Why are all organisms on Earth expected to have differing optimum functional temperatures?
Why are all organisms on Earth expected to have differing optimum functional temperatures?
Homework Answers
answr because
1.the different oraganism have different tolerance to temperature stress.
2.many organisms are not thermocinformers .many animals and plants use certain activities to get control over body temperatures .
3.an orgaisms thermal sensitivity isnt constant but often shifts to acute heat shocks or to seasonal hibernation.
4.many organisms are not active during whole season mostly in arctic reason.
Add Answer to:
Why are all organisms on Earth expected to have differing
optimum functional temperatures?
Why do organisms have differing optimal temperatures?
Why do organisms have differing optimal temperatures?
1). what is scientific explanation for why all organisms on earth have DNA, RNA, and use...
1). what is scientific explanation for why all organisms on earth have DNA, RNA, and use ATP? 2). what are homologous structures? give a real world example of homologous structures.
Why most enzymes have an optimum pH of around 7 while pepsin will be optimum at...
Why most enzymes have an optimum pH of around 7 while pepsin will be optimum at ph 2? Give a detail explanation!
In this course we surveyed some of the major kinds of organisms on Earth, all of...
In this course we surveyed some of the major kinds of organisms on Earth, all of which contribute to our planet's biodiversity. List and explain THREE ways that biodiversity contributes to the general functioning of ecosystems. Your answer should include consideration of some of major kinds of organisms covers in class, and the key roles those organisms play (energy capture and transformation, symbiosis, predation, parasitism, photosynthesis). Conclude with a brief assessment of the possible negative impact(s) of species extinction (i.e....
In this course we surveyed some of the major kinds of organisms on Earth, all of...
In this course we surveyed some of the major kinds of organisms on Earth, all of which contribute to our planet's biodiversity. Using examples drawn from the class, describe some of the ways that biodiversity contributes to the general functioning of ecosystems. Your answer might include consideration of some of major kinds of organisms covers in class, and the key roles those organisms play (energy capture and transformation, symbiosis, predation, parasitism, photosynthesis, mutualisms...). Conclude with a brief assessment of the...
In general, why do organisms that have high survivorship have low fecundity? In general, organisms have...
In general, why do organisms that have high survivorship have low fecundity? In general, organisms have a finite (i.e., limited) amount of energy that can be used for either promoting survival or promoting reproduction. o Organisms that produce lots of offspring don't need to survive for long periods of time. O Organisms that are capable of surviving long periods of time don't need to produce lots of offspring. This is an adaptation that organisms with high survivorship have acquired.
if the original atmosphere of earth lacked oxygen, The first organisms can have Carried on anaerobic...
if the original atmosphere of earth lacked oxygen, The first organisms can have Carried on anaerobic respiration Been eukaryotic Carried on aerobic respiration Produced ozone
Lab Exercise 4B ins with a higher 9. Why do organisms found at low temperature have...
Lab Exercise 4B ins with a higher 9. Why do organisms found at low temperature have membrane proteins with a percentage of alpha helices compare to beta sheets? 10. Are amino acids outside the active site important for optimal function of the Explain your response. 11. Homologous sequences: A. are expected to have very similar sequences in related organisms B. are expected to have similar sequences in related proteins but from unrelated distantly related organisms C. may have become similar...
a) Will all gram positive organisms grow on a rose agar plate? ecplain why or why...
a) Will all gram positive organisms grow on a rose agar plate? ecplain why or why not. b) Will all gram negative organisms grow on a MAC agar plate? explain why or why not. c) Can colony morphology be done from a MAC or Rose agar plate? why or why not.
6. The lipid membranes of organisms that live in extremely cold environments have glycerophosphol...
6. The lipid membranes of organisms that live in extremely cold environments have glycerophospholipids that contain an increased percentage of unsaturated fatty acid tails (as compared to organisms that live in more moderate temperatures). Why would this be the case? Provide an explanation based on the fluidity of the lipid membrane. 7. Given its composition and structure, do you think K" ion or indolewould ) would be able to better move through the lipid membrane? Provide an explanation based on...
In general, why do organisms that have high survivorship have low fecundity? In general, organisms have a finite (i.e., limited) amount of energy that can be used for either promoting survival or promoting reproduction. o Organisms that produce lots of offspring don't need to survive for long periods of time. O Organisms that are capable of surviving long periods of time don't need to produce lots of offspring. This is an adaptation that organisms with high survivorship have acquired.
Lab Exercise 4B ins with a higher 9. Why do organisms found at low temperature have membrane proteins with a percentage of alpha helices compare to beta sheets? 10. Are amino acids outside the active site important for optimal function of the Explain your response. 11. Homologous sequences: A. are expected to have very similar sequences in related organisms B. are expected to have similar sequences in related proteins but from unrelated distantly related organisms C. may have become similar...
6. The lipid membranes of organisms that live in extremely cold environments have glycerophospholipids that contain an increased percentage of unsaturated fatty acid tails (as compared to organisms that live in more moderate temperatures). Why would this be the case? Provide an explanation based on the fluidity of the lipid membrane. 7. Given its composition and structure, do you think K" ion or indolewould ) would be able to better move through the lipid membrane? Provide an explanation based on...
Most questions answered within 3 hours.
-
Assume Kw = 1.01 ✕ 10−14
For pure water, we can calculate [H3O+ ] = [OH...
asked 17 minutes ago -
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 1 hour ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 1 hour ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 3 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 3 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 4 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 6 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 6 hours ago