Homework Answers
Add Answer to:
9. Tryptophan has only a mild hydrophobic character according to this scale, while it is generally...
1. Which of the following amino acids has the most hydrophobic side chain? a). E b)....
1. Which of the following amino acids has the most hydrophobic side chain? a). E b). F c). S d). W e). Y 2. Which type of non covalent interaction would you expect to be present between Cl- and H2O? a). Ionic interactions ("salt links") b). Hydrogen bonds c). Van der Waals interactions d). Ion-dipole interactions For the first question, I have F and W both being hydrophobic chains but am unsure why or how to tell which one would...
1. Which of the following statements is consistent with the structural motifs in 1OPF? This protein...
1. Which of the following statements is consistent with the
structural motifs in 1OPF?
This protein has tertiary structure, where each subunit is a
large parallel beta barrel.
This protein has quaternary structure, where each subunit is a
large antiparallel beta barrel.
This protein has tertiary structure, where each subunit is a
large antiparallel beta barrel.
This protein has quaternary structure, where each subunit is a
large parallel beta barrel.
3. Given the information in the PDB entry for 1OPF,...
According to Robert Trivers, why are men generally larger and more physically aggressive than women? Because...
According to Robert Trivers, why are men generally larger and more physically aggressive than women? Because women are more reproductively “valuable” than men, hence competition for mates is fiercer among men Because men invest more heavily in reproduction than women Because men secrete more testosterone Trivers’ theory does not speculate on the origin of the sex difference in size and physical aggression Although some women are interested in casual sex (short-term mating), research has suggested that there are differences in...
120Spring%20Exam%201%20(1).pdf 1. Based on the Hornbostel-Sachs classification system, how would each of the following instruments be...
120Spring%20Exam%201%20(1).pdf 1. Based on the Hornbostel-Sachs classification system, how would each of the following instruments be classified and why? (2 points each, for a total of 6 points) A Guitar B Trombone c. A metal cymbal. Fill in the blank. (1 point each blank, for a total of 4 points) 3. One way of showing rhythmic emphasis is (the playing of one note louder than the rest 4. Increasing volume in a gradual manner is called 5. The which is...
Vicky grew up with many pets and has a profound love of animals.
Vicky grew up with many pets and has a profound love of animals. Due to this, she recently declared herself a vegetarian. After investigating the matter a little more, Vicky decides that being a lacto-ovo vegetarian is the best fit because she wants to keep consuming dairy products and eggs. Vicky is a little concerned about getting enough protein and essential amino acids from her diet because she's quite active and plays college volleyball. Do you think that Vicky can...
1. Like phospholipids, lipopolysaccharides have a hydrophilic head and a hydrophobic tail. True or false 2....
1. Like phospholipids, lipopolysaccharides have a hydrophilic head and a hydrophobic tail. True or false 2. The outer membrane of Gram negative bacteria contains lipopolysaccharides T or F 3. Biofilms and pure culture are formed by only one type of microorganism T or F 4. Any given antibiotic will have the same minimum inhibitory concentration (MIC) against any test microorganism. T or F 5. Production of antibiotics by the microorganism is not affected by the culture conditions T or F...
please help me type my introduction for my lab report. thank you!! INTRODUCTION In this section,...
please help me type my
introduction for my lab report. thank you!!
INTRODUCTION In this section, you will introduce the experiment by explaining generally what you did and why you did it. This section usually starts with an examination of the literature through a library search to inform the reader about work already done on this topic. If you have never done a bibliographic database search for scientific journal articles, then you are not yet a biological sciences major (note:...
There are a total of 8 pages. If you click on the first picture, the others...
There are a total of 8 pages. If you click on the first picture,
the others should pop up. Thank you!
ul Bio220 - Diversity of Life HW 2: Phylogenetics First Some Review and Examples... There are several definitions that you will need to be familiar with in order to properly use and understand phylogenetic systematics. - Character: A heritable attribute of an organism. - Plesiomorphy: A primitive or ancestral character. This is a character that was inherited from a...
1) There are four categories of customer benefits in B2B (business-to-business) markets. Which of the following...
1) There are four categories of customer benefits in B2B (business-to-business) markets. Which of the following categories would include the benefits of vendor reputation, scale of operation, or specialized capabilities? Noneconomic, intangible benefits Noneconomic, tangible benefits Economic, intangible benefits Economic, tangible benefits 2) A maker of preservatives for commercial bakery goods hopes to break into the cereal manufacturing market. As the firm pursues first-time orders in this market, its salespeople should focus on which of the following types of buyer...
1. the genes that seem to be the most necessary to maintain, since they are present...
1. the genes that seem to be the most necessary to maintain, since they are present in the smallest cellular organisms are a. cytoskeletal protein genes b, translation protein genes c. replication protein genes d. transcription protein genes e. DNA repair protein genes 2. Why do cellular organisms generally look very similar when early embryos but different from each other when mature? a. their DNAs have different chemistry b. their RNAs are different lengths c. what genes get turned on...
1. Which of the following statements is consistent with the
structural motifs in 1OPF?
This protein has tertiary structure, where each subunit is a
large parallel beta barrel.
This protein has quaternary structure, where each subunit is a
large antiparallel beta barrel.
This protein has tertiary structure, where each subunit is a
large antiparallel beta barrel.
This protein has quaternary structure, where each subunit is a
large parallel beta barrel.
3. Given the information in the PDB entry for 1OPF,...
120Spring%20Exam%201%20(1).pdf 1. Based on the Hornbostel-Sachs classification system, how would each of the following instruments be classified and why? (2 points each, for a total of 6 points) A Guitar B Trombone c. A metal cymbal. Fill in the blank. (1 point each blank, for a total of 4 points) 3. One way of showing rhythmic emphasis is (the playing of one note louder than the rest 4. Increasing volume in a gradual manner is called 5. The which is...
please help me type my
introduction for my lab report. thank you!!
INTRODUCTION In this section, you will introduce the experiment by explaining generally what you did and why you did it. This section usually starts with an examination of the literature through a library search to inform the reader about work already done on this topic. If you have never done a bibliographic database search for scientific journal articles, then you are not yet a biological sciences major (note:...
There are a total of 8 pages. If you click on the first picture,
the others should pop up. Thank you!
ul Bio220 - Diversity of Life HW 2: Phylogenetics First Some Review and Examples... There are several definitions that you will need to be familiar with in order to properly use and understand phylogenetic systematics. - Character: A heritable attribute of an organism. - Plesiomorphy: A primitive or ancestral character. This is a character that was inherited from a...
Most questions answered within 3 hours.
-
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 27 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 1 hour ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 4 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 4 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 4 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 4 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 4 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago -
Write MARIE assembly language programs that do the following:
Write a program that inputs an integer...
asked 5 hours ago