We need at least 10 more requests to produce the answer.
0 / 10 have requested this problem solution
The more requests, the faster the answer.
Part A For the question that follow, identify the class of lipid to which each of...
Question 3 5 pts Identify the class of lipid to which the following molecule belongs. CH2-0-C-(CH)6- (CH2-CH=CH2-CH2) -CH, CH-0-C-(CH2),CH=CH-(CH2)7 – CH3 CH2 –0-C-(CH), –(CH2 -CH=CH), –CH2 –CH; phospholipid fatty acid wax triglyceride Identify the class of lipid to which the following molecule belongs.. CH2 -0-C-(CH2) 16CH; CH-0-C-(CH)-CH=CH(CH2)-CH, O = CH,-o-P-0-(CH)-N(CH) triglyceride fatty acid wax phospholipid We were unable to transcribe this imageQuestion 13 5 pts A saturated fatty acid is a fatty acid chain in which a carbon chain has...
Identify the components of each lipid and classify it as a triacylglycerol, a phosphoacylglycerol, or a sphingomyelin. Classify any phosphoacylglycerol as a cephalin or lecithin. 1. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative) 2. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative) 3. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative) Lipid: OPTIONS (sphingomyelin) (phosphoacylglycerol, cephalin) (phosphoacylglycerol, lecithin) (triacylglycerol) 1. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative) 2. OPTIONS (ester) (amide) (phosphate) (choline derivative) (ethanolamine derivative) 3. OPTIONS...
Identifying functional groups in each of the following molecules really need help with this question!! it's identifying functional groups, the picture of the question is linked here: Be sure to answer all parts. Identify and classify the functional group in each of the following molecules (select) (а) сн,CHCСH ketone (b) -о—снз Нас C (select) (c) CH2CH2NH2 CH3 (select) (d) н,с —сн, C (select) (e) CH,CH,осн,сH, он (select) CH CH Н.с (select) (g) CHCOH (select) (h) CH CH CH=CH2 (select) Н.с...
Identify the class of lipid of the following molecule: CH3-(CH2)18-C-O-(CH2)19-CH3
Add hydrogen atoms to each of the hydrocarbons and identify the class of molecule to which each belongs. Add hydrogen atoms to the first hydrocarbon.
For rach of the below compounds, identify to which compound class the compound belongs. We were unable to transcribe this imageCH₃ НАС
im not sire if i selescted the right answer or not 0:45:00 Time Left:0:37:42 Logan Oliver: Attempt 1 Question 1 (10 points) Saved Identify the class of lipids to which the following molecule belongs. OH CH3CH2CH=CH-C-H R-C-HN-C-H 8 0 CH0-B-O-CH2CH.N(CH) O triacylglycerol bile salt simple lipid sphingolipid Oprostaglandin
Hint L& Give Up? Resources Identify the type of lipid in each compound. Glycerophospholipids are a class of phospholipids. CHCOOH CH(CH22CH3 Н,С(CH5 HHHH HHH HI H c- c-C-C-C-C -C-C-C-C- H-Co HH H HHH H. н H H HHHH HHH H c-c-c c-c-c-H H C-O H H HHH HH H. H H H on c-c-c-C 1 H H H-C-D СООН HO сн, DELL
3. For each compound below, state the specific class of biomolecules to which it belongs. (For example, glucocerebroside is more specific than sphingolipid, which is more specific than lipid.) (16 pts - 2 ea.) b) HO SO e) ^ f) Ho -OH OM 애
7. A lipid class which contains no fatty acids is called 8. When phosphatidylcholine (lecithin) is sonicated in water it forms 9. Membrane fluidity may be regulated by the degree of unsaturation or by the presence of which molecule? 10. A protein which embeds part way into a membrane, but does not go all the way through would be classed as an) membrane protein. 11. Prostaglandin synthase converts which molecule into prostaglandin H,? 12. Movement of a lipid molecule from...