Homework Answers
Add Answer to:
What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(1) Hint #2: Convert grams to moles and then moles back into grams. Mass of PbSO4 formed = 0.007 grams Mass of PbSO4 formed = 0.275 grams Mass of PbSO4 formed = 1.225 grams Mass of PbSO4 formed = 2.275 grams...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) +...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4...
Use the following lead-acid battery cell to answer the related questions: PbO2 (s) │PbSO4 (s) │H2SO4 (aq) (1 M) ‖ H2SO4 (aq) (1 M)│Pb (s) │PbSO4 (s) A. (5 pts) Determine the Cell potential for the battery at 25°C B. (5 pts) A high output alternator for a KIA soul can produce 220 Amp current. How long would it take to recharge/reform 4.03 kg of Pb at that rate (assuming your battery is near dead)?
In a lead acid battery (the battery that is used to start your car), the following...
In a lead acid battery (the battery that is used to start your car), the following reaction occurs: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(l) How many electrons are transferred in this reaction? Enter your answer as an integer.
ch.19 answer each of them please Part A What mass of lead sulfate is formed in...
ch.19
answer each of them please
Part A What mass of lead sulfate is formed in a lead-acid storage battery when 1.12 g of Pb undergoes oxidation? IVO AQ ? Submit Request Answer Part A What mass of aluminum metal can be produced per hour in the electrolysis of a molten aluminum salt by a current of 29 A? Express your answer using two significant figures. VO AXO ? mo 8 Submit Request Answer Copper can be electroplated at the...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in 1859...
The lead-acid storage battery is the oldest rechargeable battery in existence. It was invented in 1859 by French physician Gaston Plante and still retains application today, more than 150 years later. There are two reactions that take place during discharge of the lead-acid storage battery. In one step, sulfuric acid decomposes to form sulfur trioxide and water: H2SO4 (l) → SO3 (g) + H2O (l) ΔH=+113.kJ In another step, lead, lead(IV) oxide, and sulfur trioxide react to form lead(II) sulfate:...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red...
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)+5 H20) PbSO4 (s) + H3O (aq) 2 e Pb (s)+HSO (aq)+ H20 (I) E reduced 0.36 V How much current (in A) does a cell phone charger for your car use if your car dies after 14 hours of leaving the phone plugged in without...
Question 10 0.5 pts What mass of lead sulfate (PbSO4) is formed in a lead-acid storage battery when 1.00 g of Pb undergoes oxidation? Hint: Lead-Acid batter cell: Pb(s) + PbO2(s) + 2 H2SO4(aq) → 2 PbSO4(s) + 2 H2O(1) Hint #2: Convert grams to moles and then moles back into grams. Mass of PbSO4 formed = 0.007 grams Mass of PbSO4 formed = 0.275 grams Mass of PbSO4 formed = 1.225 grams Mass of PbSO4 formed = 2.275 grams...
5. A lead storage battery involves the following two half-reactions: PbSO4(s) + 2e → Pb(s) + SO42- (aq); E = -0.36 V PbO2(s) + 4H*(aq) + SO42 (aq) + 2e → PbSO4(s) + 2H2O(1); E° = 1.69 V In the lead battery during the discharge reaction: A) PbSO4 is the cathode. B) PbSO4 is the anode. C) Pb is the anode. D) PbO, is the anode. E) H2SO4 is the cathode.
ch.19
answer each of them please
Part A What mass of lead sulfate is formed in a lead-acid storage battery when 1.12 g of Pb undergoes oxidation? IVO AQ ? Submit Request Answer Part A What mass of aluminum metal can be produced per hour in the electrolysis of a molten aluminum salt by a current of 29 A? Express your answer using two significant figures. VO AXO ? mo 8 Submit Request Answer Copper can be electroplated at the...
The standard half-cell reactions of lead acid battery is: 2) Half-cell reduction reaction form: red 1.69 +4Ht +so +2ePbSO4,()+2H2O) РЬОог.0) Red (aq) -Ox. PbSO4.()+2e Pb)+SO -0.36 4.(aq) Pb()+PbO2.(s)+2H2SO4.(ag) Tot. 2PBSO4.()+ 2H20() 2.05 a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery. I b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference potential?
The standard half-cell reactions of lead acid battery is: 2) ЕФN Half-cell reduction reaction form: red PbOo2.(s) 4H+ + so2 4, (aq) PbSO4,()+2H20 Red 2e 1.69 Рo) + So?- 4.(aq) -Ox -0.36 Pbs04.(s)2e Pb()PbO2,(s)+ 2H2SO4,(ag) 2P6SO4.(6) +2H20D 2.05 Tot. a) Determine the full cell reaction of lead acid batter and the total cell potential when discharging the battery b) The half-cell potentials are given according to a reference potential. Describe this reference potential. What is the point of a reference...
Problem 2 (chapter 18.3, 2 points): The lead-acid battery is commonly used in cars. One electrode is a lead grid filled with spongy lead Pb(s). The other electrode is a lead grid filled with spongy lead oxide PbO2(s). The net reaction that occurs is: Pb(s)+PbO (s+2H(aq) 2HSO (aq) ->2PbSO4(s2H 0(0) a) Write down the half reactions that occur at each electrode. b) Identify the oxidation state of Pb in each of the species: Pb(s), PbO2(s) and PbSO4(s). Explain. c) Identify...
The spontaneous galvanic cell of a lead storage battery (a typical car battery) is composed of the following reduction half reactions reduced 1.69 v Pb02 (s)+ HSO, (aq)+3 Ha0 (aq) + 2 e Pbs04 (s)+5 H20) PbSO4 (s) + H3O (aq) 2 e Pb (s)+HSO (aq)+ H20 (I) E reduced 0.36 V How much current (in A) does a cell phone charger for your car use if your car dies after 14 hours of leaving the phone plugged in without...
Most questions answered within 3 hours.
-
4. what is group think? does group think bring positive or
negative result? please justify your...
asked 4 minutes ago -
describe conditions and outcomes of boiling
pasteurization and surfacing. which of these treatment can be
considered...
asked 11 minutes ago -
Who is responsible for the protection of information assets of
an organization? What are the four...
asked 6 minutes ago -
A point charge with charge q1 = 4.00 μC is held stationary at
the origin. A...
asked 9 minutes ago -
In a poll of 504 human resource professionals, 46.4% said that
body piercings and tattoos were...
asked 11 minutes ago -
AdrenalineAdrenaline
Sports Company makes snowboards, downhill skis, cross-country
skis, skateboards, surfboards, and in-line skates. The company...
asked 14 minutes ago -
Compare the Forfaiting and Factoring forms of export
financing
asked 17 minutes ago -
Europe in the 19th century was not dominated by:
a. the scientific quest
b. economic collectivism...
asked 25 minutes ago -
"The economic theory suggests that consumers will not shop at or
spend their money with a...
asked 30 minutes ago -
In your opinion, which provides the most benefit to an
organization, a budget or the budgeting...
asked 40 minutes ago -
What features are centralized in your web application by master
pages? How are master pages implemented...
asked 37 minutes ago -
Write the expression for the molecular wavefunction of (i) a
s-pz sigma bond and (ii) a...
asked 45 minutes ago