Classify each of the following organic reactions. Substitution Elimination Addition Type of Reaction Reaction OH CH2-CH + HCN– CH3-CH-CN CH3-CH2-CH2-OH + HBr – CH3-CH2-CH2-Br + H2O CH3-CH=CH-CH3 + HBr – CH3-CH-CH2-CHz Br
Name: Question 1: Draw the expected major product for the following reactions: CH2 нс HI - CH2 HBr ROOR Question 2 Draw a mechanism for the following transformations: HEC CH3 НСІ A HCI H₂C CH₂
complete the following reactions LE H3C-CH2-C-CH3 NaOH ОН HO + HO K2Cr2O7 H2C-CH-CH2-OH CH3 4x OH + HBr
Post Lab questions 1. Complete the following reactions and name the products. CH3 -CH=CH2 + CI + Brz c) CH3 -CH=CH-CH, + HBr - Pt d) CH3 -CH2-CH=CH2 + H 25 °C, I am A Bez 2. Toluene contains a benzene ring with three double bonds in it, but still does not show any signs of undergoing a reaction with bromine solution. Why? 3. Why doesn't cyclohexane decolorize the orange-red color of the bromine or the purple color of KMnO...
a Complete the following equations, H3C CH2 + HBr CH3 P opy aste *** ChemDoodle Н.С. H2SO4 - CH₂ + H2O с opy este C- *** // ChemDoodle
1. Complete the following reactions, with the major organic product. a. CH3-CH=CH2 + Br2 O + B12 c. CH3-CH-CH-CH3 +KMnO4+H2O d. CH3CH2-CH=CH-CH2CH3 + H2S04 2. Between hexane, cyclohexene and toluene, which was the most reactive with bromine solution? Explain your reasoning. 3. Based on the chemical tests used in this experiment, is it possible to clearly distinguish between alkanes and alkenes? Explain your reasoning. P
Classify each of the following organic reactions. Addition CH3-CH2-CH-CH3 – CH3-CH2-CH=CH2 + HCI CH3-C-O-CH3 + CH3-NH-CH3-C-NH-CH3 + CH2-OH CH3-CH2-CH2-OH + HBr -- CH3-CH2-CH2-Br + H20 Elimination OH CH2-CH + HCN – CH3-CH-CN CH3-CH=CH-CH3 + HBr + CH3-CH-CH2-CH3 Br Substitution CH3-CH2-CH2-CH3 + Cl2 → CH-CH2-CH2-CH3 + HCI СІ CH3-CH=CH-CH3 + Cl2 - CH3-CH-CH-CH3 CICI Reset
Give the organic products of the reactions. INCLUDE STEREOCHEMISTRY & REGIOSPECIFICITY. CH3 CH,CH2CCH2C CH 2 HBr CH3 Pd/BaSO4 C C H2 Pt + 2D2 CH3(CH2)3C CH Na Ph-C C-Ph NH3 1) (CH3)C-O NANH 2) H2O CH,C CH
5. Complete the following triacylglycerol reactions: a. Complete Hydrogenation: CH2-0-C-(CH3)-CH-CH (CH)s-CH CH-0-C-(CHỊhCH=CH-(CHỊ) -CH, + 3H, Ni, CH2-0-º-(CH3)-CH=CH-(CHỊ) -CHỊ b. Partial Hydrogenation: CH-0-C-(CH2)-CH-CH-(CH3)-CH; CH-0-C-(CH2)-CH-CH-CH2-CH3 + 2H, N . CH-0-C-(CH3)-CH=CH-(CH3-CH c Acid Hydrolysis: CH2-0-C-(CH3)-CH=CH-(CH3)-CH, -0-C-(CH); -CH=CH-CH2)-CH3 + 3H. 0 . 10 CH2-0-C-(CH2)2CH=CH-(CH2)s -CH; d. Saponification: CH2-0-C-(CH3)-CH=CH-CH2)-CH CH-0-C-(CH)-CH=CH-CH3)-CH+ 3NaOH Heat CH2-0-C-(CH)-CH-CH-CH2-CH,
Practice: Write the products for the following reactions. Propene Cyclohexene HBr | CH 3 CH Br CH₂ Hert Cl2, CH2Cl2 NBS, H2O, DMSO Cl2, CH3OH 1) Hg(OAc)2, H2O/THF 2) NaBH 1) BHz in THF 2) H2O2, OH-