Homework Answers
2} these two are different terms as
For example if burette is filled upto 50ml and let after titration it's reading comes to 40 ml
Here 50 and 40 are burette reading.
But volume used here is 50-40=10ml ✅
3} KHP is potassium hydrogen phthalate
And molecular mass is 204. 22 g/mol
Add Answer to:
2-9
2. When performing a titration, what is the difference between "buret reading and "volume used?...
need help with question 2 1. In Part C of this lab, which of the following...
need help with question 2
1. In Part C of this lab, which of the following pieces of glassware is used to accurately deliver 10.00 ml of acetic acid into your Erlenmeyer flask? O a. Volumetric pipet. b. Disposable pipet. c. Graduated cylinder. 2. What is the purpose of a titration thief? a. To hold a few milliliters of the analyte in case you overshoot the endpoint. b. To hold a few milliliters of the titrant in case you overshoot...
Question 1 and 3 thanks EXP #9: POST-LAB 1. Draw the shape ofa titration curve of...
Question 1 and 3 thanks
EXP #9: POST-LAB 1. Draw the shape ofa titration curve of diprotic base as a strong acid is added to it. 2. If you were to plot the electrical conductivity of HCl as NAOH is added, what would a plot of electrical conductivity vs. volume NaOH look like? (Hint: Write the net ionic equation): 3. Research and explain the difference between the equivalence point of a titration and its endpoint.
Questions 1). HCl is described as being a MONOPROTIC acid. What does that mean? 2) If...
Questions 1). HCl is described as being a MONOPROTIC acid. What does that mean? 2) If a group forgot to add the phenolphthalein, how would they know when the acid was neutralized? 3) Explain the difference between the terms endpoint and equivalence point? Endpoint is the point at which the indicator changes its colour, on the other hand equivalence point is the point at which n 4) If we placed the Erlenmeyer flask over a Bunsen bumer and evaporated the...
Equivalence Point for Titration #1: 24.96 mL Equivalence Point for Titration #2: 25.40 mL Equivalence Point...
Equivalence Point for Titration #1: 24.96
mL
Equivalence Point for Titration #2: 25.40
mL
Equivalence Point for Titration #3: 25.20
mL
Midpoint pH for Titration #3: 9.80
QUESTIONS:
4) Set up the calculation required to determine
the concentration of the NaOH solution via titration of a given
amount of KHP. Include all numbers except the given mass of
KHP.
5) Set up the calculation required to determine
the concentration of the unknown strong acid via titration with a
known volume...
1. In titrations, what is the difference between the equivalence point and the endpoint? 2. In...
1. In titrations, what is the difference between the equivalence point and the endpoint? 2. In a titration reaction, 45.6 mL of 0.047 N NaOH was needed to neutralize 30.1 mL of H,SO4. Calculate the following measures of concentration. a. The normality of the acid solution b. The molarity of the acid solution
I need it right now, please help me?? PROCEDURE PART I: DILUTING THE VINEGAR SOLUTION The...
I
need it right now, please help me??
PROCEDURE PART I: DILUTING THE VINEGAR SOLUTION The vinegar solution must be diluted by a factor of 5 to be suitable for titration. 1. Obtain - 20 ml of the stock vinegar solution from the fume hood. 2. Using the 10-ml. pipet, pipet" 10 mL of the stock solution to a 50-ml volumetric flask. 3. Fill the volumetric flask to the calibration line with distilled water. Be sure not to go over...
1. What is the definition of an 'equivalence point' in an acid/base titration? (1 point) 2....
1. What is the definition of an 'equivalence point' in an acid/base titration? (1 point) 2. In part one of the experiment, you will prepare the acid solutions being titrated from a stock solution. Describe how you will accurately prepare 10.00 mL of 0.100 M HCl solution using a 1.00 M HCl stock solution. In your response to this question, be very specific about the quantities of stock solution and deionized water to be used in the dilution and the...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial 4 2.60/1.20 1...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial 4 2.60/1.20 11.40/1.30 28.20 29.10.26.1026.50 Initial buret reading Final buret reading Volume of NaOH added Moles of NaOH added Moles of HCl reacted Molarity of diluted HCI Molarity of undiluted HCI Average molarity of undiluted HCI Precision PROCEDURE 1. Obtain approximately 40 mL of an unknown acid in an Erlenmeyer flask from your teaching assistant. 2. Clean your 250-ml volumetric flask (contains exactly 250.00...
It's a weak acid strong base titration Experiment 4: Identification of an unknown acid by titration...
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial 4 2.60/1.20 1.40/1.30 28.20 29.10.26.1026.50 Volume of NaOH added Initial buret reading Final buret reading Moles of NaOH added Moles of HCl reacted Molarity of diluted HCI Molarity of undiluted HCI Average molarity of undiluted HCI Precision PROCEDURE 1. Obtain approximately 40 mL of an unknown acid in an Erlenmeyer flask from your teaching assistant. 2. Clean your 250-ml volumetric flask (contains exactly 250.00...
need help with question 2
1. In Part C of this lab, which of the following pieces of glassware is used to accurately deliver 10.00 ml of acetic acid into your Erlenmeyer flask? O a. Volumetric pipet. b. Disposable pipet. c. Graduated cylinder. 2. What is the purpose of a titration thief? a. To hold a few milliliters of the analyte in case you overshoot the endpoint. b. To hold a few milliliters of the titrant in case you overshoot...
Question 1 and 3 thanks
EXP #9: POST-LAB 1. Draw the shape ofa titration curve of diprotic base as a strong acid is added to it. 2. If you were to plot the electrical conductivity of HCl as NAOH is added, what would a plot of electrical conductivity vs. volume NaOH look like? (Hint: Write the net ionic equation): 3. Research and explain the difference between the equivalence point of a titration and its endpoint.
Questions 1). HCl is described as being a MONOPROTIC acid. What does that mean? 2) If a group forgot to add the phenolphthalein, how would they know when the acid was neutralized? 3) Explain the difference between the terms endpoint and equivalence point? Endpoint is the point at which the indicator changes its colour, on the other hand equivalence point is the point at which n 4) If we placed the Erlenmeyer flask over a Bunsen bumer and evaporated the...
Equivalence Point for Titration #1: 24.96
mL
Equivalence Point for Titration #2: 25.40
mL
Equivalence Point for Titration #3: 25.20
mL
Midpoint pH for Titration #3: 9.80
QUESTIONS:
4) Set up the calculation required to determine
the concentration of the NaOH solution via titration of a given
amount of KHP. Include all numbers except the given mass of
KHP.
5) Set up the calculation required to determine
the concentration of the unknown strong acid via titration with a
known volume...
1. In titrations, what is the difference between the equivalence point and the endpoint? 2. In a titration reaction, 45.6 mL of 0.047 N NaOH was needed to neutralize 30.1 mL of H,SO4. Calculate the following measures of concentration. a. The normality of the acid solution b. The molarity of the acid solution
I
need it right now, please help me??
PROCEDURE PART I: DILUTING THE VINEGAR SOLUTION The vinegar solution must be diluted by a factor of 5 to be suitable for titration. 1. Obtain - 20 ml of the stock vinegar solution from the fume hood. 2. Using the 10-ml. pipet, pipet" 10 mL of the stock solution to a 50-ml volumetric flask. 3. Fill the volumetric flask to the calibration line with distilled water. Be sure not to go over...
1. What is the definition of an 'equivalence point' in an acid/base titration? (1 point) 2. In part one of the experiment, you will prepare the acid solutions being titrated from a stock solution. Describe how you will accurately prepare 10.00 mL of 0.100 M HCl solution using a 1.00 M HCl stock solution. In your response to this question, be very specific about the quantities of stock solution and deionized water to be used in the dilution and the...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial 4 2.60/1.20 11.40/1.30 28.20 29.10.26.1026.50 Initial buret reading Final buret reading Volume of NaOH added Moles of NaOH added Moles of HCl reacted Molarity of diluted HCI Molarity of undiluted HCI Average molarity of undiluted HCI Precision PROCEDURE 1. Obtain approximately 40 mL of an unknown acid in an Erlenmeyer flask from your teaching assistant. 2. Clean your 250-ml volumetric flask (contains exactly 250.00...
It's a weak acid strong base titration
Experiment 4: Identification of an unknown acid by titration Page 2 of 15 Background In this experiment, you will use both qualitative and quantitative properties to determine an unknown acid's identity and concentration. To do this analysis, you will perform a titration of your unknown acid sample-specifically a potentiometric titration where you use a pH meter and record pH values during the titration, combined with a visual titration using a color indi- cator...
Concentration of NaOH = 1600 x10- Molar Sodium hydroxide Nach Trial 1 Trial 2 Trial Trial 4 2.60/1.20 1.40/1.30 28.20 29.10.26.1026.50 Volume of NaOH added Initial buret reading Final buret reading Moles of NaOH added Moles of HCl reacted Molarity of diluted HCI Molarity of undiluted HCI Average molarity of undiluted HCI Precision PROCEDURE 1. Obtain approximately 40 mL of an unknown acid in an Erlenmeyer flask from your teaching assistant. 2. Clean your 250-ml volumetric flask (contains exactly 250.00...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 29 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago