 2, 3, complete the following reactions by supplying the missing reactant or product indicated by...
1, 2, 3, complete the following reactions by supplying the
missing reactant or product indicated by a question mark. Where
applicable, indicate the formal charges.
(NOTE THE QUESTIONS MARK IN THE QUESTIONS ANT BELOW CAN BE Complete the following reaction by supplying the missing reactant or product indicated by a question mark. Where applicable. indicate the formal charges. Complete the following reaction by supplying the missing reactant or product indicated by a question mark. Where applicable. indicate the formal charges....
Name the type of reaction, reactant (functional group) and product (functional group) of the following: -Acid/base...
Name the type of reaction, reactant (functional group) and product
(functional group) of the following:
-Acid/base
-Addition
-Combustion
-Elimination
-Substitution
material for reactions 1 and 2) H3C— CH reaction 1 Br Br HO CH2=CH2 HC-CH2 HC-CH2 reaction 2 Br reaction 3 CH2 H3C- H2C= CH2 reaction 4 C OH reaction 5 - HC-CH2 H3C— CH Lei reaction 6 HEC OCH HEC OH HUC CNH,
complete the following reactions by providing either the missing reactant, reagent, or product as indicated: (for...
complete the following reactions by providing either the
missing reactant, reagent, or product as indicated:
(for b through e)
d. CH₃ CH₂ CH=CH₂ 1. Hg CoAc)2(ag) 2. NaBity * ET Iy? Eauge, cena 2. H₂00
4. Complete the reactions below by supplying the reactant, reagent or product. (*pts each OH b...
4. Complete the reactions below by supplying the reactant, reagent or product. (*pts each OH b H,0,HCI Heat O it CI d. (excess) 1. LAIH 2. H2O -CHCH PPh; 3 Name: f. 1. CHACHIMBI 2. H,0 1. LAIH 2. HO h. CuLi(CH 3)2 i. 1. LDA (1 equiv) 2. CHỊCH,C 5
B Bopts) GV Complete the following reactions by putting the structure of the missing compound or...
B Bopts) GV Complete the following reactions by putting the structure of the missing compound or reagent in the given box. Show stereochemistry clearly where applicable KMnou (012 rot 1. 2. 번 + H₂O NaBtly 3. chhor 4. @CEC-City CH₂ 5. y o Zn, Acetic acid 6. + Brz Product t BH/THE Intermediate th 7. peroxide ID 8. + Her ho 9. Juller 10. - 0 c(CH3)4, t. Quoh. heat cl 11. NaI Aceton
Complete the following reactions. Provide the missing reactant(s) OR major organic product(s). Show correct regio- and...
Complete the following reactions. Provide the missing reactant(s) OR major organic product(s). Show correct regio- and stereochemistry for products you draw, where applicable Сн,, Zn(Cu) 1. OSONMO, pyridine 2. NaHSO, H,0 H2O* g. V 1. BH-THF 2. 1,0,, NaOH, HO - Y 1. MCPBA 2.4,00 DCM H,802, H2O heat 1., 2. Zn, AcOH
CHE 310 Homework #8 Due WED NOV 6 Name Score: DIRECTIONS: You must complete the entire...
CHE 310 Homework #8 Due WED NOV 6 Name Score: DIRECTIONS: You must complete the entire assignment. 1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) HO 1. Hg(OA), CH, OH H, SO 2. NaBH4 1 BH-THF 2) H2O2, KOH Bry, H,0 1. BH-THF 2. H2O2, NaOH H20, H2SO4 1, NaNH, H-CEC-CH2 CH2 CH 2. CH,CH,B1 Lindlar cat 1....
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni,...
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni, CH2-0-º-(CH3)-CH=CH-(CHỊ) -CHỊ b. Partial Hydrogenation: CH-0-C-(CH2)-CH-CH-(CH3)-CH; CH-0-C-(CH2)-CH-CH-CH2-CH3 + 2H, N . CH-0-C-(CH3)-CH=CH-(CH3-CH c Acid Hydrolysis: CH2-0-C-(CH3)-CH=CH-(CH3)-CH, -0-C-(CH); -CH=CH-CH2)-CH3 + 3H. 0 . 10 CH2-0-C-(CH2)2CH=CH-(CH2)s -CH; d. Saponification: CH2-0-C-(CH3)-CH=CH-CH2)-CH CH-0-C-(CH)-CH=CH-CH3)-CH+ 3NaOH Heat CH2-0-C-(CH)-CH-CH-CH2-CH,
3. (6) Complete the following reactions by drawing the structure of the principal organic product. он...
3. (6) Complete the following reactions by drawing the structure of the principal organic product. он H3O NaOH a. но он CO2 Ho + KOH b. NNCuBr CIO C. HBFA CIO d. heat OH e. pH 9, H20 OCH3 two products, why?
QUESTIONS 6-109. Predict the product formed in each of the following reactions and give each reactant and product a suitable name: (a) CH3CH,MgBr + CH,0 1. ether 2. H 1. ether b) p-CH,CHMgBr CHCHCO 6-110. Using the Grignard reaction, carry out the following transformations. Any necessary organic or inorganic reagents may be used. Name all reactants and products. OH CH,CH,OH (c) CHy 6-112. In the experiment, ligroin may be used as a solvent for the separation of the product from...
1, 2, 3, complete the following reactions by supplying the
missing reactant or product indicated by a question mark. Where
applicable, indicate the formal charges.
