Homework Answers
23. Option d. M. The compound is 2-propanol will
produce acetone (ketone) if oxidized.
24. Option e. both c and d. Both the structures have carbon carbon double bond. structure X is cyclic and Y is aliphatic but they are unsaturated.
25. Option e. The structure of W is 3-ethyl 4-methyl heptane, X is 3-ethyl 4-methyl 1-cyclobutene. Y is 3-ethyl 4-methyl 2-hexene. Please find the attached image for detailed numbering according to IUPAC.
26. Option d. Urea, Isopropyl alcohol, m-xylene.
27. Option b and c. both the option have 3 name of polymer as correct. option b have 1st three polymer name correct but last name should be nylon 66 or nylon. in option c 2nd polymer name is wrong as the polymer is poly vinyl chloride others are correct.
28. option c. But there is some mistake in name it is though best accurate than others set of names. Find in attached image.
Add Answer to:
LES BELOW FOR QUESTIONS 23-28. CH3 F. CH2-CH2-C J. СН 3-C-OH H. NH2-C-NH2 G. CH3-CH2 9...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH 20 CH3-CH2-CH-CH CH,CH,COOH Ovo 17. What is the product of oxidation of butanal? 1-butanol D butanoic acid C. 2-butanol d. 2-butanal e. dibutylether 18). O CE, H-C-O - CHCH, is called: methyl isopropyl ester methyl isopropyl ether methylethyl ethanoate isopropyl formate 19. Reaction of CH3-CH-CH2-COOH with CH-CH,OH produces: a. butyl ethanoate ethyl butanoate ethyl propanoate d. propyl butanoate acetyl butanoate
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH...
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3...
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3 A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene 2. Name the following compound. CH-CH2 CH,CH CH CCH H-CH A) 2,2-diethylpenatane B) 2,2-diethylpentene C) 4-ethyl-4-methyl-5-hexene D) 3-ethyl-3-methyl-1-hexene E) 4-ethyl-4-methylhexane 3. Name the following compound. CH CH CH, CH,CH CC CH CH2CH CH A) 3-butyl-3-propyl-1-pentyne B) 3-butyl-3-propyl-4-pentyne C) 3-ethyl-3-propyl-1-heptyne D) 5-ethyl-5-propyl-6-heptyne E) 3-ethyl-3-butyl-1-hexyne
Question 33 33) What is the IUPAC name for the following compound? CH3 CH-CH2-CH=C-CH3 A) 3-methyl-4-pentene...
Question 33 33) What is the IUPAC name for the following compound? CH3 CH-CH2-CH=C-CH3 A) 3-methyl-4-pentene B) 2-methyl-3-pentene C) hexene D) 2-methyl-2-pentene E) 4-methyl-3-pentene A B с 3 11 7월 5 30 Ах P TA MacBook Pro
what is the carboxylic acid ? CH, CH, -CH-CH-c-OH CH, --CH2-CH, Select the correct answer below:...
what is the carboxylic acid ?
CH, CH, -CH-CH-c-OH CH, --CH2-CH, Select the correct answer below: 0 3-propyl-2-methyl butanoic acid 0 2,3-dimethyl butanoic acid O 2-ethyl-3-methyl butanoic acid 2-propyl-3-methyl butanold acid
26) Name the following compound. CH3 H2C=CH-CH2CHCH: A) 1,1-dimethyl-3-butane B) 4-methyl-1-pentene C) hexene D) 2-methyl-4-pentene E)...
26) Name the following compound. CH3 H2C=CH-CH2CHCH: A) 1,1-dimethyl-3-butane B) 4-methyl-1-pentene C) hexene D) 2-methyl-4-pentene E) 2-methylpentene 27) Name the following compound. CI A) 2,3,5-trichlorobenzene B) trichlorostyrene C) 1,3,4-trichlorobenzene D) 1,3,4-trichlorohexene E) 1,2,4-trichlorobenzene 28) Identify the formula for an alkene. A) CnH2n+4 B) CnH2n+2 C) CnH2n D) CnH2n-4 E) CnH2n-2 29) Name the following compound. A) 1,4-bromocyclohexene B) 1,4-dibromobenzene C) 3,6-dibromobenzene D) 2,5-dibromobenzene E) 2,5-dibromocyclohexene 30) Name the following compound. CECH CH,CH,CHCH A) 2-ethynebutane B) 3-methyl-1-pentyne C) 3-methyl-4-pentyne D) 3-ethyl-1-butyne...
