Explain the significance of telomerase expression in cancer cells
Explain the significance of telomerase expression in cancer cells
Homework Answers
Telomerase is know for the sequence that gets repeated at every end of the eukaryotic chromosomes that in most of the eukaryotic.
this expression of telomerase is that acts as that which is used to arrest the increase in cancer growth and it attains senescence and that cease to divide. Due to this affect is a potent anti cancer mechanism.
this mechanism is the one which gives the possibility in cure cancer as it arrest the spreading of cancer throughout the body.
Cancer Biology 8. Re-expression of telomerase can confer immortality to emerging clones of tumor cells, and...
Cancer Biology
8. Re-expression of telomerase can confer immortality to emerging clones of tumor cells, and was originally viewed as an attractive target for drug discovery. However, which of the following best explains the lack of therapeutic efficacy for telomerase inhibitors? a. Telomerase alone is sufficient for transformation in human cells. b. Telomerase is required for the maintenance of somatic cell populations. c. Too many post-inhibition cell doublings would be required to see anti-tumor efficacy. d. Telomerase has sequence and...
90% of cancer cells have active telomerase enzymes. How does this play a role in cancer...
90% of cancer cells have active telomerase enzymes. How does this play a role in cancer and how they divide fast.
Activation of the telomerase gene is an indicator of cancer progression. How does the telomerase gene...
Activation of the telomerase gene is an indicator of cancer progression. How does the telomerase gene assist in granting cancer cells 'immortality'?
what does telomerase enable cancer cells to do the normal adult somatic cells cannot do?
what does telomerase enable cancer cells to do the normal adult somatic cells cannot do?
What allows cancer cells to divide an infinite number of times? Telomerase genes become active in...
What allows cancer cells to divide an infinite number of times? Telomerase genes become active in cancer cells The ends of the chromosomes become resistant to degradation in cancer cells Cancer cells contain special DNA repair genes not found in healthy cells Cancer cells lack signal transduction pathways
If a patient has an abnormality in telomerase activity, how might this contribute to cancer?
If a patient has an abnormality in telomerase activity, how might this contribute to cancer?
What significance does Precision Medicine have on personalizing cancer treatments for cancer patients? Explain
What significance does Precision Medicine have on personalizing cancer treatments for cancer patients? Explain
Why might inhibition of LDH in cancer cells lead to cancer cell death? Explain why conjugating...
Why might inhibition of LDH in cancer cells lead to cancer cell death? Explain why conjugating an LDH inhibitor to glucose leads to preferential targeting of cancer cells?
What would be a likely result of a mutation that disrupts telomerase function? Cancer Shortening of...
What would be a likely result of a mutation that disrupts telomerase function? Cancer Shortening of chromosomes Lower rates of replication Immortality of gametes Early termination of replication
Some people believe that telomerase could be the “fountain of youth”. Telomerase is not active in...
Some people believe that telomerase could be the “fountain of youth”. Telomerase is not active in all cells. What happens when telomerase is absent? Based on this, how could telomerase relate to aging?
Cancer Biology
8. Re-expression of telomerase can confer immortality to emerging clones of tumor cells, and was originally viewed as an attractive target for drug discovery. However, which of the following best explains the lack of therapeutic efficacy for telomerase inhibitors? a. Telomerase alone is sufficient for transformation in human cells. b. Telomerase is required for the maintenance of somatic cell populations. c. Too many post-inhibition cell doublings would be required to see anti-tumor efficacy. d. Telomerase has sequence and...
What would be a likely result of a mutation that disrupts telomerase function? Cancer Shortening of chromosomes Lower rates of replication Immortality of gametes Early termination of replication
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 13 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago