complete the reaction CH3 8) TÖ + HNO3 / 4.50 HNO 9) DJ CHICHS COOH +...
Question A4 In the laboratory you performed the following reaction. W CH3! HNO3, H2SO4 Toluene (a) What is the electrophile that reacts with the aromatic ring? [1 mark] (b) Complete the following equation for the formation of the electrophile in part (a)? HNO3 + H2SO4 HNO, + H30. — C C + HS0, + HSO4 (C) [2 marks] Using curly arrows, draw the mechanism of the substitution of the electrophile with Toluene to form the product.
Question 8 What is the major organic product obtained from the following reaction? COOH OOOH COOH COOH COOH -NO2 HNO, H2SO4 "NO2 Br Br Br NO2 2 Br 4 3 1 a. 1 b. 2 C. 3 d. 4
*12. What sequence of reagents is needed to complete the following reaction! Answer: COOH NO2 A. 1. CHCI, AICI, , 2. HNO3, H2SO4 3. KMnO4, 100 °C B. 1. HNO3, H2SO4 2. KMnO4, 100 °C, 3. CH3CI, AICI3, C. 1. CH3CI, AICI3, 2. KMnO4, 100 °C, 3. HNO3, H2SO4 D. 1. KMnO4, 100 °C, 2. CH3CI, AICl3, 3. HNO3, H2SO4
Circle the alcohol that is used to produce acetic acid
(CH3-COOH) by an oxidation reaction
Circle the alcohol that is used to produce acetic acid (CH3-COOH) by an oxidation reaction a) CH_3 OH b) H_3 CH_2 OH c) CH_3 CH_2 CH_2 OH d) CH_3 CH(OH) CH_3
Question 47 What is the major organic product of the reaction shown? CH3-(CH3 -COOH + CH3-CH-CH3 - > ??????? OH Question 47 options: OH CH3-(CH2)3-2-0-CH-CH2-CH3 CH3C(CH3)3-CH CH-(CH3)2 CH3-(CH2)2-2-0-C-(CH3)2 CH3-(CH2) 3-2-0-CH-(CH3)2 CH3CH2CH2CH2OCH2OCH(CH3)2
Predict the product of the following reaction. OsO4. (CH3),COOH (CH3)3COH, NaOH OH 0 ОН "OH + enantiomer o H OH + enantiomer OH OH + enantiomer
solve
OCH₃ - 9. Clz FeCl3 FeCl3 2 HNO3 H₂sou -OCH3 3. 10. Chyelili CH3 CCI AlCl3 Aldiz 4 AlCl3 H-M een 5. Br2> Fe Biz 6. -(CH3 HNO3 H₂504 roz CLE Cl2 FeCl3 cl 8. Brzy Fe Bra
9) What is the product of the following reaction! H,CrO4 ? Δ COOH COOH IV. I. COOH COOH COOH "COOH V. II. COOH COOH III. D) IV E) V C) IT B) II A) 1
A solution of HNO, is standardized by reaction with pure sodium carbonate. 2H Na,CO, » 2 Na* +H,O + CO2 A volume of 27.48 ± 0.05 mL of HNO3 solution was required for complete reaction with 0.8371 ± 0.0008 g of Na,CO3, (FM 105.988 0.001 g/mol). Find the molarity of the HNO solution and its absolute uncertainty Note: Significant figures are graded for this problem. To avoid rounding errors, do not round your answers until the very end of your...
please answer all. thank you!
Predict the product of the following reaction. OsO4, (CH3),COOH (CH3)3COH, NaOH ЕН ОН + enantiomer Орон ОН ОН + enantiomer ОН ОН + enantiomer НО НО PhP Predict the product of the following reaction. 1. MgBr 2. H3O+ o OH + enantiomer O OH + enantiomer OH + enantiomer OH + enantiomer