28) The Common name of the following acid: CH3 CH₂ CH CH2-C-OH ? CH3 a. 3....
28) The Common name of the following acid: CH3 CH₂ CH CH2-C-OH ? CH3 a. 3. Methyl pentanoic acid b. B-Methyl Pentonoic acid c. 3.Methyl Propanoic acid d.o-Methyl ppentanoic acid e.a-Methyl pentanoic acid
8. How many chiral carbons are present for the following molecule? CH3 HO–CH2-CH2-C-CH=CH-CH3 NH2 a. 4...
8. How many chiral carbons are present for the following molecule? CH3 HO–CH2-CH2-C-CH=CH-CH3 NH2 a. 4 b. 3 c. 2 d. 1 e. none
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T CH2 2. ? CH2 he N(CH3)2 O2N HaC CH3 Phosgen...
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T CH2 2. ? CH2 he N(CH3)2 O2N HaC CH3 Phosgene, ? (Review a 3. O-CC2 2 CO2H PY ? HaC 4. Нас OH +CH3 NH2 ? H + excess CH30H ? 6. CH(CH2)16 heat b-(CH2)1CH3 heat ? 7. CaHs-C O-CH2 + NH2-OH hydrorylarnine O-
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T...
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpent...
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpentanoatef) butyl 3-hydroxyheptanoate 15. Name the following esters CH CH3 H3 C) CH3 b) CH2 CH O-C--CH3 CH3 f CH2 d)
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d)...
Which of the following has the lowest boiling point? | CHG-CH2-CHO - || . CH3-CH2-CH, CH-CH2-CH2-OH 20 CH3-CH2-CH-CH CH,CH,COOH Ovo 17. What is the product of oxidation of butanal? 1-butanol D butanoic acid C. 2-butanol d. 2-butanal e. dibutylether 18). O CE, H-C-O - CHCH, is called: methyl isopropyl ester methyl isopropyl ether methylethyl ethanoate isopropyl formate 19. Reaction of CH3-CH-CH2-COOH with CH-CH,OH produces: a. butyl ethanoate ethyl butanoate ethyl propanoate d. propyl butanoate acetyl butanoate
1. Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
CH3C(CH3)CH2
CH2O
CH3CH(NH2)CH3
CH3OCH2CH2CH3
CH(CH3)2COOH
For the list above I currently put the following as the IUPAC
names. If any are wrong can you please correct them!
Give systematic IUPAC names for each of the following:
CH3CH2C(CH3)2CH(CH2CH3)CH3
IUPAC Name: 3,3,4-trimethylhexane
IUPAC Name:
3-methyl-4-ol-heptane
CH3C(CH3)CH2 IUPAC Name:
2-methylpropene
CH2O IUPAC Name: methanal
CH3CH(NH2)CH3 IUPAC Name:
isopropylamine
CH3OCH2CH2CH3 IUPAC
Name: methoxyethane (ethyl methyl ether)
CH(CH3)2COOH IUPAC Name:
2-methylpropanoic acid
1. What is the IUPAC name for the following compound? CH3 CI CH3-CH-C- CH-CH CH3 CH3 A) 4-chloro-4,5-dimethyl-2-hexene B) 3-chloro-1,3,4-trimethyl-1-pentene C) 3-chloro-2,3-dimethyl-4-hexene D) 3-chloro-2,3,5-trimethyl-4-pentene E) 3-chloro-1,3,4,4-tetramethyl-1-butene 2. Name the following compound. CH-CH2 CH,CH CH CCH H-CH A) 2,2-diethylpenatane B) 2,2-diethylpentene C) 4-ethyl-4-methyl-5-hexene D) 3-ethyl-3-methyl-1-hexene E) 4-ethyl-4-methylhexane 3. Name the following compound. CH CH CH, CH,CH CC CH CH2CH CH A) 3-butyl-3-propyl-1-pentyne B) 3-butyl-3-propyl-4-pentyne C) 3-ethyl-3-propyl-1-heptyne D) 5-ethyl-5-propyl-6-heptyne E) 3-ethyl-3-butyl-1-hexyne
Question 33 33) What is the IUPAC name for the following compound? CH3 CH-CH2-CH=C-CH3 A) 3-methyl-4-pentene B) 2-methyl-3-pentene C) hexene D) 2-methyl-2-pentene E) 4-methyl-3-pentene A B с 3 11 7월 5 30 Ах P TA MacBook Pro
what is the carboxylic acid ?
