What mass of KX (Mm= 190 g/mol) is required to prepare 555 mL of a pH...
What mass of KX (Mm= 190 g/mol) is required to prepare 555 mL of a pH = 12.10 solution? The pKa of HX is 12.82
___ g KX
Homework Answers
![HX +420 ② x +H₂O (x=kx ] x tho HX + oH giren pH=12-10 pt + polt=14 PO 14-12.10 = 1.9 [olf] = 10la = 0012619 at Equilibrium (](http://img.homeworklib.com/questions/2c778260-cf9a-11eb-96db-5d2b8312773b.png?x-oss-process=image/resize,w_560)
Add Answer to:
What mass of KX (Mm= 190 g/mol) is required to prepare 555 mL of
a pH...
What mass of KX (Mm= 150 g/mol) is required to prepare 331 mL of a pH...
What mass of KX (Mm= 150 g/mol) is required to prepare 331 mL of a pH = 12.68 solution? The pKa of HX is 11.75 g KX
What mass of KX (Mm= 180 g/mol) is required to prepare 483 mL of a pH...
What mass of KX (Mm= 180 g/mol) is required to prepare 483 mL of a pH = 12.38 solution? The pKa of HX is 12.89?
10. 0/10 points Previous Answers What mass of KX (Mm-120 g/mol) is required to prepare 525...
10. 0/10 points Previous Answers What mass of KX (Mm-120 g/mol) is required to prepare 525 mL of a pH = 12.46 solution? The pka of HX is 12.69 1.0699 x gkX Submit Answer
Consider the titration of 40.0 mL of 0.223-M of KX with 0.174-M HCl. The pKa of...
Consider the titration of 40.0
mL of 0.223-M of KX with 0.174-M HCl. The pKa of HX =
6.72. Give all pH values to 0.01 pH units.
Consider the titration of 40.0 mL of 0.223-M of KX with 0.174-M HCI. The pk, of HX = 6.72. Give all pH values to 0.01 pH units. a) What is the pH of the original solution before addition of any acid? pH = b) How many mL of acid are required to reach...
Consider the titration of 30.0 mL of 0.170-M of KX with 0.110-M HCl. The pKa of...
Consider the titration of 30.0 mL of 0.170-M of KX with 0.110-M HCl. The pKa of HX = 7.42. Give all pH values to 0.01 pH units. a) What is the pH of the original solution before addition of any acid? b) How many mL of acid are required to reach the equivalence point? c) What is the pH at the equivalence point? d) What is the pH of the solution after the addition of 26.4 mL of acid? e)...
What mass of potassium nitrate (M = 101.1 g//mol) is required to prepare 300 mL of...
What mass of potassium nitrate (M = 101.1 g//mol) is required to prepare 300 mL of 0.1 M solution? b) What will be the concentration of potassium ions if extra 10 g of potassium sulfate (M = 174.3 g/mol) are added? Assume that the volume of the salt is negligible.
Consider the titration of 50.0 mL of 0.183-M of KX with 0.090-M HCl. The pKa of...
Consider the titration of 50.0 mL of 0.183-M of KX with 0.090-M HCl. The pKa of HX = 8.13. Give all pH values to 0.01 pH units. a) What is the pH of the original solution before addition of any acid? pH = 10.70 b) How many mL of acid are required to reach the equivalence point? VA = 101.67 mL c) What is the pH at the equivalence point? pH = 4.67 d) What is the pH of the...
Calculate the number of grams of solid Tris-base (121.1 g/mol) required to prepare 250.0 mL of...
Calculate the number of grams of solid Tris-base (121.1 g/mol) required to prepare 250.0 mL of a 50.0 mM solution. Calculate the number of milliliters of 5 M NaCl required to prepare 875.0 mL of a 25 mM NaCl solution.
What mass of sodium benzoate (NaC6H5COO, MM = 144.11 g/mol) is required to create a 125....
What mass of sodium benzoate (NaC6H5COO, MM = 144.11 g/mol) is required to create a 125. mL buffer with 1.30 M benzoic acid (C6H5COOH, Ka = 6.3 * 10-5) that has a pH = 3.75? Calculate your answer in grams. Round to one decimal place and only input the number value. (Do not add a unit.)
Practice Exercise 12.25 g of the protein (molar mass = 235,000 g mol What is the...
Practice Exercise 12.25 g of the protein (molar mass = 235,000 g mol What is the osmotic pressure, mm Hq and mm H20, of a protein solution when 4.02 is used to prepare 109.7 mL of an aqueous solution at 8.3 °C? mm H20 The osmotic pressure = mm Hg =
Practice Exercise 12.25 g of the protein (molar mass = 235,000 g mol What is the osmotic pressure, mm Hq and mm H20, of a protein solution when 4.02...
10. 0/10 points Previous Answers What mass of KX (Mm-120 g/mol) is required to prepare 525 mL of a pH = 12.46 solution? The pka of HX is 12.69 1.0699 x gkX Submit Answer
Consider the titration of 40.0
mL of 0.223-M of KX with 0.174-M HCl. The pKa of HX =
6.72. Give all pH values to 0.01 pH units.
Consider the titration of 40.0 mL of 0.223-M of KX with 0.174-M HCI. The pk, of HX = 6.72. Give all pH values to 0.01 pH units. a) What is the pH of the original solution before addition of any acid? pH = b) How many mL of acid are required to reach...
What mass of potassium nitrate (M = 101.1 g//mol) is required to prepare 300 mL of 0.1 M solution? b) What will be the concentration of potassium ions if extra 10 g of potassium sulfate (M = 174.3 g/mol) are added? Assume that the volume of the salt is negligible.
Calculate the number of grams of solid Tris-base (121.1 g/mol) required to prepare 250.0 mL of a 50.0 mM solution. Calculate the number of milliliters of 5 M NaCl required to prepare 875.0 mL of a 25 mM NaCl solution.
Practice Exercise 12.25 g of the protein (molar mass = 235,000 g mol What is the osmotic pressure, mm Hq and mm H20, of a protein solution when 4.02 is used to prepare 109.7 mL of an aqueous solution at 8.3 °C? mm H20 The osmotic pressure = mm Hg =
Practice Exercise 12.25 g of the protein (molar mass = 235,000 g mol What is the osmotic pressure, mm Hq and mm H20, of a protein solution when 4.02...
Most questions answered within 3 hours.
-
You are one of the first engineers hired into the
manufacturing engineering department at a brand...
asked 45 seconds from now -
Suppose car models A, B, and C are popular among drivers.
Suppose 12% of the drivers...
asked 16 minutes ago -
write a program that finds the number of zeros in an 8-bit data
item using assembly...
asked 17 minutes ago -
Which statement is always true: The total energy of a closed
system...
A) is always equally...
asked 30 minutes ago -
find the critical value associated with a right sided hypothesis of
the mean using a sample...
asked 2 hours ago -
Which of the following statements is true with respect to a
simple linear regression model?
a....
asked 3 hours ago -
The energy required to remove an electron from a surface of a
solid element is called...
asked 4 hours ago -
How would you train your employees to avoid risks of using
mobile devices?
asked 4 hours ago -
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 5 hours ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 6 hours ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 7 hours ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 8 hours ago