IUPAC names are---
A.) 5,5-dimethylhexane-2,4-dione
B.) 3-phenylprop-2-enal
If you have any questions please comment
If you satisfied with the solution please rate it thanks....
Problem #3 Provide full IUPAC names for each molecule below: a) H₂CL 1 CH3 H₃C CH₂
Problem #3 Provide full IUPAC names for each molecule below: a) a) e ii Hgc CH₂ H₃ C CH Problem #4 Draw the major product expected from each reaction below. HS HOOH SH, H+ 2. Raney Ni нс CH3 P-TSOH CHE H₃C 5 NH₂ 1. NHANH 2. KOH, AA pH - 5 pH
Problem #3 Provide full IUPAC names for each molecule below: CH н,с сн,
5. Give IUPAC names: a. b. Cl Cl 0 CH3 CH--CH3 снз-CH2-CH-CH-C-OH Cl OH CH2CH3
Problem 47. 'rovide proper IUPAC names for each compound. CH2CH2CH3 CH2CHCH2CHCHCH; CH2CH3 CH3 48. Provide a name for the structure below. (IUPAC) CH3 419. Provide a name for the compound below. ĆUPAC) CH; CH,CECCHCH,CH2CH3 50. Provide the correct IUPAC name for the following compound. NOZ G CH 57. Give an acceptable name for the following substance. I UPAC HOCH,CH,OH S. Provide the IUPAC name for the structure below. H NO2 1. 53. Provide the IUPAC name for the following structure....
6. Provide IUPAC names for the following compounds (E-G). Name: H₃ C. CH3 CH, E Name: H₃C CH3 CH F Name: HO OH сна G
CH3 6. Assign IUPAC names for each of the following compounds: d) CHS-C-CH3 CH₂CH3 CH2CH2 C H2CH2CH3 CH3-CH2-CH2-C-CH2-CH2-C-CH3 H2 CH₂ CH₂ H CH2CH3
1. (12 points) Provide the IUPAC name for each molecule shown: нсон CHE CH3 CH₂ d. (CH).CCH=CCl2 Hz нус 2. (12 points) Provide a structure for each named molecule: a. cis-3-bromocylopentanol C. 2-cyclobutyl-2-propanol b. (E)-3-chloro-3-heptene d. trans-1,2-divinylcyclohexane 1 Pa
Problem #3 Provide the full IUPAC name for the following molecule. НАС H₂O
Provide the IUPAC names of the following compounds. (a) CH2CH2C=CCOOH (b) CH2CH(CH3)CHBCOOH (c) (CH3)2C=CHCOOH NO2 CH, COOH d) COOH O, NVNO
1. Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 CH3C(CH3)CH2 CH2O CH3CH(NH2)CH3 CH3OCH2CH2CH3 CH(CH3)2COOH For the list above I currently put the following as the IUPAC names. If any are wrong can you please correct them! Give systematic IUPAC names for each of the following: CH3CH2C(CH3)2CH(CH2CH3)CH3 IUPAC Name: 3,3,4-trimethylhexane IUPAC Name: 3-methyl-4-ol-heptane CH3C(CH3)CH2 IUPAC Name: 2-methylpropene CH2O IUPAC Name: methanal CH3CH(NH2)CH3 IUPAC Name: isopropylamine CH3OCH2CH2CH3 IUPAC Name: methoxyethane (ethyl methyl ether) CH(CH3)2COOH IUPAC Name: 2-methylpropanoic acid