1. Unsopropylacetylene 7.7 Name the following compounds: CH3 COOH СІ ОН NH2 Br Br CH3CH CH2CH2CH; F CH; CHCH
Name the compounds OCH3 он CH CH3 H3CCN CH3 CN NH2 CH он
Name the following alkyl halides Нас Br Br CH3 CH3CHCHCHCH2CHCH3 CH,сH—снсH,снсH 1st compound 2nd compound: 3 item attempts remaining Submit Answer Try Another Version Which of the following compounds have the same oxidation level as the compound in row 1? (Enter your answer in numerical order as the row number(s) separated by commas, ie. 2,3,5. Ifnone of the compounds have the same oxidation level, write 'none') First set Second set Row 1 Row 2 NH2 Br Row 3 ОН Row...
1. Using IUPAC rules, narne the following organic compounds: CH3CH-CCH2CH2C-CCH2CH2CH2CH2COH CH3CH2CH2NC CH2CH2CH2CHCH2 CH3 CH,CHCH,N CH.CH,CH,CHCH, CH chichi CHCHicHCH.CH CH3CH2 H2CH2CH2CH2CH2CH CH CH2(CHala oČCHCH,CH,CH CH,ç-CH CH, CH CH2C
Give the following compounds there IUPAC name? Thank you in advance! e. (CH2CH2)3CCH(CH3)CH2CH2CH3 f. CH2CH2CH(CH3)CH(CH3)CH(CH2CH2CH3)(CH2)2CH3 g. (CH3CH2CH2)4C
Give the IUPAC name of the following compounds. COZH CH3 OH wolltartoon 50 asso COOH Br CH; CH,-CH2-CH-CH2-CH-CH-CN
Problem 17.3 Give the IUPAC name for each compound. 1. PhCH(CH3)2 CH2CH3 , O CHCH ОН 3 CH3 Br 4. сі
Organic chemistry 6. Addcurvedamowst thefollowingpolarreactionston dicatethe flow ofelectronsine 16points OH + H20 CH3CH-CHCH(CH3)2 CH,CH,CHCH(CH3)2 → (b) CH O CH:Br CH3OCH3 + +Br CH3 + CH,OH Br CH3
Name the following molecules ОН Br Br OH HC CH3 ОН H2c `CH₃
Give both IUPAC names and common names for the following compounds. (a) PhCH,CH,COOH (b) PCO,K (c) (CH3),CHCHBCOOH (d) HOOCCH,CH(CH3)CO,H (e) (CH3)2CHCH,COONa (f) CHCH(NH4)CH-COOH COOH Br in Loo Me" COOH 0) "CHOV COOH
please help! 1) Which of the following compounds is chiral? CH3-1-ci CH3-1-ci Br -1-ci CH3 CH3-1-Br CH3-1-ci CH3 3-1-C CH3 CH3 ci--c1 Br--Br CH3 2) What is the relationship between the structures shown below? H-|-Brand Br- -CH3 CH3 o Constitutional isomers Identical compounds O Diastereomers O Enantiomers O Configurational isomers 4) What is the product of the following reaction? MoBr 2. Fich, o V. HOCHẶCHỌCH-O V. II. CH CHCH-(O) OH CH2OH ON CH3CH II. HOCH2CH2– O III oll ON 01...