1Of the permeable of potassium ions decrease, what would happen to the membrane potential? depolarize is...
1Of the permeable of potassium ions decrease, what would happen to the membrane potential? depolarize is this correct?
2/What will happen to the resting membrane potential if you add potassium ions to the extracellular fluid? it will decrease is this correct
3/ What is oxygen used for in cellular respiration?
a/to accept carbon from the citric acid cycle, creating C02
b./to accept hydrogen from NADH, refreshing NAD+, creating H20
which one is correct
Homework Answers
1) If permeable of potassium ions decreases, it would decrease the membrane potential (depolarize the cell) because reduction in equilibrium potential for potassium will mean less potential will diffuse out of the cell, leaving internal more positive than before.
2) If extracellular potassium concentration increases, then the potassium gradient across cell membrane decreases therefore resting membrane potential will become more positive.
3) Oxygen is used in cellular respiration by the cell which help them to convert glucose into energy.
Add Answer to:
1Of the permeable of potassium ions decrease, what would happen
to the membrane potential? depolarize is...
1. There's a branching point in cellular respiration involving pyruvate. Pyruvate can undergo lactic acid fermentation...
1. There's a branching point in cellular respiration involving pyruvate. Pyruvate can undergo lactic acid fermentation or enter the mitochondria to enter the citric acid cycle. What determines what happens to pyruvate? A. Energy demands of the cell B. 15% concentrated power of will C. pH of the intracellular fluid D. Presence/absence of oxygen In the fed state, how is glucose used in the body? Select all correct answer choices. A. Used in glycogenesis to create glycogen in skeletal muscles...
In its resting state, the membrane surrounding a neuron is permeable to potassium ions but only...
In its resting state, the membrane surrounding a neuron is
permeable to potassium ions but only slightly permeable to sodium
ions. Thus, positive K ions can flow through the membrane in an
attempt to equalize K concentration, but Na ions cannot as quickly.
This leads to an excess of Na ions outside of the cell. If the
space outside the cell is defined as zero electric potential, then
the electric potential of the interior of the cell is negative.
This...
Draw a graph showing what would happen to resting membrane potential over time, if the sodium/potassium...
Draw a graph showing what would happen to resting membrane potential over time, if the sodium/potassium pump were not functioning. How would this affect a neuron's ability to produce action potentials? What does this imply about the quantity of ions that normally cross the membrane during the course of an action potential?
The amphipathie antibiotic, Valinomycin, is capable of facilitating diffusion of potassium ions because it can effectively...
The amphipathie antibiotic, Valinomycin, is capable of facilitating diffusion of potassium ions because it can effectively replace the solvation shell of the ion while being able to diffuse through the plasma membrane. What would happen if all of the potassium ion channels were blocked and then valinomycin was added to the cells immediately after? Consider that the experiment is performed on neurons in the resting state and other ion channels are intact. U K would be transported inside the neuron,...
6) Explain what would happen if someone took the drug DNP (dinitrolphenol). DNP allows H+ ions...
6) Explain what would happen if someone took the drug DNP (dinitrolphenol). DNP allows H+ ions to flow down the concentration gradient and across the inner mitochondrial membrane without going through the ATP Synthase. Why would this be a problem for Cell Respiration? You may want to refer to your diagram of the ETC to help you. Answer this in 3-5 well crafted sentences. 7) Describe what happens to the free energy of the carbon molecules through Cell Respiration. Your...
1. The Mystery of the Seven Deaths-- The results in Part III suggests which process of...
1. The Mystery of the Seven Deaths--
The results in Part III suggests which process of respiration
[glycolysis, pyruvate processing, citric acid cycle, or the
electron transport chain] was affected? Why is this the process you
suspect [based on the results]?
Does cyanide poisoning increase ATP production or decrease it?
Explain your answer.
2. The effect of gramicidin--
List the one(s) that would remain the same.
List the one(s) that would decrease (or go to zero).
List the one(s) that...
During the aerobic metabolism of glucose, glucose is ____________. Reduced to form water Oxidized to form...
During the aerobic metabolism of glucose, glucose is ____________. Reduced to form water Oxidized to form water Reduced to form CO2 Oxidized to form CO2 Which of the following describes the equation: FAD + XH2 à FADH2 + X. FAD is reduced to FADH2 It is a coupled reduction – oxidation reaction XH2 is oxidized to X All of the above Which of the following is FALSE about glycolysis? The initial steps of glycolysis requires energy derived from the splitting...
Q2. The release of ATP by the beta subunit is most directly dependent on: Select ONE...
Q2.
The release of ATP by the beta subunit is most directly
dependent on:
Select ONE option:
1. the flow of protons from the intermembrane space to the
matrix.
2. the rotation of the c-ring in the membrane.
3. the passage of electrons along the electron transport
chain.
4. a conformational change in the beta subunit.
Q3.
What defines the direction of rotation of the c-ring in the F0
complex?
(Select ALL that apply.)