CH, CH, -CH-CH-c-OH CH, --CH2-CH, Select the correct answer below: 0 3-propyl-2-methyl butanoic acid 0 2,3-dimethyl butanoic acid O 2-ethyl-3-methyl butanoic acid 2-propyl-3-methyl butanold acid
26) Name the following compound. CH3 H2C=CH-CH2CHCH: A) 1,1-dimethyl-3-butane B) 4-methyl-1-pentene C) hexene D) 2-methyl-4-pentene E) 2-methylpentene 27) Name the following compound. CI A) 2,3,5-trichlorobenzene B) trichlorostyrene C) 1,3,4-trichlorobenzene D) 1,3,4-trichlorohexene E) 1,2,4-trichlorobenzene 28) Identify the formula for an alkene. A) CnH2n+4 B) CnH2n+2 C) CnH2n D) CnH2n-4 E) CnH2n-2 29) Name the following compound. A) 1,4-bromocyclohexene B) 1,4-dibromobenzene C) 3,6-dibromobenzene D) 2,5-dibromobenzene E) 2,5-dibromocyclohexene 30) Name the following compound. CECH CH,CH,CHCH A) 2-ethynebutane B) 3-methyl-1-pentyne C) 3-methyl-4-pentyne D) 3-ethyl-1-butyne...
28) The Common name of the following acid: CH3 CH₂ CH CH2-C-OH ? CH3 a. 3. Methyl pentanoic acid b. B-Methyl Pentonoic acid c. 3.Methyl Propanoic acid d.o-Methyl ppentanoic acid e.a-Methyl pentanoic acid
8. How many chiral carbons are present for the following molecule? CH3 HO–CH2-CH2-C-CH=CH-CH3 NH2 a. 4 b. 3 c. 2 d. 1 e. none
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T CH2 2. ? CH2 he N(CH3)2 O2N HaC CH3 Phosgene, ? (Review a 3. O-CC2 2 CO2H PY ? HaC 4. Нас OH +CH3 NH2 ? H + excess CH30H ? 6. CH(CH2)16 heat b-(CH2)1CH3 heat ? 7. CaHs-C O-CH2 + NH2-OH hydrorylarnine O-
Practice Set-lll CH3 o 1. H3c-C- CHa a HaC, CH3 PY ? H-C-N H Нас + OH T...
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d) methyl 4-phenylpentanoatef) butyl 3-hydroxyheptanoate 15. Name the following esters CH CH3 H3 C) CH3 b) CH2 CH O-C--CH3 CH3 f CH2 d)
CH3 но cCH2 CH2 H3C H3C-HC CH 2 CH3 CH-C он 14. Draw the following esters a) ethyl butanoate b) pentyl propanoate e) 2,3-dimethylpentyl ethanoate c) propyl 3-ethylhexanoate d)...
Most questions answered within 3 hours.
-
LABORATORY EXERCISES:
Using nested for loops, write a java program to print the
pattern as shown...
asked 46 seconds ago -
a) The frequency of light coming out from a laser source is 297
MHz. What is...
asked 53 seconds ago -
Assume that the correlation coefficient between achievement test
scores (X) and grade point averages (Y) among...
asked 13 minutes ago -
In Chapter 1 titled "So Close and Yet So Different", in "Why
Nations Fail" authors bring...
asked 10 minutes ago -
Leadership Philosophy
Write a two-page paper identifying your personal leadership
philosophy based on your new perspective...
asked 7 minutes ago -
Which of these function correctly defines the function g(),
which should return a pointer to a...
asked 16 minutes ago -
Pickett Industries just paid a dividend of D0 = $1.10. Analysts
expect the company's dividend to...
asked 16 minutes ago -
Suppose a random sample of 900 measurements is taken from an
unknown population. The average of...
asked 19 minutes ago -
Suppose we add another SRC instruction xor ra, rb, rc that xors
the contents of registers...
asked 20 minutes ago -
Hello, I need some help creating this class in Java. This is for
a larger project....
asked 41 minutes ago -
Why does entrepreneurs trying to employ AI into their
business organizations? What are the advantages and...
asked 39 minutes ago -
// This program is supposed to display every fifth year
// starting with 2017; that is,...
asked 41 minutes ago