What would be the molecular formula for a polymer made from eight glucose (C6H12O6) molecules linked...
What would be the molecular formula for a polymer made from eight glucose (C6H12O6) molecules linked together by dehydration reactions?
Answer choices:
|
C48H80O40 or C48H82O41 |
||
Homework Answers
Answer : The answer isC48 H82 O41. Since water molecule is removed.
8 x6 = 48
8 x 12 = 96
8 x 6 = 48
= C48 H96 O48
Therefore 1 O and 2 H are removed from every dehydration reaction
Now you must multiply everything by 10, so:
C48H80O40
However, one OH molecule and one H molecule are combined in the
reaction, therefore an extra H2O is not removed at the
end of both sides of the chain. Therefore you must add 2H and 1O to
the formula above, therefore the final answer is:
C48 H82
O41
Add Answer to:
What would be the molecular formula for a polymer made from
eight glucose (C6H12O6) molecules
linked...
Consider a solution of glucose (C6H12O6) that was made by combining 25 g of glucose with...
Consider a solution of glucose (C6H12O6) that was made by combining 25 g of glucose with water. If the resulting solution has a volume of 540 mL, what is the molarity of glucose in the solution? Group of answer choices 0.00026 M 540 M 0.98 M 25 M 0.14 M 46 M 0.044 M 0.54 M 0.26 M 0.046 M 1 M
What is the osmotic pressure of a solution made from dissolving 35.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made from dissolving 35.0 g of glucose, C6H12O6, in 575 mL of water at 7.00 ∘C ?
What is the molecular formula of each compound? (Type your answer using the format C6H12O6 for...
What is the molecular formula of each compound? (Type your answer using the format C6H12O6 for C6H12O6 and use the same order of the elements as in the empirical formulas.) (a) empirical formula C3H6O2 ( = 74.08 g/mol) (b) empirical formula HgCl ( = 472.1 g/mol) (c) empirical formula NO2 ( = 92.02 g/mol) (d) empirical formula CHCl ( = 96.94 g/mol)
What is the osmotic pressure of a solution made by dissolving 50.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made by dissolving 50.0 g of glucose, C6H12O6, in enough water to form 475.0 mL of solution at 32.0 ∘C ?
What is the osmotic pressure of a solution made by dissolving 75.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made by dissolving 75.0 g of glucose, C6H12O6, in enough water to form 500.0 mL of solution at 45.0 ∘C ?
What is the osmotic pressure of a solution made by dissolving 25.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made by dissolving 25.0 g of glucose, C6H12O6, in enough water to form 800.0 mL of solution at 10.0 ∘C ?
What is the osmotic pressure of a solution made by dissolving 70.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made by dissolving 70.0 g of glucose, C6H12O6, in enough water to form 150.0 mL of solution at 9.00 ∘C ?
What is the osmotic pressure of a solution made by dissolving 35.0 g of glucose, C6H12O6,...
What is the osmotic pressure of a solution made by dissolving 35.0 g of glucose, C6H12O6, in enough water to form 625.0 mL of solution at 9.00 ∘C ?
5. Carbohydrates a. What is the molecular formula of all carbohydrates? How does this differ from...
5. Carbohydrates a. What is the molecular formula of all carbohydrates? How does this differ from hydrocarbons? How do monosaccharides like glucose and lactulose differ structurally if they have the same molecular formula? b. What is the function of glycoproteins? Where would you find them in a cell? How does their structure support their function? c. What is the difference between a monosaccharide, a disaccharide, an oligosaccharide, and a polysaccharide? d. What are three ways monosaccharides differ from each other?...
1. A. Draw out the polymer made from 3 molecules of propanedioic acid and 3 molecules...
1. A. Draw out the polymer made from 3 molecules of propanedioic acid and 3 molecules of ethane-1,2-diamine B. What's the by-product of this reaction? C. Break up polyester, below, into its monomers n
1. A. Draw out the polymer made from 3 molecules of propanedioic acid and 3 molecules of ethane-1,2-diamine B. What's the by-product of this reaction? C. Break up polyester, below, into its monomers n
Most questions answered within 3 hours.
-
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 1 hour ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 2 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 3 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 5 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 6 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 7 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 9 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 10 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 10 hours ago