1. Amino acids side chains in...
09. What goes into the Krebs cycle a. Acetyl c. Pyruvate Q9. What is made in...
09. What goes into the Krebs cycle a. Acetyl c. Pyruvate Q9. What is made in Krebs cycle but not in glycolysis? . NADH b FADH C. ATP Q10. How is ventilation stimulated? a. Chemoreceptors detect low blood ph b. Chemoreceptors detect high blood pH Q11. Which of the following is an example of negative feedback? a. Low oxygen detected by peripheral chemoreceptors causes ventilation to increase b. High oxygen detected by peripheral chemoreceptors causes ventilation to increase 12. What...
change pas channels in the volta t ive protein to change shape. This A of the...
change pas channels in the volta t ive protein to change shape. This A of the S l e terminal siste oplasmic reticum calcio p r eneule warcoplasm reticulum sodium ions m o nster transverse tubules sarcolemma: calcium ions Saroplasmic reticum: triadsarcolemma: calcium ions sons bind to This causes a change in shape and exposing C D E Calcium vesicle tylcholine action potential Sodium sarcolemma calcium on myosin heads Sodium sacoplasmic reticulum calcium ions actin 15. An attaches to exposed...
In its resting state, the membrane surrounding a neuron is
permeable to potassium ions but only slightly permeable to sodium
ions. Thus, positive K ions can flow through the membrane in an
attempt to equalize K concentration, but Na ions cannot as quickly.
This leads to an excess of Na ions outside of the cell. If the
space outside the cell is defined as zero electric potential, then
the electric potential of the interior of the cell is negative.
This...
The amphipathie antibiotic, Valinomycin, is capable of facilitating diffusion of potassium ions because it can effectively replace the solvation shell of the ion while being able to diffuse through the plasma membrane. What would happen if all of the potassium ion channels were blocked and then valinomycin was added to the cells immediately after? Consider that the experiment is performed on neurons in the resting state and other ion channels are intact. U K would be transported inside the neuron,...
6) Explain what would happen if someone took the drug DNP (dinitrolphenol). DNP allows H+ ions to flow down the concentration gradient and across the inner mitochondrial membrane without going through the ATP Synthase. Why would this be a problem for Cell Respiration? You may want to refer to your diagram of the ETC to help you. Answer this in 3-5 well crafted sentences. 7) Describe what happens to the free energy of the carbon molecules through Cell Respiration. Your...
1. The Mystery of the Seven Deaths--
The results in Part III suggests which process of respiration
[glycolysis, pyruvate processing, citric acid cycle, or the
electron transport chain] was affected? Why is this the process you
suspect [based on the results]?
Does cyanide poisoning increase ATP production or decrease it?
Explain your answer.
2. The effect of gramicidin--
List the one(s) that would remain the same.
List the one(s) that would decrease (or go to zero).
List the one(s) that...
Q2.
The release of ATP by the beta subunit is most directly
dependent on:
Select ONE option:
1. the flow of protons from the intermembrane space to the
matrix.
2. the rotation of the c-ring in the membrane.
3. the passage of electrons along the electron transport
chain.
4. a conformational change in the beta subunit.
Q3.
What defines the direction of rotation of the c-ring in the F0
complex?
(Select ALL that apply.)
1. Amino acids side chains in...
09. What goes into the Krebs cycle a. Acetyl c. Pyruvate Q9. What is made in Krebs cycle but not in glycolysis? . NADH b FADH C. ATP Q10. How is ventilation stimulated? a. Chemoreceptors detect low blood ph b. Chemoreceptors detect high blood pH Q11. Which of the following is an example of negative feedback? a. Low oxygen detected by peripheral chemoreceptors causes ventilation to increase b. High oxygen detected by peripheral chemoreceptors causes ventilation to increase 12. What...
change pas channels in the volta t ive protein to change shape. This A of the S l e terminal siste oplasmic reticum calcio p r eneule warcoplasm reticulum sodium ions m o nster transverse tubules sarcolemma: calcium ions Saroplasmic reticum: triadsarcolemma: calcium ions sons bind to This causes a change in shape and exposing C D E Calcium vesicle tylcholine action potential Sodium sarcolemma calcium on myosin heads Sodium sacoplasmic reticulum calcium ions actin 15. An attaches to exposed...
Most questions answered within 3 hours.
-
Suppose that on a temperature scale X, water boils at 203.0°X
and freezes at -105.7°X. What...
asked 26 minutes ago -
BaS crystallizes in a cubic unit cell with S2- ions on each
corner and each face....
asked 57 minutes ago -
A. 0≤P(Oi)≤10≤P(Oi)≤1 for each i
B. P(Oi)≤0P(Oi)≤0
C. P(Oi)=1+P(OCi)P(Oi)=1+P(OiC)
D. P(Oi)≥1P(Oi)≥1
If an experiment consists of...
asked 2 hours ago -
A battery has an emf of 9.20V and an internal resistance of 1.20
ohm. a)What resistance...
asked 2 hours ago -
The area of an elastic circular loop decreases at a constant
rate, dA/dt = −6.60×10−3 m2/s...
asked 3 hours ago -
The denaturation of proteins can be described by the
equilibrium
F⇌U
where F and U represent...
asked 5 hours ago -
Please answer what the maximum and minimum force is, and the
angle on the ion is...
asked 5 hours ago -
implement a program that reads a number of rows and a symbol.
The program will draw...
asked 5 hours ago -
Assume that when adults with smartphones are randomly selected,
45% use them in meetings or classes....
asked 5 hours ago -
Determine the number of formula units of
Na2SO4 and moles of oxygen contained in 8.11
moles...
asked 5 hours ago -
Explain in steps on the following code
What would be the output when executed
using System;...
asked 5 hours ago -
Given the information in the table, which of the following
statements is CORRECT?
Stock A
Stock...
asked 5 hours ago