Already posted this question but it was
wrong the other times ;(
Homework Answers
Add Answer to:
Already posted this question but it was wrong the other times ;( Consider the following gas phase reaction. D B—A=A—B +...
Use the Bond Energies Table to estimate the enthalpy change in each of the following reactions....
Use the Bond Energies Table to estimate the enthalpy change in each of the following reactions. (Enter your answer to the nearest integer.) (a) CH4(g) C(g) 2 H2(g) 4.0 X kJ/mol (b) ICH3(g) + H20(g) H3COH(g) HI(g) 4.0 X kJ/mol HC CH(g)2 H2(g)H3C-CH 3 (g) (c) 4.0 X kJ/mol
Options for Part b : 1.) negative 2.) postive or 3.) nearly zero Options for Part C:...
Options for Part b : 1.) negative
2.) postive or 3.) nearly zero
Options for Part C: 1.) Not very extensive at low temps but more
so at high temps or 2.) extensive at all temps with only slight
variations in temperature 3.) extensive at low temps but more so at
high temps or 4.) extensive and its extent would not vary much with
temperature or 5.) extensive at low temps but less so at
high temps or 6.) Not very extensive...
1. + 0.25/0.75 points Previous Answers My Notes + Ask Your Teacher Use the Bond Energies...
1. + 0.25/0.75 points Previous Answers My Notes + Ask Your Teacher Use the Bond Energies Table to estimate the enthalpy change in each of the following reactions. (Enter your answer to the nearest integer.) (a) ICH3(g) + H20(g) → H3COH() + HI(g) 49 30 kJ/mol (b) 49 CH49) → 794 (9) + 2 H2(g) x kJ/mol (c) H2CBr2(g) + F2(g) → H2CF2(g) + Brz(9) 49 -364 x kJ/mol
Review Intelligent Tutoring Problem 03-02 Consider the following reaction, with all reagents in the gas phase:...
Review Intelligent Tutoring Problem 03-02 Consider the following reaction, with all reagents in the gas phase: Η Η C=( + 3 0=0 HH 2 0=c=0 +2 -O-H Avarage bond energy for C=0 = 800 kJ/mol. x Incorrect. Make sure you used AE = sum of energies of bonds broken - sum of energies of bonds made. Calculate the energy change of this reaction (in kJ mol-?) using average bond energies found in Table 3-2 of the textbook. Use 800 kJ/mol...
Estimate the enthalpy change for the following reaction : H2(g) + C2H4(g) -------> C2H6(g), given the...
Estimate the enthalpy change for the following reaction : H2(g) + C2H4(g) -------> C2H6(g), given the following bond energies: BE(H-H) = 436 kJ/mol; BE(C-H) = 414 kJ/mol; BE(C-C) = 347 kJ/mol; BE(C=C) = 620 kJ/mol. A. -119 kJ B. +119 kJ C. -392 kJ D. +392 kJ E. none of the above
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction:...
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction: 2 HF (g) H2 (g)F2 (g) Bond type Bond Energy (kJ/mol) 159 F-F H-H 432 H-F 565 Enter your answers to zero decimal places. Ignore significant figure rules. Include negative signs if necessary What is the sum of the reactant bond enthalpies? kJ What is the sum of the product bond enthalpies? kJ What is the overall enthalpy of reaction? kJ
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction: Co2...
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction: Co2 (g)2 H20 (g) CH4 (g)+2 02 (8) Bond type Bond Energy (kJ/mol) C-C 347 C=C 614 C-H 413 O-O 204 498 O=O 358 C-O C=O 799 H-O 467 Enter your answers to zero decimal places. Ignore significant figure rules. Include negative signs if necessary. What is the sum of the reactant bond enthalpies? kJ What is the sum of the product bond enthalpies?...
3. Consider the following reaction for the combustion of pentane to answer parts a and b...
3. Consider the following reaction for the combustion of pentane to answer parts a and b below. CsH1x+8 Op+5 COa+6 H.O or н H H H H H-C 5 O C=O +6 -H +8 O=0 C H н H a.) Given the following bond dissociation energies, estimate the molar enthalpy change for the combustion of pentane. D-732 kJ/mol D 410 kJ/mol C-O D 436 kJ/mol C-H Н-Н D 498 kJ/mol H-O D-460 kJ/mol D 350 kJ/mol O-O Сс
Answe all please! Consider the following reaction carried out under constant pressure 2HCl(aq) + Zn(s) -...
Answe all please!
Consider the following reaction carried out under constant pressure 2HCl(aq) + Zn(s) - H2(g) + ZnCl2(s) AHpx = -80.97 kJ Calculate the heat associated with the complete reaction of 24.3 g of HCl with 16.8 g of Zn. 0-54.0 kJ 0-10.8 kJ O-55.2 kJ -20.8 kJ O-27.0 kJ Determine AHrxn for the reaction CO2(g) + 2 H2O(9) CH4(9) + 2 O2(g) given the following average bond energies (values given parentheses) C-H (414 kJ/mol) O=O (498 kJ/mol) C=0...
717)Use the reactions below to calculate the standard change in enthalpy for the reaction of methane...
717)Use the reactions below to calculate the standard change in enthalpy for the reaction of methane (CH4) with chlorine to form chloroform (CHC13) and hydrochloric acid: CH4(g) + 3Cl2(g) → CHCI3(g) + 3HCI(g) Reaction 1: HCI(g) → H2(g) + 2Cl2(g) AH° = +92.3 kJ Reaction 2: CH4(g) → C(s) + 2H2(g) AH° = +74.8 kJ Reaction 3: C(s) + 3H2(g) + 3/2Cl2(g) →CHCl3(g) AH° = -103.1 kJ x a. +270.2 kl b. +248.6 kJ PC. +64.0 kJ -120.6 kJ -305.2...
Use the Bond Energies Table to estimate the enthalpy change in each of the following reactions. (Enter your answer to the nearest integer.) (a) CH4(g) C(g) 2 H2(g) 4.0 X kJ/mol (b) ICH3(g) + H20(g) H3COH(g) HI(g) 4.0 X kJ/mol HC CH(g)2 H2(g)H3C-CH 3 (g) (c) 4.0 X kJ/mol
Options for Part b : 1.) negative
2.) postive or 3.) nearly zero
Options for Part C: 1.) Not very extensive at low temps but more
so at high temps or 2.) extensive at all temps with only slight
variations in temperature 3.) extensive at low temps but more so at
high temps or 4.) extensive and its extent would not vary much with
temperature or 5.) extensive at low temps but less so at
high temps or 6.) Not very extensive...
1. + 0.25/0.75 points Previous Answers My Notes + Ask Your Teacher Use the Bond Energies Table to estimate the enthalpy change in each of the following reactions. (Enter your answer to the nearest integer.) (a) ICH3(g) + H20(g) → H3COH() + HI(g) 49 30 kJ/mol (b) 49 CH49) → 794 (9) + 2 H2(g) x kJ/mol (c) H2CBr2(g) + F2(g) → H2CF2(g) + Brz(9) 49 -364 x kJ/mol
Review Intelligent Tutoring Problem 03-02 Consider the following reaction, with all reagents in the gas phase: Η Η C=( + 3 0=0 HH 2 0=c=0 +2 -O-H Avarage bond energy for C=0 = 800 kJ/mol. x Incorrect. Make sure you used AE = sum of energies of bonds broken - sum of energies of bonds made. Calculate the energy change of this reaction (in kJ mol-?) using average bond energies found in Table 3-2 of the textbook. Use 800 kJ/mol...
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction: 2 HF (g) H2 (g)F2 (g) Bond type Bond Energy (kJ/mol) 159 F-F H-H 432 H-F 565 Enter your answers to zero decimal places. Ignore significant figure rules. Include negative signs if necessary What is the sum of the reactant bond enthalpies? kJ What is the sum of the product bond enthalpies? kJ What is the overall enthalpy of reaction? kJ
Using the table of bond energies below, calculate the following enthalpy values associated with this reaction: Co2 (g)2 H20 (g) CH4 (g)+2 02 (8) Bond type Bond Energy (kJ/mol) C-C 347 C=C 614 C-H 413 O-O 204 498 O=O 358 C-O C=O 799 H-O 467 Enter your answers to zero decimal places. Ignore significant figure rules. Include negative signs if necessary. What is the sum of the reactant bond enthalpies? kJ What is the sum of the product bond enthalpies?...
3. Consider the following reaction for the combustion of pentane to answer parts a and b below. CsH1x+8 Op+5 COa+6 H.O or н H H H H H-C 5 O C=O +6 -H +8 O=0 C H н H a.) Given the following bond dissociation energies, estimate the molar enthalpy change for the combustion of pentane. D-732 kJ/mol D 410 kJ/mol C-O D 436 kJ/mol C-H Н-Н D 498 kJ/mol H-O D-460 kJ/mol D 350 kJ/mol O-O Сс
Answe all please!
Consider the following reaction carried out under constant pressure 2HCl(aq) + Zn(s) - H2(g) + ZnCl2(s) AHpx = -80.97 kJ Calculate the heat associated with the complete reaction of 24.3 g of HCl with 16.8 g of Zn. 0-54.0 kJ 0-10.8 kJ O-55.2 kJ -20.8 kJ O-27.0 kJ Determine AHrxn for the reaction CO2(g) + 2 H2O(9) CH4(9) + 2 O2(g) given the following average bond energies (values given parentheses) C-H (414 kJ/mol) O=O (498 kJ/mol) C=0...
717)Use the reactions below to calculate the standard change in enthalpy for the reaction of methane (CH4) with chlorine to form chloroform (CHC13) and hydrochloric acid: CH4(g) + 3Cl2(g) → CHCI3(g) + 3HCI(g) Reaction 1: HCI(g) → H2(g) + 2Cl2(g) AH° = +92.3 kJ Reaction 2: CH4(g) → C(s) + 2H2(g) AH° = +74.8 kJ Reaction 3: C(s) + 3H2(g) + 3/2Cl2(g) →CHCl3(g) AH° = -103.1 kJ x a. +270.2 kl b. +248.6 kJ PC. +64.0 kJ -120.6 kJ -305.2...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 29 seconds from now -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 16 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 17 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 31 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago