Homework Answers
5) sulphuric acid is a diprotic acid.
Dissociation reactions of sulphuric acid are
H2SO4 ---------> H+ + HSO-4
HSO-4 ------------> H+ + SO2-4
6)
HBr is a strong acid and it ionizes completely.
HBr -------> H+ + Br-
One molar HBr gives one mole of Hydronium ions
Since [HBr] = 0.015 M, it gives [H+] = 0.015 M
pH = -log[H+]
pH = -log(0.015)
pH = 1.824
Add Answer to:
please help with 5 and 6 showing work
3. Write the two reactions for the complete...
5 & 6 1014 3.70xie - 2.7 5. Write the two reactions for the complete dissociation...
5 & 6
1014 3.70xie - 2.7 5. Write the two reactions for the complete dissociation of H2SO4, a polyprotic acid. (2pts) ph 14- ? 6. Calculate the pH of a 0.015 M solution of HBr. Circle your answer. (2pts) рон pon
3. Calculate and insert the proper values to complete the following table: 8pts) [H+M pH Acidic...
3. Calculate and insert the proper values to complete the following table: 8pts) [H+M pH Acidic or Basic [OH-M Solution 8.21 POH 1.78 x 10 3.70 x 10-2 4. Give definitions of an Arrhenius acid, a Bronsted-Lowry acid, and a Lewis acid. (3pts) 5. Write the two reactions for the complete dissociation of H.SO., a polyprotic acid. 2pts) 6. Calculate the pH of a 0.015 M solution of HBr. Circle your answer. (2pts)
7. If H,PO, has K, -6.83 x 10, and Hco, has K,-5.8x 10", which is the...
7. If H,PO, has K, -6.83 x 10, and Hco, has K,-5.8x 10", which is the weaker acid? Circle your answer and explain how you know. (Ipt 8. For a solution with pH 9.74, calculate the following: (3pa) [H'] [OH] pOH- 9. (2pas total) a. A solution of a weak acid with concentration 0.11 M. is 8.8 % ionized. Calculate its K, value. K, b. Calculate the K, value of a 0.060 M solution of a monoprotic acid with [H']...
please help with numbers 7, 8 and 9 showing work 7. If H.PO, has K. -6.83 x 10', and H.CO, has K, -5.8 x 10", which...
please help with numbers 7, 8 and 9 showing work
7. If H.PO, has K. -6.83 x 10', and H.CO, has K, -5.8 x 10", which is the weaker acid? Circle your answer and explain how you know. (pt) 8. For a solution with pH = 9.74, calculate the following: 3ps) [OH) = pOH - 9. (pes total) a. A solution of a weak acid with concentration - 0.11 M. is 8.8 % ionized. Calculate its K, value b. Calculate...
A solution is prepared containing 5 times 10^-6 M selenous acid (H_2 SeO_3^0) at pH 7.8...
A solution is prepared containing 5 times 10^-6 M selenous acid (H_2 SeO_3^0) at pH 7.8 and 25 degree C Write out stepwise mass action reactions for the first and second acid-dissociation reactions. The acid constants are 2.63 (pK_a1) and 8.40 (pK_a2). Write out the overall mass action reaction for complete dissociation of selenous acid and calculate the overall dissociation constant. Write out the mass balance equation for selenium, assuming only selenous acid and its conjugate bases are present in...
i need help you mix equal concentrations of the following reactants and products, will the reaction...
i need help
you mix equal concentrations of the following reactants and products, will the reaction proceed to the left or to the right? Explain your answer briefly. (6 pts) (a) HF (aq) + NO3(a) HNO, (aq) + F (b) NH. (aq) + CO2(aq) HCO3' (aq) + NH3(aq) 17. The concentration of OH in human blood is 2.24 x 10-7M. Calculate the concentration of H30 ions and classify the solution as acidic, neutral or basic (5 pts) 18. (a) What...
show work please 4) Write out the acid dissociation reaction for hydrochloric acid. Calculate the pH...
show work please
4) Write out the acid dissociation reaction for hydrochloric acid. Calculate the pH of a solution prepared by diluting 3 ml of 0.5 M HCl to a final volume of 100 ml with H20. (3 pt)
Part 3: Working with the Titration Curve for a Polyprotic Acid and Strong Base Consider carbonic...
Part 3: Working with the Titration Curve for a Polyprotic Acid and Strong Base Consider carbonic acid, H.CO, (which is polyprotic) - a) Write the multi-step dissociation equilibrium for this acid in water (ie, there should be three chemical dissociation stages connected by two equilibrium arrows, given below): b) Below is an idealized titration curve showing the exhibited pH for 25.00 mL of a 0.100 M aqueous carbonic acid solution as a function of added 0.100 M NaOH in units...
phosphoric avid is a polyprotic avid. write balanced chemical equation please help with answering all of...
phosphoric avid is a polyprotic avid. write balanced chemical
equation
please help with answering all of these blanks! thank you!
TABLE 22-5. Acid and Base Dissociation Constants Solution Value of K, ork 0.1 M NACI 0.1 M NaC,H,O, Dissociation Constant Expression CNA OHJCHCI CNOCI [H 3 O + ][ Na C₂H₂ 0₂ ] (NaC₂H₂ O2] CN03 C F07 TK = [Fe(NO3),] CNH3][ HC17 ENHYCH 0.1 M Fe(NO3), 01 M NHẠCH 0,1 M KHCO, 0.1 M AICI 0.1 M Na,Co, Sample...
Need help with 1-6 Write a neutralization reaction for each acid and base pair (a) HF(aq)...
Need help with 1-6
Write a neutralization reaction for each acid and base pair (a) HF(aq) and Ba(OH)2(ag) (b) HCIO4a and NaOH(aq) (c) HBr(ag) and Ca(OH)2(aą) (d) HCIaą) and KOH(aq) 2. Write a balanced chemical equation showing how each met- al reacts with HCI (a) K (b) Ca (c) Na (d) Sr 3. Write a balanced chemical equation showing how each met- al oxide reacts with HCI (a) SrO (b) Na2O (c) LiO (d) BaO What volume in milliliters of...
5 & 6
1014 3.70xie - 2.7 5. Write the two reactions for the complete dissociation of H2SO4, a polyprotic acid. (2pts) ph 14- ? 6. Calculate the pH of a 0.015 M solution of HBr. Circle your answer. (2pts) рон pon
3. Calculate and insert the proper values to complete the following table: 8pts) [H+M pH Acidic or Basic [OH-M Solution 8.21 POH 1.78 x 10 3.70 x 10-2 4. Give definitions of an Arrhenius acid, a Bronsted-Lowry acid, and a Lewis acid. (3pts) 5. Write the two reactions for the complete dissociation of H.SO., a polyprotic acid. 2pts) 6. Calculate the pH of a 0.015 M solution of HBr. Circle your answer. (2pts)
7. If H,PO, has K, -6.83 x 10, and Hco, has K,-5.8x 10", which is the weaker acid? Circle your answer and explain how you know. (Ipt 8. For a solution with pH 9.74, calculate the following: (3pa) [H'] [OH] pOH- 9. (2pas total) a. A solution of a weak acid with concentration 0.11 M. is 8.8 % ionized. Calculate its K, value. K, b. Calculate the K, value of a 0.060 M solution of a monoprotic acid with [H']...
please help with numbers 7, 8 and 9 showing work
7. If H.PO, has K. -6.83 x 10', and H.CO, has K, -5.8 x 10", which is the weaker acid? Circle your answer and explain how you know. (pt) 8. For a solution with pH = 9.74, calculate the following: 3ps) [OH) = pOH - 9. (pes total) a. A solution of a weak acid with concentration - 0.11 M. is 8.8 % ionized. Calculate its K, value b. Calculate...
A solution is prepared containing 5 times 10^-6 M selenous acid (H_2 SeO_3^0) at pH 7.8 and 25 degree C Write out stepwise mass action reactions for the first and second acid-dissociation reactions. The acid constants are 2.63 (pK_a1) and 8.40 (pK_a2). Write out the overall mass action reaction for complete dissociation of selenous acid and calculate the overall dissociation constant. Write out the mass balance equation for selenium, assuming only selenous acid and its conjugate bases are present in...
i need help
you mix equal concentrations of the following reactants and products, will the reaction proceed to the left or to the right? Explain your answer briefly. (6 pts) (a) HF (aq) + NO3(a) HNO, (aq) + F (b) NH. (aq) + CO2(aq) HCO3' (aq) + NH3(aq) 17. The concentration of OH in human blood is 2.24 x 10-7M. Calculate the concentration of H30 ions and classify the solution as acidic, neutral or basic (5 pts) 18. (a) What...
show work please
4) Write out the acid dissociation reaction for hydrochloric acid. Calculate the pH of a solution prepared by diluting 3 ml of 0.5 M HCl to a final volume of 100 ml with H20. (3 pt)
Part 3: Working with the Titration Curve for a Polyprotic Acid and Strong Base Consider carbonic acid, H.CO, (which is polyprotic) - a) Write the multi-step dissociation equilibrium for this acid in water (ie, there should be three chemical dissociation stages connected by two equilibrium arrows, given below): b) Below is an idealized titration curve showing the exhibited pH for 25.00 mL of a 0.100 M aqueous carbonic acid solution as a function of added 0.100 M NaOH in units...
phosphoric avid is a polyprotic avid. write balanced chemical
equation
please help with answering all of these blanks! thank you!
TABLE 22-5. Acid and Base Dissociation Constants Solution Value of K, ork 0.1 M NACI 0.1 M NaC,H,O, Dissociation Constant Expression CNA OHJCHCI CNOCI [H 3 O + ][ Na C₂H₂ 0₂ ] (NaC₂H₂ O2] CN03 C F07 TK = [Fe(NO3),] CNH3][ HC17 ENHYCH 0.1 M Fe(NO3), 01 M NHẠCH 0,1 M KHCO, 0.1 M AICI 0.1 M Na,Co, Sample...
Need help with 1-6
Write a neutralization reaction for each acid and base pair (a) HF(aq) and Ba(OH)2(ag) (b) HCIO4a and NaOH(aq) (c) HBr(ag) and Ca(OH)2(aą) (d) HCIaą) and KOH(aq) 2. Write a balanced chemical equation showing how each met- al reacts with HCI (a) K (b) Ca (c) Na (d) Sr 3. Write a balanced chemical equation showing how each met- al oxide reacts with HCI (a) SrO (b) Na2O (c) LiO (d) BaO What volume in milliliters of...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 28 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 59 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago