Homework Answers
SWOT (STRENGTH, WEAKNESS, OPPURTUNITIES, THREATS) :
Swot is one of a business plan where it will identifies the strengths, weakness, oppurtunities and threats of a business competition and project planning. It is otherwise called as tried and true tool of strategies. Swot mainly uses market strategies, building strategy of a person who is working in one organization.
HCO (HEALTH CARE ORGANIZATIONS) :
Health care organizations are the one which delivers medical health organizations, managed care regulations. In this self insured people may contact with HCO administrators to provide medical services for injured persons and disabled persons. IN this practice comprehensive medical health practice is included.
There both SWOT and HCO are having their own limitations which the manager can co ordinate between two these while providing medical care services to patients.
Add Answer to:
Explain in your own words 3. How could a manager determine the swOTs for an HCO?
1. a, In your own words, explain the goal of a peer review. b, What could...
1. a, In your own words, explain the goal of a peer review. b, What could improve the peer review process?
Explain, in your own words, what the sticky bit is and its purpose. ( 3. Explain,...
Explain, in your own words, what the sticky bit is and its purpose. ( 3. Explain, in your own words, what the purpose of SUID and SGID are. Research and provide an example of when they may be used. 4. Show the contents of your home directory in a way that shows the hidden files. Pick four of these hidden files and research to determine what their purpose is. (
(in your own words) of what leadership means to you. Explain why leadership and management are...
(in your own words) of what leadership means to you. Explain why leadership and management are different. Use your own words. R include a personal example where you have witnessed a good leader and a good manager or a poor leader or manager. Relate to the how these leaders or managers affected you. Do you think that all good managers must be good leaders to be effective?
In your own words, how might a project manager alter a straightforward PERT network to accommodate...
In your own words, how might a project manager alter a straightforward PERT network to accommodate an inordinately large and complex project?
In your own words: In a minimum of 100 words, explain how macros can be used...
In your own words: In a minimum of 100 words, explain how macros can be used for database security.
Explain in your own words the meaning of each of the following words. Discuss how they...
Explain in your own words the meaning of each of the following words. Discuss how they are related to the concepts of gas exchange. (At least one full page.) Ischemia Infarction Anoxia
9) In your own words, explain how gene expression can be regulated by miRNAs. Choose a...
9) In your own words, explain how gene expression can be regulated by miRNAs. Choose a gene of your choice and explain how miRNAs could be used to elucidate its function. Include your hypothesis and expected results from your proposed experiment (10 points). aculated by mininas, Choose asene of your
2. What is meant by concurrent audits and how it could be achieved? 3. In your own words, differentiate between COSO an...
2. What is meant by concurrent audits and how it could be achieved? 3. In your own words, differentiate between COSO and COBIT in terms of their purpose and application. Why do organizations need to apply both of them not only one. (write 200 words).
explain in your own words what the graph is depicting 24. Explain in your own words...
explain in your own words what the graph is
depicting
24. Explain in your own words what the graph pictured below is depicting, IM Plasma Drug Concentration SC or PO Time
Question 3 (25 points): 1) (1pt) Explain briefly and in your own words why collision is...
Question 3 (25 points): 1) (1pt) Explain briefly and in your own words why collision is an issue in random access protocols but not in controlled access protocols. 2) (2pts) Explain briefly and in your own words why collision is an issue in random access protocols but not in channelization protocols. 3) (2pts) What happens if there is a collision during the handshaking period? 4) (5pts) Give 2 reasons that CSMA/CD cannot be used in a wireless LAN? 5) (5pts)...
9) In your own words, explain how gene expression can be regulated by miRNAs. Choose a gene of your choice and explain how miRNAs could be used to elucidate its function. Include your hypothesis and expected results from your proposed experiment (10 points). aculated by mininas, Choose asene of your
explain in your own words what the graph is
depicting
24. Explain in your own words what the graph pictured below is depicting, IM Plasma Drug Concentration SC or PO Time
Question 3 (25 points): 1) (1pt) Explain briefly and in your own words why collision is an issue in random access protocols but not in controlled access protocols. 2) (2pts) Explain briefly and in your own words why collision is an issue in random access protocols but not in channelization protocols. 3) (2pts) What happens if there is a collision during the handshaking period? 4) (5pts) Give 2 reasons that CSMA/CD cannot be used in a wireless LAN? 5) (5pts)...
Most questions answered within 3 hours.
-
The energy required to remove an electron from a surface of a
solid element is called...
asked 1 hour ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 1 hour ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 2 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 3 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 3 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 5 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 5 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 6 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 7 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 7 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 8 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 8 hours ago