(NOTE THE QUESTIONS MARK IN THE QUESTIONS ANT BELOW CAN BE Complete the following reaction by supplying the missing reactant or product indicated by a question mark. Where applicable. indicate the formal charges. Complete the following reaction by supplying the missing reactant or product indicated by a question mark. Where applicable. indicate the formal charges....
Name the type of reaction, reactant (functional group) and product
(functional group) of the following:
-Acid/base
-Addition
-Combustion
-Elimination
-Substitution
material for reactions 1 and 2) H3C— CH reaction 1 Br Br HO CH2=CH2 HC-CH2 HC-CH2 reaction 2 Br reaction 3 CH2 H3C- H2C= CH2 reaction 4 C OH reaction 5 - HC-CH2 H3C— CH Lei reaction 6 HEC OCH HEC OH HUC CNH,
complete the following reactions by providing either the
missing reactant, reagent, or product as indicated:
(for b through e)
d. CH₃ CH₂ CH=CH₂ 1. Hg CoAc)2(ag) 2. NaBity * ET Iy? Eauge, cena 2. H₂00
4. Complete the reactions below by supplying the reactant, reagent or product. (*pts each OH b H,0,HCI Heat O it CI d. (excess) 1. LAIH 2. H2O -CHCH PPh; 3 Name: f. 1. CHACHIMBI 2. H,0 1. LAIH 2. HO h. CuLi(CH 3)2 i. 1. LDA (1 equiv) 2. CHỊCH,C 5
B Bopts) GV Complete the following reactions by putting the structure of the missing compound or reagent in the given box. Show stereochemistry clearly where applicable KMnou (012 rot 1. 2. 번 + H₂O NaBtly 3. chhor 4. @CEC-City CH₂ 5. y o Zn, Acetic acid 6. + Brz Product t BH/THE Intermediate th 7. peroxide ID 8. + Her ho 9. Juller 10. - 0 c(CH3)4, t. Quoh. heat cl 11. NaI Aceton
Complete the following reactions. Provide the missing reactant(s) OR major organic product(s). Show correct regio- and stereochemistry for products you draw, where applicable Сн,, Zn(Cu) 1. OSONMO, pyridine 2. NaHSO, H,0 H2O* g. V 1. BH-THF 2. 1,0,, NaOH, HO - Y 1. MCPBA 2.4,00 DCM H,802, H2O heat 1., 2. Zn, AcOH
CHE 310 Homework #8 Due WED NOV 6 Name Score: DIRECTIONS: You must complete the entire assignment. 1. PREDICT THE PRODUCT: Provide the structure of the major product expected from the following reactions or reaction sequences. Make sure you account for any regio- and/or stereochemistry! (24 pts.) HO 1. Hg(OA), CH, OH H, SO 2. NaBH4 1 BH-THF 2) H2O2, KOH Bry, H,0 1. BH-THF 2. H2O2, NaOH H20, H2SO4 1, NaNH, H-CEC-CH2 CH2 CH 2. CH,CH,B1 Lindlar cat 1....
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni, CH2-0-º-(CH3)-CH=CH-(CHỊ) -CHỊ b. Partial Hydrogenation: CH-0-C-(CH2)-CH-CH-(CH3)-CH; CH-0-C-(CH2)-CH-CH-CH2-CH3 + 2H, N . CH-0-C-(CH3)-CH=CH-(CH3-CH c Acid Hydrolysis: CH2-0-C-(CH3)-CH=CH-(CH3)-CH, -0-C-(CH); -CH=CH-CH2)-CH3 + 3H. 0 . 10 CH2-0-C-(CH2)2CH=CH-(CH2)s -CH; d. Saponification: CH2-0-C-(CH3)-CH=CH-CH2)-CH CH-0-C-(CH)-CH=CH-CH3)-CH+ 3NaOH Heat CH2-0-C-(CH)-CH-CH-CH2-CH,
3. (6) Complete the following reactions by drawing the structure of the principal organic product. он H3O NaOH a. но он CO2 Ho + KOH b. NNCuBr CIO C. HBFA CIO d. heat OH e. pH 9, H20 OCH3 two products, why?
Most questions answered within 3 hours.
-
Will dislike
if you don't code efficiently, you must have knowledge of
next.js,vue.js,immutable.js,react,js.
Develop an api...
asked 1 minute from now -
When financial statements are converted to percentages, they are
referred to as:
A. Percent of change...
asked 8 seconds from now -
16) Which of the following is not a way to reduce the
government's budget
deficit
A)...
asked 25 minutes ago -
At some time, a charged particle with q = −1.24×10−8C is moving
with instantaneous velocity v...
asked 34 minutes ago -
4. Determine the theoretical yield of P2O5, when 3.07 g of P
reacts with 6.09 g...
asked 2 hours ago -
Explain the PEST analysis and how a marketer would use this when
putting together a marketing...
asked 2 hours ago -
S sells property with a $500 basis to B for $450, and B later
sells the...
asked 3 hours ago -
True/False Questions
1.
In interpreting an agreement, courts generally apply a
subjective standard.
2.
If, after...
asked 2 hours ago -
On January 1, 20X7, Green Corp. paid $1,020,000 to acquire Wax
Co. Wax maintained separate incorporation....
asked 3 hours ago -
C++
Write a class Fraction that defines adding, subtracting,
multiplying, and dividing fractions by overloading standard...
asked 4 hours ago -
This java code won't run and I can't figure out the problem with
it. Please help...
asked 5 hours ago -
Trace the following recursive methods:
a) isPal with the string “abccda”
b) isAnBn with the string...
asked 6 hours ago