Homework Answers
Q. No. 1. Answer :
Media influences the positively and negatively on our individual beliefs and cultural norms.
Positively means it increases the connection between the people by sharing their cultural norms and individual beliefs.
People can share their opinions and pictures in the way of media.
Negatively like the people who don't have interest and if they don't like that opinions they may avoid the media and some quarrels may occurs.
Q. No. 4. Answer :
Objectification : it is a act of treating some person or some times animals as an object or a thing.
In advertising a person is treating like as a object with regard their personality and dignity.
So that they will get population regarding such type of objects.
Q. No. 10. Answer :
Yes, I think media corporations use stereotypes to sell their products.
Because, they will advertise the shapes of culture and create norms and they create like the products are desirable and essential to the people, so that the improvement in the selling of products may taken place .
So the media use the stereotypes to sell their products.
Q. No. 11. Answer :
Yes, government should creates more rules for media companies, because with having rules and norms from the government the media will show what ever the matter or advertisement wants to give and there is no limitations, so it may leads to so many complications to the all.
So the government creates some rules to media.
Add Answer to:
29 Miss Representation Questions (Please type your responses to SIX of the following questions): 1. How...
l TOul Doys/nell and the way represented they are in the media? 9. Who benefits/profits from...
l TOul Doys/nell and the way represented they are in the media? 9. Who benefits/profits from the way women are represented in the media? Who loses? 10. Why do you think media corporations use stereotypes to sell their products? 11. Do you think the government should create more rules for media companies? Why or why not? 12. How can you change the way media does business? Miss Representation Questions (Please type your responses to SIX of the following questions): 1....
Miss Representation Questions (Please type your responses to SIX of the following questions): 1. How does...
Miss Representation Questions (Please type your responses to SIX of the following questions): 1. How does the media influence our individual beliefs and our culture norms? 2. How does what we see shape our beliefs about ourselves and about others? 3. How do we overcome the media's negative messaging?
2. How does what we see shape our beliefs about ourselves and about others? 3. How...
2. How does what we see shape our beliefs about ourselves and about others? 3. How do we overcome the media's negative messaging?
1.In your own words, describe the relationship between mental illness and drug use/abuse? How is this...
1.In your own words, describe the relationship between mental illness and drug use/abuse? How is this relationship important? 2. Considering Big Pharma spends approximately $80 billion annually on advertising in our society: describe if do you think pharmaceutical manipulation exists? Why or why not? Cite an example 3. Many patients who have been receiving these medications (over a number of years) insists that it does more harm than good? Based on this documentary, societal influence, etc do you agree/disagree? Why...
Please help!! Cultural messages, simply, are what everyone in a group knows that outsiders do not...
Please help!!
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description: Culture is an essential part of...
Cuban and american culture, please and thank you! Cultural messages, simply, are what everyone in a...
Cuban and american culture, please and thank you!
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description:...
1. How did Solomon Asch’s study illustrate the power of norms to shape behavior? Provide at...
1. How did Solomon Asch’s study illustrate the power of norms to shape behavior? Provide at least one other example of the power of norms to shape behavior. 2. Prior to our class on conformity, I emailed about half the students in our class and asked them to agree to take off their shoes when they entered class the next day, in the hopes that other students would conform. Discuss why very few people conformed, using concepts from variations...
Case Study Fun-Spot Fun Park began as a small amusement park in 1985
Case Study Fun-Spot Fun Park began as a small amusement park in 1985. With nothing more than a merry-go-round, a slide, pony rides, and an ice cream stand, Fun-Spot grew into a popular family attraction with 20 rides, a restaurant, and an outdoor performing arts theater. “My wife, Gail, and I didn’t know what we were getting into,” commented Ron Hart, the owner. “We just knew that weekenders coming to the lakes in our rural area represented an untapped market.”...
Cuban culture and american culture Cultural messages, simply, are what everyone in a group knows that...
Cuban culture and american culture
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description: Culture is an...
1. Give a short answer to the following questions. Please keep your reasoning to the point....
1. Give a short answer to the following questions. Please keep your reasoning to the point. (a) You put two identical glasses of water on a scale, both filled to the brim, but one with a piece of wood floating in it. Which one is heavier? (b) A particular cat likes to sleep on window sills. Today it falls from a particularly high one, finding itself in a perilous configuration with its legs upside down. By twisting its body in...
l TOul Doys/nell and the way represented they are in the media? 9. Who benefits/profits from the way women are represented in the media? Who loses? 10. Why do you think media corporations use stereotypes to sell their products? 11. Do you think the government should create more rules for media companies? Why or why not? 12. How can you change the way media does business? Miss Representation Questions (Please type your responses to SIX of the following questions): 1....
Miss Representation Questions (Please type your responses to SIX of the following questions): 1. How does the media influence our individual beliefs and our culture norms? 2. How does what we see shape our beliefs about ourselves and about others? 3. How do we overcome the media's negative messaging?
2. How does what we see shape our beliefs about ourselves and about others? 3. How do we overcome the media's negative messaging?
1.In your own words, describe the relationship between mental illness and drug use/abuse? How is this relationship important? 2. Considering Big Pharma spends approximately $80 billion annually on advertising in our society: describe if do you think pharmaceutical manipulation exists? Why or why not? Cite an example 3. Many patients who have been receiving these medications (over a number of years) insists that it does more harm than good? Based on this documentary, societal influence, etc do you agree/disagree? Why...
Please help!!
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description: Culture is an essential part of...
Cuban and american culture, please and thank you!
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description:...
Cuban culture and american culture
Cultural messages, simply, are what everyone in a group knows that outsiders do not know. They are a series of lenses that shape our perceptions, interpretations, boundaries, and values. Users: Anyone involved in a cross-cultural conflict. This includes not only people from different countries, but also people from different gender, age, ethnic, religious, regional, even different professional groups. (One might speak of the engineering culture or the business culture, for example.) Description: Culture is an...
1. Give a short answer to the following questions. Please keep your reasoning to the point. (a) You put two identical glasses of water on a scale, both filled to the brim, but one with a piece of wood floating in it. Which one is heavier? (b) A particular cat likes to sleep on window sills. Today it falls from a particularly high one, finding itself in a perilous configuration with its legs upside down. By twisting its body in...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago