Homework Answers
Amino acids are classified in to 2 types.
1. Essential or Indispensable amino acids
2. Non-essential or Dispensable amino acids
The aminos acids which cannot be synthesized in the body and should provide with diet are called Essential amino acids.
Ex: Lysine, Isoleucine, Threonine, Methionine,
Tryptophan, Leucine, Valine, Phenylalanine.
These amino acids cannot be synthesized in the body. Hence they should be provided with diet.
For adults, these are the essential amino acids.
For children along these amino acids, some other amino acids are needed to be provided in the diet.
Those are arginine, histidine, cysteine, glycine, tyrosine, glutamine and proline.
In adults these amino acids can be synthesized by process of transmination ie conversion of one amino acid to other. It is not possible in case of children. Hence they should provide with diet.
Add Answer to:
16. List five (5) essential amino acids in children and include how it differs from that of an adult.
5. The following amino acids are considered non-essential: alanine, glutamic acid, and serine. From what biomolecule...
5. The following amino acids are considered non-essential: alanine, glutamic acid, and serine. From what biomolecule can each be made? (Consider anaplerotic reactions and metabolism of other amino acids.) (6 pts - 2 ea.) 6. List five organic coenzymes covered so far that can be used for oxidation/reduction. (10 pts - 2 ea.)
Amino acids can be categorized according to the body's ability to synthesize them. Both essential and...
Amino acids can be categorized according to the body's ability to synthesize them. Both essential and nonessential amino acids are necessary for life, but the human body is unable to synthesize some amino acids. Different pathways enable synthesis of nonessential amino acids from five precursors: pyruvate, 3-phosphoglycerate, oxaloacetate, a-ketoglutarate, and phenylalanine. Many of these pathways include a process called transamination, which is a reaction between an amino acid and an alpha-keto acid. Some non essential amino acids are synthesized in...
5. Draw structures of nine essential amino acids.
5. Draw structures of nine essential amino acids.
1. Amino acids are often broken down into two groups, essential and nonessential. Essential amino acids...
1. Amino acids are often broken down into two groups, essential and nonessential. Essential amino acids must be eaten in order to survive as we don’t make them. This is why intaking a certain amount of protein is so important to the body. In one of the greatest scientific finds of the 21st century, amino acids were discovered inside meteorites that had impacted the earth. Interestly, the amino acids contained different side chains and configurations than those found on earth....
Font Ратауар 15. Excess essential amino acids may be stored as: a) proteins. b) glycogen. c)...
Font Ратауар 15. Excess essential amino acids may be stored as: a) proteins. b) glycogen. c) fats. d) a) and (or just) c, depending on the amino acid. e) b) and (or just) c, depending on the amino acid. 16. Some non-essential amino acids are non-essential because they are made in you but only: a) if certain essential amino acids are present in your diet. b) if pyruvate or certain TCA cycle intermediates are present in your diet. c) if...
Taurine is an essential amino acids for the cat but not the dog. It is essential...
Taurine is an essential amino acids for the cat but not the dog. It is essential becuase cats are ubable to synthesize taurine in the amount required to meet its metabolic needs. Current recommendations are 0.1g per 1,000 kcal of energy. Sabrina, the Persian cat, is eating 326 kcal per day. How much taurine is Sabrina consuming each day? a) 43.5mg b) 32.6mg c) 16.8mg d) 25.5mg
. storage carbohydrate in humans is --------------. 2. Can legumes/beans/vegetarian protein provide all essential amino acids?...
. storage carbohydrate in humans is --------------. 2. Can legumes/beans/vegetarian protein provide all essential amino acids? Yes or No. 3. Why Trans fats are bad for us? 4. List 3-4 sources of omega -3 fatty acids in our diet. You must include at least one plant based source. 5. Does animal foods such as meat/fish/dairy provide us with Fiber? If you answer is No then name 2-3 food sources of fiber.
1. Identify the chemical elements of protein. How many amino acids are there that build body...
1. Identify the chemical elements of protein. How many amino acids are there that build body proteins. How many essential amino acids are there. 2. What is the difference between indispensable (essential), dispensable (nonessential), and conditionally indispensable (essential) amino acids. 3. What are the major functions of proteins in the body. 3. Describe nitrogen balance and the conditions that may result in positive and negative nitrogen balance. 4. What are complete and incomplete proteins. Identify food items that contain complete...
Sometimes the distinction between essential and nonessential amino acids can become a little blurred. Here is...
Sometimes the distinction between essential and nonessential amino acids can become a little blurred. Here is an interesting article that talks about this. http://www.naturalhealthresearch.org/essential-amino-acid/ What new information did you obtain from it?
essential fatty acids essential amino acids Your diet provides C A for ATP production, as raw...
essential fatty acids essential amino acids Your diet provides C A for ATP production, as raw materials to build your own molecules, and essential nutrients -- substances you require but cannot make yourself. • The must be obtained from your diet, either by eating meat, eggs, or milk, or by consuming a variety of plant proteins. fuel organic molecules vitamin C B vitamins minerals One of the Jis needed to make membrane phospholipids. Organic nutrients called are required in very...
5. The following amino acids are considered non-essential: alanine, glutamic acid, and serine. From what biomolecule can each be made? (Consider anaplerotic reactions and metabolism of other amino acids.) (6 pts - 2 ea.) 6. List five organic coenzymes covered so far that can be used for oxidation/reduction. (10 pts - 2 ea.)
Amino acids can be categorized according to the body's ability to synthesize them. Both essential and nonessential amino acids are necessary for life, but the human body is unable to synthesize some amino acids. Different pathways enable synthesis of nonessential amino acids from five precursors: pyruvate, 3-phosphoglycerate, oxaloacetate, a-ketoglutarate, and phenylalanine. Many of these pathways include a process called transamination, which is a reaction between an amino acid and an alpha-keto acid. Some non essential amino acids are synthesized in...
5. Draw structures of nine essential amino acids.
Font Ратауар 15. Excess essential amino acids may be stored as: a) proteins. b) glycogen. c) fats. d) a) and (or just) c, depending on the amino acid. e) b) and (or just) c, depending on the amino acid. 16. Some non-essential amino acids are non-essential because they are made in you but only: a) if certain essential amino acids are present in your diet. b) if pyruvate or certain TCA cycle intermediates are present in your diet. c) if...
essential fatty acids essential amino acids Your diet provides C A for ATP production, as raw materials to build your own molecules, and essential nutrients -- substances you require but cannot make yourself. • The must be obtained from your diet, either by eating meat, eggs, or milk, or by consuming a variety of plant proteins. fuel organic molecules vitamin C B vitamins minerals One of the Jis needed to make membrane phospholipids. Organic nutrients called are required in very...
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 3 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 4 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 7 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 8 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago